You are on page 1of 28

Phuong trinh dau

Fe(CrO2)2 + K2CO3 + O2 = Fe2O3 +


K2CrO4 + CO2
Fe2O3 + HBr = H2O + FeBr3
Fe + O2 = FeO
Fe + O2 = Fe2O3
FeS2+O2=Fe2O3+SO2
Fe2O3 + HClO4 = Fe(ClO4)3 + H2O
FeS2+O2=Fe2O3+SO2
Fe3+ + I = Fe2+ + I2
Fe(OH)3 (s) + HNO3 (aq) = H2O (l) +
Fe(NO3)3 (aq)
FeS+HCl = FeCl2+H2S
Fe2O3 + HClO4 = Fe(ClO4)3 + H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
Fe+CuCl2=FeCl2+Cu
Fe3Br + CuS = BrS + Fe3Cu
FeCl2 + Na3PO4 = NaCl + Fe3(PO4)2
Fe3+ + I = Fe2+ + I2
FeS + HCl = FeCl2 + H2S
Fe+Pb(NO3)2=Fe(NO3)2+Pb
Fe +Na2S=FeS+Na
Fe(NO3)3+H2O=Fe(OH)3+HNO3
Fe3O4(s)+CO(g)=Fe(s)+CO2(g)
Fe3O4(s)+H2(g)=Fe(s)+H2O(g)
FeCl3 + NaOH = Fe(OH)3 + NaCl
Fe(OH)3(s) + H2SO4(aq)=Fe2(SO4)3(aq)
+H2O(l)
Fe(OH)3(s) + H2SO4(aq)=Fe2(SO4)3(aq)
+H2O(l)
Fe+O2=Fe2O3
Fe + S8 = FeS8
Fe +S8 = FeS
Fe + S8 = FeS
Fe +S8 = FeS8
Fe2O3+2CO=Fe+CO2
Fe2O3+CO=Fe+CO2
Fe+O2=Fe2O3
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)

Can bang phuong trinh


4Fe(CrO2)2 + 8K2CO3 + 7O2 = 2Fe2O3 +
8K2CrO4 + 8CO2
Fe2O3 + 6HBr = 3H2O + 2FeBr3
2Fe + O2 = 2FeO
4Fe + 3O2 = 2Fe2O3
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
0Fe3+ + 2I = 0Fe2+ + I2
Fe(OH)3(s) + 3HNO3(aq) = 3H2O(l) +
Fe(NO3)3(aq)
FeS + 2HCl = FeCl2 + H2S
Fe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + CuCl2 = FeCl2 + Cu
Fe3Br + CuS = BrS + Fe3Cu
3FeCl2 + 2Na3PO4 = 6NaCl + Fe3(PO4)2
0Fe3+ + 2I = 0Fe2+ + I2
FeS + 2HCl = FeCl2 + H2S
Fe + Pb(NO3)2 = Fe(NO3)2 + Pb
Fe + Na2S = FeS + 2Na
Fe(NO3)3 + 3H2O = Fe(OH)3 + 3HNO3
Fe3O4(s) + 4CO(g) = 3Fe(s) + 4CO2(g)
Fe3O4(s) + 4H2(g) = 3Fe(s) + 4H2O(g)
FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
6H2O(l)
2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
6H2O(l)
4Fe + 3O2 = 2Fe2O3
Fe + S8 = FeS8
8Fe + S8 = 8FeS
8Fe + S8 = 8FeS
Fe + S8 = FeS8
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3CO = 2Fe + 3CO2
4Fe + 3O2 = 2Fe2O3
FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)

FeS+HCl=FeCl2+H2S
FeS + 2HCl = H2S + FeCl2
Fe2O3 + H2 = Fe + H2O
Fe2P+FeS2=FeS+P4S10
Fe2O3 + C = Fe +CO2
Fe+O2=Fe2O3
FeS+HCl=FeCl2+H2S
FeCl2+Cl2=FeCl3
FeO(OH) = Fe2O3 + H2O
Fe2O3 + CO = Fe + CO2
Fe+Se=2FeSe
Fe+S2=2FeS
Fe+O2=2FeO
Fe(NO3)3+Na3SO4=NaNO3+FeSO4
Fe(NO3)3=Fe2O3 + NO2 +O2
Fe2O3 + HClO4=Fe(ClO4)3 + H2O
Fe + O2 + H2O = Fe(OH)2
Fe + H2SO4 = FeSO4 + H2
Fe + HSO4 = FeSO4 + H2
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)
FeS+HCl=FeCl2+H2S
Fe + O = Fe2O3
Fe2O3+CO=Fe+CO2
Fe2O3+CO=Fe+CO2
Fe+AgNO3=Fe(NO3)2+Ag
Fe+AgNO3=Fe(NO3)3+Ag
Fe3O4+H2=Fe+H2O
Fe(OH)3 + H2SO4 = Fe2(SO4)3 +H2O
Fe2O3 + CO = Fe + CO2
FeCl2+KMnO4+HCl=FeCl3+MnCl2+KCl+
H2O
Fe +Cd2+= Cd+Fe2
Fe(NO3)3 + NaOH = Fe(OH)3 + NaNO3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O
FeCl3+Mg= Fe+ MgCl2
Fe2O3(s) + CO(g) = Fe(s) + CO2(g)
Fe+O2=Fe2O3
FeCl3+NaCO2=FeCO2+NaCl3

FeS + 2HCl = FeCl2 + H2S


FeS + 2HCl = H2S + FeCl2
Fe2O3 + 3H2 = 2Fe + 3H2O
4Fe2P + 18FeS2 = 26FeS + P4S10
2Fe2O3 + 3C = 4Fe + 3CO2
4Fe + 3O2 = 2Fe2O3
FeS + 2HCl = FeCl2 + H2S
2FeCl2 + Cl2 = 2FeCl3
2FeO(OH) = Fe2O3 + H2O
Fe2O3 + 3CO = 2Fe + 3CO2
Fe + Se = FeSe
2Fe + S2 = 2FeS
2Fe + O2 = 2FeO
Fe(NO3)3 + Na3SO4 = 3NaNO3 + FeSO4
4Fe(NO3)3 = 2Fe2O3 + 12NO2 + 3O2
Fe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
2Fe + O2 + 2H2O = 2Fe(OH)2
Fe + H2SO4 = FeSO4 + H2
2Fe + 2HSO4 = 2FeSO4 + H2
FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
FeS + 2HCl = FeCl2 + H2S
2Fe + 3O = Fe2O3
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe + 2AgNO3 = Fe(NO3)2 + 2Ag
Fe + 3AgNO3 = Fe(NO3)3 + 3Ag
Fe3O4 + 4H2 = 3Fe + 4H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + 3CO = 2Fe + 3CO2
5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + MnCl2 +
KCl + 4H2O
2Fe + 0Cd2+ = 0Cd + Fe2
Fe(NO3)3 + 3NaOH = Fe(OH)3 + 3NaNO3
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
2FeCl3 + 3Mg = 2Fe + 3MgCl2
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
4Fe + 3O2 = 2Fe2O3
FeCl3 + NaCO2 = FeCO2 + NaCl3

Fe + O2 = Fe2O3
FeS + HCl = FeCl2 + H2S
FeCl3 +KOH = Fe(OH)3 + KCl
Fe + H2O =FeO + H2
Fe2O3 + CO = Fe + CO2
Fe+S=Fe2S3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
Fe2O3 + H2 =Fe + H2O
Fe3O4 + C = Fe + CO2
FeS +HCl=FeCl2+H2S
FeO(s)+C(s)=Fe(l)+CO2(g)
Fe2O3+CO=Fe+CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
Fe2O3(s) + 14HNO3(aq) = 15Fe(NO3)3(aq)
+ 16H2O(l)
FeS + HCl = FeCl2 + H2S
Fe3P2 + S = P4S10 + FeS
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
F2 + NaCl = NaF + Cl2
Fe+H2O=Fe3O4+H2
FATSO=FATSO
Fe(OH)3+H2SO4 = Fe2(SO4)3+H2O
Fe3O4 + O2 = Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)
+H2O(l)
Fe +S=Fe2S3

4Fe + 3O2 = 2Fe2O3


FeS + 2HCl = FeCl2 + H2S
FeCl3 + 3KOH = Fe(OH)3 + 3KCl
Fe + H2O = FeO + H2
Fe2O3 + 3CO = 2Fe + 3CO2
2Fe + 3S = Fe2S3
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3 + 3H2 = 2Fe + 3H2O
Fe3O4 + 2C = 3Fe + 2CO2
FeS + 2HCl = FeCl2 + H2S
2FeO(s) + C(s) = 2Fe(l) + CO2(g)
Fe2O3 + 3CO = 2Fe + 3CO2
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) +
3H2O(l)
FeS + 2HCl = FeCl2 + H2S
2Fe3P2 + 16S = P4S10 + 6FeS
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
F2 + 2NaCl = 2NaF + Cl2
3Fe + 4H2O = Fe3O4 + 4H2
FATSO = FATSO
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
4Fe3O4 + O2 = 6Fe2O3
2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
6H2O(l)
2Fe + 3S = Fe2S3
FeC2O4*2H20 + 0H2O2 = FeC2O4 + 0OH- +
FeC2O4*2H20+H2O2=FeC2O4+OH-+H20
2H20
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe3O4 + O2 = Fe2O3
4Fe3O4 + O2 = 6Fe2O3
Fe2O3+CO=Fe+CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe(s) + S(s) = Fe2S3(s)
2Fe(s) + 3S(s) = Fe2S3(s)
Fe(s) + O2(g) = Fe2O3(s)
4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe+O2=Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe2P+FeS2=FeS+P4S10
4Fe2P + 18FeS2 = 26FeS + P4S10
FeCl2+Cl2=FeCl3
2FeCl2 + Cl2 = 2FeCl3
Fe2P+FeS2=FeS+P2S5
2Fe2P + 9FeS2 = 13FeS + P2S5
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)
FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
Fe2P+FeS2=Fe2S5+P2S5
2Fe2P - 30FeS2 = -13Fe2S5 + P2S5

Fe + H2SO4 = Fe2(SO4)3 + H2
2Fe + 3H2SO4 = Fe2(SO4)3 + 3H2
Fe + S2 = FeS
2Fe + S2 = 2FeS
Fe + S = FeS
Fe + S = FeS
Fe2O3 + C = Fe + CO2
2Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 = Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe(NO3)3 + NH4OH = Fe(OH)3 +
Fe(NO3)3 + 3NH4OH = Fe(OH)3 + 3NH4(NO3)
NH4(NO3)
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(NO3)2+KOH=Fe(OH)2+K(NO3)
Fe(NO3)2 + 2KOH = Fe(OH)2 + 2K(NO3)
Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl2+H2O2+HCl=FeCl3+H2O
2FeCl2 + H2O2 + 2HCl = 2FeCl3 + 2H2O
Fe2O3(s) + C(s) = Fe(s) + CO2(g)
2Fe2O3(s) + 3C(s) = 4Fe(s) + 3CO2(g)
Fe2O3 + HClO4 = Fe(ClO4)3 + H2O
Fe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
Fe + S = Fe2S3
2Fe + 3S = Fe2S3
Fe+H2O=Fe3O4+H2
3Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+HCl=FeCl3+H2O
Fe2O3 + 6HCl = 2FeCl3 + 3H2O
Fe+AgNO3=Fe(NO3)2+Ag
Fe + 2AgNO3 = Fe(NO3)2 + 2Ag
FeS2+O2=Fe2O3+SO2
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
FeCl3 + NaOH = NaCl + Fe(OH)3
FeCl3 + 3NaOH = 3NaCl + Fe(OH)3
Fe + O2 = Fe2 O3
4Fe + 3O2 = 2Fe2O3
Fe2O3(s)+CO(g)=Fe(s)+CO2(g)
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe2(SO4)3+KOH=K2+SO4+Fe(OH)
Fe2(SO4)3 + 2KOH = K2 + 3SO4 + 2Fe(OH)
Fe2O3+CO=Fe+CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+H2=Fe+H2O
Fe2O3 + 3H2 = 2Fe + 3H2O
Fe+O2=Fe2O3
4Fe + 3O2 = 2Fe2O3
F2+O2=F2O3
2F2 + 3O2 = 2F2O3
Fe--- + Na2SO3 + H+ = SO4-- + Fe++ + Na+ 2Fe--- - 5Na2SO3 + 10H+ = -5SO4-- + 2Fe++ + H2O
10Na+ + 5H2O
FeCl3+NaOH=Fe(OH)3+NaCl
FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
FeCl3+NaOH=Fe(OH)3+NaCl
FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe--- + Na2SO3 + H+ = SO4-- + Fe++ +
2Fe--- - 5Na2SO3 + 20H+ = -5SO4-- + 2Fe++ NaOH + H2O
10NaOH + 15H2O
Fe3O4+HNO3=Fe(NO3)3+NO2+H2O
Fe3O4 + 10HNO3 = 3Fe(NO3)3 + NO2 + 5H2O
FeS+HCl = FeCl2+H2S
FeS + 2HCl = FeCl2 + H2S
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)
FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
F2 + 2Al2O3 = 3AlF3 +4O2
6F2 + 2Al2O3 = 4AlF3 + 3O2
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3+HCl+H2O=Fe2O4H3Cl
Fe2O3 + HCl + H2O = Fe2O4H3Cl
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + 10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 +

K2SO4 + MnSO4 + H2O


FeS2 + O2 = Fe2O3 + SO2
FeS2 + O2 = Fe2O3 + SO2
Fe(OH)3 +H2SO4=Fe2(SO4)3+H2O
Fe2O3(s) + HNO3(aq) = Fe(NO3)3(aq) +
H2O(l)
Fe2O3 + CO = CO2 + Fe

K2SO4 + 2MnSO4 + 8H2O


4FeS2 + 11O2 = 2Fe2O3 + 8SO2
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) +
3H2O(l)
Fe2O3 + 3CO = 3CO2 + 2Fe
Fe2O3(s) + 6HNO3(aq) = 2Fe(NO3)3(aq) +
Fe2O3(s)+HNO3(aq)=Fe(NO3)3(aq)+H2O(l)
3H2O(l)
FeS2 + O2 = Fe2O3 + SO2
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe (OH)3+H2SO4 = Fe2 (SO4)3 + H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS+HCl=FeCl2+H2S
FeS + 2HCl = FeCl2 + H2S
F2+H2O=HF+O2
2F2 + 2H2O = 4HF + O2
Fe2O3+CO=Fe+CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)3 + NH3 + H2O = Fe(OH)3 +
Fe(NO3)3 + 3NH3 + 3H2O = Fe(OH)3 +
NH4NO3
3NH4NO3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS2+O2=Fe2O3+SO2
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe + H2O = FeO + H2
Fe + H2O = FeO + H2
FeS2+HNO3+HCl=FeCl3+H2SO4+NO+H2 FeS2 + 5HNO3 + 3HCl = FeCl3 + 2H2SO4 +
O
5NO + 2H2O
Fe+H2SO4=Fe2(SO4)3+H2S+H2O
8Fe + 15H2SO4 = 4Fe2(SO4)3 + 3H2S + 12H2O
FeSO4+KMnO4+H2SO4=Fe2(SO4)3+K2SO 10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 +
4+MnSO4+H2O
K2SO4 + 2MnSO4 + 8H2O
FeS+HCl=FeCl2+H2S
FeS + 2HCl = FeCl2 + H2S
FeS2+O2=Fe2O3+SO2
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe+H2O=Fe3O4+H2
3Fe + 4H2O = Fe3O4 + 4H2
Fe2O3+H2O=Fe(OH)3
Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3=Fe2O3+H2O
2Fe(OH)3 = Fe2O3 + 3H2O
Fe2O3+ FeTiO3 + H2SO4 = FeSO4 +
0Fe2O3 + FeTiO3 + 2H2SO4 = FeSO4 +
TiOSO4 + H2O
TiOSO4 + 2H2O
Fe2O3+ FeTiO3 + H2SO4 = FeSO4 +
0Fe2O3 + FeTiO3 + 2H2SO4 = FeSO4 +
TiOSO4 + H2O
TiOSO4 + 2H2O
FeTiO3 + H2SO4 = FeSO4 + TiOSO4 +
FeTiO3 + 2H2SO4 = FeSO4 + TiOSO4 + 2H2O
H2O
Fe2O3+ CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
FeO3 + Al = Fe + Al2O3
FeO3 + 2Al = Fe + Al2O3
Fe + Br 2 = 2 FeBr2
Fe + Br2 = FeBr2
Fe2O3(s) + CO(g) = 2Fe(s) + CO2(g)
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)

Fe(OH)2 + H2O +O2 = Fe(OH)3


FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 +
Cr2(SO4)3 + K2SO4 + H2O
Fe+O2=Fe2O3
FeS + HCl = FeCl2 + H2S
Fe + O2 = Fe2O3
Fe2O3 + H2 = Fe + H2O
FeO3 + H2 = Fe + H2O
Fe + S = Fe2S3
Fe + H2O = Fe3O4 + H2
Fe2O3+CO=Fe+CO2
Fe2O3+CO=Fe+CO2
Fe2O3 + C = Fe + CO2
Fe(OH)2 + H2O + O2 = Fe(OH)3
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 +
Cr2(SO4)3 +K2SO4 + H2O
FeS + HCl = FeCl2 + H2S
FeS2 + O2 = Fe2O3 + SO2
Fe + O2 = Fe2O3
Fe2S2+O2=Fe2O2+SO2
Fe2O3+H3PO4=FePO4+H2O
Fe2O3 + CO = Fe + CO2
Fe2(SO4)3+NaOH=Fe(OH)3+Na2SO4
Fe(s)+O2(g)=FeO(s)
Fe + Cl = FeCl
Fe(OH)3 + O2 = Fe2O3 + H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 +
MnSO4 + K2SO4 + H2O
Fe3O4 + HNO3 = Fe(NO3)3 + NO + H2O
Fe(s)+O2(g)=Fe2O3(s)
Fe2O3+CO=Fe+CO2
Fe2O3 +CO = Fe + CO2
Fe2O3+CO=Fe+CO2
Fe + H2O = Fe3O4 + H2
FeCl3+NH4OH=Fe(OH)3+NH4Cl
Fe+V2O3=Fe2O3+VO
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
Fe + H2O = Fe3O4 + H2

4Fe(OH)2 + 2H2O + O2 = 4Fe(OH)3


6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 +
Cr2(SO4)3 + K2SO4 + 7H2O
4Fe + 3O2 = 2Fe2O3
FeS + 2HCl = FeCl2 + H2S
4Fe + 3O2 = 2Fe2O3
Fe2O3 + 3H2 = 2Fe + 3H2O
FeO3 + 3H2 = Fe + 3H2O
2Fe + 3S = Fe2S3
3Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3CO = 2Fe + 3CO2
2Fe2O3 + 3C = 4Fe + 3CO2
4Fe(OH)2 + 2H2O + O2 = 4Fe(OH)3
6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 +
Cr2(SO4)3 + K2SO4 + 7H2O
FeS + 2HCl = FeCl2 + H2S
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
4Fe + 3O2 = 2Fe2O3
Fe2S2 + 3O2 = Fe2O2 + 2SO2
Fe2O3 + 2H3PO4 = 2FePO4 + 3H2O
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
2Fe(s) + O2(g) = 2FeO(s)
Fe + Cl = FeCl
2Fe(OH)3 + 0O2 = Fe2O3 + 3H2O
10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 +
2MnSO4 + K2SO4 + 8H2O
3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO +
14H2O
4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3CO = 2Fe + 3CO2
3Fe + 4H2O = Fe3O4 + 4H2
FeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
2Fe + 3V2O3 = Fe2O3 + 6VO
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
3Fe + 4H2O = Fe3O4 + 4H2

Fe2O3 + HNO3 = Fe(NO3)3 + H2O


Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeCO3+H2CO3=Fe(HCO3)2
FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3+HNO3=Fe(NO3)3+H2O
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2O3 + C = Fe + CO2
2Fe2O3 + 3C = 4Fe + 3CO2
Fe + O2 = Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe2O3(s) + 3 CO(g) = 2 Fe(s) + 3 CO2(g)
Fe2O3(s) + 3CO(g) = 2Fe(s) + 3CO2(g)
Fe(OH)2 + H2O + O2 = Fe(OH)3
4Fe(OH)2 + 2H2O + O2 = 4Fe(OH)3
Fe(OH)3(s)+H2SO4(aq) = Fe2(SO4)3(aq)
2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
+H2O
6H2O
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
H2O
6H2O
Fe2S3 + HCl = FeCl3 + H2S
Fe2S3 + 6HCl = 2FeCl3 + 3H2S
FeCl3+H2S=FeCl2+S+HCl
2FeCl3 + H2S = 2FeCl2 + S + 2HCl
FeS + HCl = FeCl2 + H2S
FeS + 2HCl = FeCl2 + H2S
Fe2O3 + HNO3 = Fe(NO3)3 +H2O
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)
2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
+H2O(l)
6H2O(l)
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)
2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
+H2O(l)
6H2O(l)
Fe2(CO3)3 + CH3COOH = Fe(CH3COO)3 + Fe2(CO3)3 + 6CH3COOH = 2Fe(CH3COO)3 +
CO2 + H2O
3CO2 + 3H2O
Fe2(CO3)3 + H2SO4 = Fe2(SO4)3 + CO2 + Fe2(CO3)3 + 3H2SO4 = Fe2(SO4)3 + 3CO2 +
H2O
3H2O
Fe2(CO3)3 + H3PO4 = Fe(PO4) + CO2 +
Fe2(CO3)3 + 2H3PO4 = 2Fe(PO4) + 3CO2 +
H2O
3H2O
Fe2(CO3)3 + HNO3 = Fe(NO3)3 + CO2 + Fe2(CO3)3 + 6HNO3 = 2Fe(NO3)3 + 3CO2 +
H2O
3H2O
Fe2(CO3)3 + HCl = FeCl3 + CO2 + H2O
Fe2(CO3)3 + 6HCl = 2FeCl3 + 3CO2 + 3H2O
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4 + H2 = Fe + H2O
Fe3O4 + 4H2 = 3Fe + 4H2O
Fe2O4 + H2 = Fe + H2O
Fe2O4 + 4H2 = 2Fe + 4H2O
FeO2 + C = Fe + CO2
FeO2 + C = Fe + CO2
Fe + H2SO4 = FeSO4 + H2
Fe + H2SO4 = FeSO4 + H2
Fe3O3 + CO = Fe + CO2
Fe3O3 + 3CO = 3Fe + 3CO2
FeCl3 + NaOH = Fe( OH)3 + NaCl
FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe3O3+CO=Fe+CO2
Fe3O3 + 3CO = 3Fe + 3CO2
FeSO4=Fe2O3+SO2+SO3
2FeSO4 = Fe2O3 + SO2 + SO3
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
FeSO4 + HNO3 + H2SO4 = Fe2(SO4)3 +
6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 +
NO + H2O
2NO + 4H2O

Fe + H2O = Fe3O4 + H2
3Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NH4OH = Fe(OH)3 + NH4Cl
FeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + H2 = Fe + H2O
Fe2O3 + 3H2 = 2Fe + 3H2O
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3
Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe(OH)3 + HNO3 = H2O + Fe(NO3)3
Fe(OH)3 + 3HNO3 = 3H2O + Fe(NO3)3
Fe2O3+C=Fe3O4+CO
3Fe2O3 + C = 2Fe3O4 + CO
FeCl3 + (NH4)2S = Fe2S3 + (NH4)Cl
2FeCl3 + 3(NH4)2S = Fe2S3 + 6(NH4)Cl
FeS2 + O2 = Fe2O3 + SO2
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2O3 + H2O = Fe(OH)3
Fe2O3 + 3H2O = 2Fe(OH)3
Fe(OH)3 = Fe2O3 + H2O
2Fe(OH)3 = Fe2O3 + 3H2O
Fe2S3+H2SO4=Fe2(SO4)3+H2S
Fe2S3 + 3H2SO4 = Fe2(SO4)3 + 3H2S
Fe2O3+HNO3=Fe(NO3)3+H2O
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe + H2O = Fe3O4 + H2
3Fe + 4H2O = Fe3O4 + 4H2
FeS + O2 = Fe2O3 + SO2
4FeS + 7O2 = 2Fe2O3 + 4SO2
FeO(s) + O2(g) = Fe2O3(s)
4FeO(s) + O2(g) = 2Fe2O3(s)
Fe(s) + O2(g) = Fe2O3(s)
4Fe(s) + 3O2(g) = 2Fe2O3(s)
Fe + H2O = Fe3O4 + H2
3Fe + 4H2O = Fe3O4 + 4H2
FeSO4 + K2Cr2O7 + H2SO4 = Fe2(SO4)3 + 6FeSO4 + K2Cr2O7 + 7H2SO4 = 3Fe2(SO4)3 +
Cr2(SO4)3 + K2SO4 + H2O
Cr2(SO4)3 + K2SO4 + 7H2O
FeSO4 + K2Cr2O7 + H2SO4 = Fe(SO4)3 + 3FeSO4 + 2K2Cr2O7 + 14H2SO4 = 3Fe(SO4)3
Cr2(SO4)3 + K2SO4 + H2O
+ 2Cr2(SO4)3 + 2K2SO4 + 14H2O
FeCl3+ FeCl2 + NH3+ H2O = Fe3O4 +
2FeCl3 + FeCl2 + 8NH3 + 4H2O = Fe3O4 +
NH4Cl
8NH4Cl
Fe2O3+HClO4=Fe(ClO4)3+H2O
Fe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
FeCl3 + K2CrO4 = Fe2(CrO4)3 + KCl
2FeCl3 + 3K2CrO4 = Fe2(CrO4)3 + 6KCl
FeCl3 + K2CrO4 = Fe2(CrO4)3 + KCl
2FeCl3 + 3K2CrO4 = Fe2(CrO4)3 + 6KCl
Fe3O4 + H2 = Fe + H2O
Fe3O4 + 4H2 = 3Fe + 4H2O
Fe3O4 + H2 = Fe + H2O
Fe3O4 + 4H2 = 3Fe + 4H2O
Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 +
Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
3Na2SO4
Fe2O3 + Al = Fe + AlO3
Fe2O3 + Al = 2Fe + AlO3
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
H2O(l)
6H2O(l)
Fe + H2SO4 = FeSO4 + H
Fe + H2SO4 = FeSO4 + 2H
Fe2(CO3)3 + 2H3PO4 = 2FePO4 + 6H + 0O +
Fe2(CO3)3 + H3PO4= FePO4 +H+O+ CO3
3CO3

Fe2(CO3)3 + 2HNO3 = 2FeNO3 + 2H + 0O +


3CO3
Fe2(CO3)3 + 2H2SO4 = 2FeSO4 + 4H + 0O +
Fe2(CO3)3 + H2SO4 = FeSO4 +H+O+ CO3
3CO3
Fe2(CO3)3 + 2H2SO4 = 2FeSO4 + 4H + 0O +
Fe2(CO3)3 + H2SO4 = FeSO4 +H+ O+ CO3
3CO3
Fe2(CO3)3 + HCL = FeCL +H+ O+ CO3
Fe2(CO3)3 + 2HCL = 2FeCL + 2H + 0O + 3CO3
Fe2(CO3)3 + HCL = FeCL +H+O+ CO3
Fe2(CO3)3 + 2HCL = 2FeCL + 2H + 0O + 3CO3
Fe2(CO3)3 + HCL = FeCL +H+O+ CO3
Fe2(CO3)3 + 2HCL = 2FeCL + 2H + 0O + 3CO3
Fe + H2SO4 = FeSO4 + H
Fe + H2SO4 = FeSO4 + 2H
Fe2O3+CO=Fe+CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe3O4+H2=Fe+H2O
Fe3O4 + 4H2 = 3Fe + 4H2O
Fe(OH)3 = Fe2O3 + H2O
2Fe(OH)3 = Fe2O3 + 3H2O
Fe3O4 + H2 = Fe + H2O
Fe3O4 + 4H2 = 3Fe + 4H2O
FeCl2 + Zn = Fe + ZnCl2
FeCl2 + Zn = Fe + ZnCl2
FeCl2 + Zn = Fe + ZnCl
FeCl2 + 2Zn = Fe + 2ZnCl
FeCl + Zn = Fe + ZnCl
FeCl + Zn = Fe + ZnCl
Fe(NO3)3+NaSO4=FeSO4+Na(NO3)3
Fe(NO3)3 + NaSO4 = FeSO4 + Na(NO3)3
Fe(NO3)3+NaSO4=FeSO4+Na(NO3)3
Fe(NO3)3 + NaSO4 = FeSO4 + Na(NO3)3
Fe2(SO4)3 + Na2S2O3 = FeSO4 + Na2S4O6 Fe2(SO4)3 + 2Na2S2O3 = 2FeSO4 + Na2S4O6 +
+ Na2SO4
Na2SO4
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
H2O(l)
6H2O(l)
Fe2O3 + HCl = FeCl3 + H2O
Fe2O3 + 6HCl = 2FeCl3 + 3H2O
FeO2H + HCl = FeCl3 + H2O
FeO2H + 3HCl = FeCl3 + 2H2O
Fe(OH)3 + HCl = FeCl3 + H2O
Fe(OH)3 + 3HCl = FeCl3 + 3H2O
FeCO3 + H2CO3 = Fe(HCO3)2
FeCO3 + H2CO3 = Fe(HCO3)2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeSO4 + KMnO4 + H2SO4 = Fe2(SO4)3 + 10FeSO4 + 2KMnO4 + 8H2SO4 = 5Fe2(SO4)3 +
MnSO4 + K2SO4 +H2O
2MnSO4 + K2SO4 + 8H2O
Fe(NO3)3 +KOH = KNO3 + Fe(OH)3
Fe(NO3)3 + 3KOH = 3KNO3 + Fe(OH)3
Fe + H2O = Fe3O4 + H2
3Fe + 4H2O = Fe3O4 + 4H2
FeCO3(s) + HNO3(aq) = Fe(NO3)2 + CO2 + FeCO3(s) + 2HNO3(aq) = Fe(NO3)2 + CO2 +
H2O
H2O
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NH4OH = Fe(OH)3 + NH4Cl
FeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeS + HNO3=Fe(NO3)3 + H2SO4 + NO2+ FeS + 12HNO3 = Fe(NO3)3 + H2SO4 + 9NO2 +
H2O
5H2O
FeS2 + HNO3=Fe(NO3)3 + H2SO4 + NO2+ FeS2 + 18HNO3 = Fe(NO3)3 + 2H2SO4 +
H2O
15NO2 + 7H2O
Fe2(CO3)3 + HNO3 = FeNO3 +H+O+ CO3

FeS2 + HNO3=Fe(NO3)3 + H2SO4 + NO+


H2O
Fe(OH)3(s) + HNO3(aq) = Fe(NO3)3 + H2O
Fe2O3 + H2 = Fe + H2O
FeS2 + O2 = Fe2O3 + SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3
Fe + O2 = FeO3
Fe(OH)3 + H2SO4 = Fe2(SO4)3 + H2O
FeS+HNO3=Fe(NO3)3+NO+S+H2O
Fe + HCl = FeCl2 + H
Fe2O3 + CO = Fe + CO2
Fe+H2=FeH2
Fe+H2=Fe2H
Fe(OH)2+O2+H2O=Fe(OH)3
Fe(OH)2+O2+H2O=Fe(OH)3
F2+Al2O3=AlF3+O2
Fe3O4 + H2 = Fe + H2O
FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + HNO3 = Fe(NO3)3 + H2O
F2 + Cl2 = ClF3
Fe(NH4)2(SO4)2*6H2O+KMnO4+H2SO4=
Fe2(SO4)3+
(NH4)2SO4+K2SO4+MnSO4+H2O
Fe2O3 + CO = Fe + CO2
FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + HNO3 = Fe(NO3)3 + H2O
FeS+O2=Fe2O3+SO2
FeCl3+Ca(OH)2=Fe(OH)3+CaCl2
Fe2O3+H2O=Fe(OH)3
Fe(OH)3=Fe2O3+H2O
FeCO3 + HNO3 = Fe(NO3)2 + CO2 + H2O
FeCO3 + HNO3 = Fe(NO3)2 + CO2 + H2O
Fe(OH)3 + HNO3 = Fe(NO3)3 + H2O
Fe2O3 + HNO3 = Fe(NO3)3 + H2O
Fe + CuSO4 = FeSO4 + Cu
Fe + H2O = Fe3O4 + H2
Fe + O2 = Fe2O3
Fe(OH)3 + H2S = Fe2S3 + H2O
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)

FeS2 + 8HNO3 = Fe(NO3)3 + 2H2SO4 + 5NO +


2H2O
Fe(OH)3(s) + 3HNO3(aq) = Fe(NO3)3 + 3H2O
Fe2O3 + 3H2 = 2Fe + 3H2O
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
2Fe + 3O2 = 2FeO3
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeS + 4HNO3 = Fe(NO3)3 + NO + S + 2H2O
Fe + 2HCl = FeCl2 + 2H
Fe2O3 + 3CO = 2Fe + 3CO2
Fe + H2 = FeH2
4Fe + H2 = 2Fe2H
4Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
4Fe(OH)2 + O2 + 2H2O = 4Fe(OH)3
6F2 + 2Al2O3 = 4AlF3 + 3O2
Fe3O4 + 4H2 = 3Fe + 4H2O
FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
3F2 + Cl2 = 2ClF3
10Fe(NH4)2(SO4)2*6H2O + 2KMnO4 +
8H2SO4 = 5Fe2(SO4)3 + 10(NH4)2SO4 +
K2SO4 + 2MnSO4 + 68H2O
Fe2O3 + 3CO = 2Fe + 3CO2
FeCO3 + H2CO3 = Fe(HCO3)2
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
4FeS + 7O2 = 2Fe2O3 + 4SO2
2FeCl3 + 3Ca(OH)2 = 2Fe(OH)3 + 3CaCl2
Fe2O3 + 3H2O = 2Fe(OH)3
2Fe(OH)3 = Fe2O3 + 3H2O
FeCO3 + 2HNO3 = Fe(NO3)2 + CO2 + H2O
FeCO3 + 2HNO3 = Fe(NO3)2 + CO2 + H2O
Fe(OH)3 + 3HNO3 = Fe(NO3)3 + 3H2O
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe + CuSO4 = FeSO4 + Cu
3Fe + 4H2O = Fe3O4 + 4H2
4Fe + 3O2 = 2Fe2O3
2Fe(OH)3 + 3H2S = Fe2S3 + 6H2O
FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)

Fe2O3+3CO2=2Fe+3CO2
FeCl3+Na2S=Na2Cl3+FeS
FeCl3 + HCl = FeCl + H
FeCl3 + HCl + Zn = FeCl2 + Zn H2
Fe+Cl2=FeCl3
Fe2O3+CO=Fe+CO2
Fe2O3+CO=Fe+CO2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
Fe2(SO4)3 + KSCN = K3Fe(SCN)6 +
K2SO4
Fe + H2O = Fe3O4 +H2
Fe2O3+HCl = FeCl3+H2O
FeS2+O2=Fe2S3+SO2
FeS2 + O2 = Fe2S3 + SO2
FeS(s) + HCl(aq) = FeCl2(aq) + H2S(g)
Fe3O4 + HNO3 = Fe(NO3)3 + NO + H2O
Fe2(SO4)3 + K(SCN) = K3Fe(SCN)6 +
K2SO4
Fe2O3 +C = Fe +CO2
Fe(NO3)2 + H2SO4= Fe2(SO4)3 + SO2
+NO2 =H2O
FeS2 + H2SO4 = Fe2(SO4)3+ SO2 + H2O
FeO+HCl=FeCl2+H2O
FeO+HCl=FeCl2+H2O
FeO+2HCl=FeCl2+H2O
FeO+HCl=FeCl+HO
Fe + H2SO4=FeSO4 + H2
Fe+O=FeO
Fe+O2=FeO
Fe2O3 + Al = Al2O3 + Fe
Fe2O3 + H2 = Fe3O4 + H2O
Fe(OH)3 + H2SO4= Fe2(SO4)3 +H2O
Fe+H2SO4= Fe(SO4)+H2
FeCl2+Na2S=FeS+Cl2Na2
Fe + O2 = Fe3O4
Fe CO3 + H2CO3 = Fe(HCO3)2
Fe + Cl2 = FeCl3

0Fe2O3 + CO2 = 0Fe + CO2


FeCl3 + Na2S = Na2Cl3 + FeS
-1FeCl3 + 2HCl = -1FeCl + 2H
-2FeCl3 + 2HCl + Zn = -2FeCl2 + ZnH2
2Fe + 3Cl2 = 2FeCl3
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3CO = 2Fe + 3CO2
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 +
3K2SO4
3Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + 6HCl = 2FeCl3 + 3H2O
2FeS2 + O2 = Fe2S3 + SO2
2FeS2 + O2 = Fe2S3 + SO2
FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
3Fe3O4 + 28HNO3 = 9Fe(NO3)3 + NO +
14H2O
Fe2(SO4)3 + 12K(SCN) = 2K3Fe(SCN)6 +
3K2SO4
2Fe2O3 + 3C = 4Fe + 3CO2
2Fe(NO3)2 + 2H2SO4 = Fe2(SO4)3 - SO2 +
4NO2 + 2H2O
2FeS2 + 14H2SO4 = Fe2(SO4)3 + 15SO2 +
14H2O
FeO + 2HCl = FeCl2 + H2O
FeO + 2HCl = FeCl2 + H2O
FeO + 2HCl = FeCl2 + H2O
FeO + HCl = FeCl + HO
Fe + H2SO4 = FeSO4 + H2
Fe + O = FeO
2Fe + O2 = 2FeO
Fe2O3 + 2Al = Al2O3 + 2Fe
3Fe2O3 + H2 = 2Fe3O4 + H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe + H2SO4 = Fe(SO4) + H2
FeCl2 + Na2S = FeS + Cl2Na2
3Fe + 2O2 = Fe3O4
FeCO3 + H2CO3 = Fe(HCO3)2
2Fe + 3Cl2 = 2FeCl3

Fe+O2=Fe2O3
Fe+O2=Fe2O3
Fe2O3 + HNO3 = Fe(NO3)3 + H2O

4Fe + 3O2 = 2Fe2O3


4Fe + 3O2 = 2Fe2O3
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
Fe2(SO4)3 + 12KSCN = 2K3Fe(SCN)6 +
Fe2(SO4)3+KSCN=K3Fe(SCN)6+K2SO4
3K2SO4
Fe2CO3+O2=CO2+Fe
2Fe2CO3 - O2 = 2CO2 + 4Fe
FeCl3 + NaOH = Fe(OH)3 +NaCl
FeCl3 + 3NaOH = Fe(OH)3 + 3NaCl
Fe+O2=Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe3O4 + FeO = Fe2O3
Fe3O4 - FeO = Fe2O3
Fe + H2O = Fe3O4 + H2
3Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
FeCl3 + NH4OH = Fe(OH)3 + NH4Cl
FeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
FeO+PdF2=FeF2+PdO
FeO + PdF2 = FeF2 + PdO
FeS+HCl=FeCl2+H2S
FeS + 2HCl = FeCl2 + H2S
Fe2O3 + H2 = Fe + H2O
Fe2O3 + 3H2 = 2Fe + 3H2O
FeS2 + O2 = Fe2O3 + SO2
4FeS2 + 11O2 = 2Fe2O3 + 8SO2
Fe2(SO4)3 + KOH = K2SO4 + Fe(OH)3
Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + O2 = Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe(OH)3(s)+H2SO4(aq)=Fe2(SO4)3(aq)
2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
+H2O(l)
6H2O(l)
Fe++ + MnO4- + H+ = Fe+++ + Mn++ +
5Fe++ + MnO4- + 8H+ = 5Fe+++ + Mn++ +
H2O
4H2O
FeCl3+NH3+H2O=Fe(OH)3+NH4Cl
FeCl3 + 3NH3 + 3H2O = Fe(OH)3 + 3NH4Cl
FeCl3+AgNO3= AgCl+Fe+NO3
FeCl3 + 3AgNO3 = 3AgCl + Fe + 3NO3
FeCl3 + NaHCO3 +HCl = CO2 + Fe(OH)3 + FeCl3 + 3NaHCO3 + 0HCl = 3CO2 + Fe(OH)3 +
NaCl
3NaCl
Fe+CuSO4=FeSO4+Cu
Fe + CuSO4 = FeSO4 + Cu
Fe+ O2= Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe(s) + H2O(g) =Fe3O4(s) + H2(g)
3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
FeCO3 + H2CO3 = Fe(HCO3)2
FeCO3 + H2CO3 = Fe(HCO3)2
FeCl3(aq) + Cs3PO4(aq) = FePO4(s) +
FeCl3(aq) + Cs3PO4(aq) = FePO4(s) + 3CsCl(aq)
3CsCl(aq)
Fe(s) + HCl(aq) = FeCl3(aq) + H2
2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2
Fe2O3 + HNO3 = Fe(NO3)3 + H2O
Fe2O3 + 6HNO3 = 2Fe(NO3)3 + 3H2O
FeS + HCl=FeCl2+H2S
FeS + 2HCl = FeCl2 + H2S
Fe(s) + H2O(g) = Fe3O4(s) + H2(g)
3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe(s) + HCl(aq) = FeCl3(aq) + H2(g)
2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe(s) + H2O(g) = Fe3O4(s) + H2(g)
3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)

FeBr3 + K3PO4 = KBr + FePO4


FeBr3 + K3PO4 = 3KBr + FePO4
Fe(s) + H2O(g) = Fe3O4(s) + H2(g)
3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Fe + CuSO4 = Fe(SO4)3 + Cu
Fe + 3CuSO4 = Fe(SO4)3 + 3Cu
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
H2O(l)
6H2O(l)
Fe(s) + HCl(aq) = FeCl3(aq) + H2(g)
2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
Fe + HCl = FeCl3 + H2
2Fe + 6HCl = 2FeCl3 + 3H2
Fe2(SO4)3 +KOH = K2SO4+Fe(OH)3
Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
FeCl2 + KMnO4 + HCl = FeCl3 + KCl +
5FeCl2 + KMnO4 + 8HCl = 5FeCl3 + KCl +
MnCl2 + H2O
MnCl2 + 4H2O
Fe2O3 + HClO4 = Fe(ClO4)3 + H2O
Fe2O3 + 6HClO4 = 2Fe(ClO4)3 + 3H2O
FeCl3 + (NH4)3PO4 = FePO4 +NH4Cl
FeCl3 + (NH4)3PO4 = FePO4 + 3NH4Cl
FeCl3 + NH4OH = Fe(OH)3 + NH4Cl
FeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2(SO4)3 + KOH = K2SO4 + Fe (OH)3
Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
Fe + HCl = FeCl3 + H2
2Fe + 6HCl = 2FeCl3 + 3H2
Fe + H2O = Fe3O4 + H2
3Fe + 4H2O = Fe3O4 + 4H2
Fe + Cl2 = FeCl3
2Fe + 3Cl2 = 2FeCl3
Fe+O2=Fe2O3
4Fe + 3O2 = 2Fe2O3
FeS+HCl=FeCl2 + H2S
FeS + 2HCl = FeCl2 + H2S
FeCl2+Cl2=FeCl3
2FeCl2 + Cl2 = 2FeCl3
Fe + O2 = Fe2O3
4Fe + 3O2 = 2Fe2O3
Fe2O3 + H2O = Fe(OH)3
Fe2O3 + 3H2O = 2Fe(OH)3
FeCl3 + H2C2O4 = FeCl2 + CO2 + H2O + 2FeCl3 + H2C2O4 = 2FeCl2 + 2CO2 + 0H2O +
HCl
2HCl
FeSO4 + HNO3 + H2SO4 = Fe2(SO4)3 +
6FeSO4 + 2HNO3 + 3H2SO4 = 3Fe2(SO4)3 +
NO + H2O
2NO + 4H2O
Fe + H2O = Fe(OH)3 +H2
2Fe + 6H2O = 2Fe(OH)3 + 3H2
Fe(s) + HCl(aq)= FeCl3(aq) + H2(g)
2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
FeSO4 + NH4OH = FeOH + NH4SO4
FeSO4 + NH4OH = FeOH + NH4SO4
FeSO4 + NH4OH = FeOH + NH4SO4
FeSO4 + NH4OH = FeOH + NH4SO4
Fe2(SO4)3+HNO3=Fe(NO3)3+H2SO4
Fe2(SO4)3 + 6HNO3 = 2Fe(NO3)3 + 3H2SO4
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
Fe2O3+H2O=Fe(OH)3
Fe2O3 + 3H2O = 2Fe(OH)3
FeSO4+KClO3+H2SO4=Fe2(SO4)3+KCl+H 6FeSO4 + KClO3 + 3H2SO4 = 3Fe2(SO4)3 +
2O
KCl + 3H2O
Fe2O3 + CO = Fe + CO2
Fe2O3 + 3CO = 2Fe + 3CO2
FeO3 + CO = Fe + CO2
FeO3 + 3CO = Fe + 3CO2
FeO+HNO3=FeNO3+OH
FeO + HNO3 = FeNO3 + OH
F2 + Na = F2Na
F2 + Na = F2Na

FeS + H2SO4 = Fe2(SO4)3 + SO2 + H2O


Fe2O3+CO=Fe+CO2
FeS + HNO3 = Fe(SO4) + Fe(NO3)2 +NO
+H2O
FeS + HNO3 = Fe(SO4) + Fe(NO3)3 +NO
+H2O
FeS + HNO3 = Fe2(SO4)3 + Fe(NO3)3 +NO
+H2O
FeS + HNO3 = Fe(NO3)2 + H2S
Fe+NiSO4=FeSO4+Ni
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
FeCl+O2+H2O=Fe(OH)3+Cl3
Fe+O2+H2O=Fe(OH)3
Fe + Br2 = FeBr3
FeO+H2SO4=FeSO4+H2O
FeCl3+NH4OH=Fe(OH)3+3NH4Cl
Fe2O3 + CO = Fe + CO2
Fe2(SO4)3+KOH=K2SO4+Fe(OH)3
Fe+H2O=Fe3O4+H2
Fe2O3+CO=Fe+CO2
Fe2O3+H2=Fe+H2O
FeCl3+Al=Fe+AlCl3
Fe(s) + HCl(aq) =FeCl3(aq) + H2(g)
FeS(s)+HCl(aq)=FeCl2(aq)+H2S(g)
Fe2O3(s) + H20(l) = Fe2(OH)3(s)

2FeS + 10H2SO4 = Fe2(SO4)3 + 9SO2 + 10H2O


Fe2O3 + 3CO = 2Fe + 3CO2
3FeS + 8HNO3 = 3Fe(SO4) + 0Fe(NO3)2 + 8NO
+ 4H2O
3FeS + 8HNO3 = 3Fe(SO4) + 0Fe(NO3)3 + 8NO
+ 4H2O
3FeS + 12HNO3 = Fe2(SO4)3 + Fe(NO3)3 +
9NO + 6H2O
FeS + 2HNO3 = Fe(NO3)2 + H2S
Fe + NiSO4 = FeSO4 + Ni
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
12FeCl + 9O2 + 18H2O = 12Fe(OH)3 + 4Cl3
4Fe + 3O2 + 6H2O = 4Fe(OH)3
2Fe + 3Br2 = 2FeBr3
FeO + H2SO4 = FeSO4 + H2O
FeCl3 + 3NH4OH = Fe(OH)3 + 3NH4Cl
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2(SO4)3 + 6KOH = 3K2SO4 + 2Fe(OH)3
3Fe + 4H2O = Fe3O4 + 4H2
Fe2O3 + 3CO = 2Fe + 3CO2
Fe2O3 + 3H2 = 2Fe + 3H2O
FeCl3 + Al = Fe + AlCl3
2Fe(s) + 6HCl(aq) = 2FeCl3(aq) + 3H2(g)
FeS(s) + 2HCl(aq) = FeCl2(aq) + H2S(g)
20Fe2O3(s) + 3H20(l) = 20Fe2(OH)3(s)
3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO +
Fe(NO3)2+HNO3=Fe(NO3)3+NO+H2O
2H2O
FeW + W2 = Fe2W3
4FeW + W2 = 2Fe2W3
FeO + O2 = Fe2O3
4FeO + O2 = 2Fe2O3
FeS2 + O2 = FeO3 + SO2
2FeS2 + 7O2 = 2FeO3 + 4SO2
Fe (OH)3 + H2SO4 = Fe2 (SO4)3 + H2O
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
FeCl3 + Na2S = NaCl + FeS + Cl
FeCl3 + Na2S = 2NaCl + FeS + Cl
FeBr3 + K3PO4 = FePO4 +K3Br3
FeBr3 + K3PO4 = FePO4 + K3Br3
FeCl3+H2S=Fe2S3+HCl
2FeCl3 + 3H2S = Fe2S3 + 6HCl
Fe(OH)3(s) + H2SO4(aq) = Fe2(SO4)3(aq) + 2Fe(OH)3(s) + 3H2SO4(aq) = Fe2(SO4)3(aq) +
H2O(l)
6H2O(l)
Fe(NO3)2 + HNO3 = Fe(NO3)3 + NO +
3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO +
H2O
2H2O
FeCl2 + H2SO4 = Fe2(SO4)3 + Cl2 + SO2 + 2FeCl2 + 6H2SO4 = Fe2(SO4)3 + 2Cl2 + 3SO2
H2O
+ 6H2O

Fe(NO3)2 + HNO3 = Fe(NO3)3 + NO2 +


H2O
Fe(NO3)2 + HNO3 = Fe(NO3)3 + NO +
H2O
Fe(s) + H2O(l) = Fe3O4(s) + H2(g)
Fe2O3 + HCl = FeCl3 + H2O
FeO3(s) + CO(g)=Fe(l) + CO2(g)
Fe2O3 = 4Fe + 3O2
Fe3O3 = 4Fe + 3O2
Fe + O = Fe2O3
Fe + O = FeO3
Fe + O = Fe2O3
Fe + H2O = Fe(OH)3 +H2
Fe(OH)3+H2SO4=Fe2(SO4)3+H2O
FeCl3 + (NH4)2S = Fe2S3 +NH4Cl
FeCl3 + (NH4)2S = Fe2S3 +NH4Cl
Fe2O3 + Mg = MgO + Fe
FeO3(s)+CO(g)=Fe+CO2(g)
FeCl3 + Fe = FeCl2
Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 +
3Na2SO4
Fe2O3 + CO= Fe + CO2
Fe(NO3)3+K3PO4=K3(NO3)3+FePO4
Fe(s) + H2O(g)= Fe3O4(s) + H2(g)
FeCl3 + Na2CO3 = Fe2(CO3)3 + NaCl
Fe + O2 = Fe2O3
Fe +H2O=Fe3O4+H2
Fe(s) + H2O(g) = Fe3O4(s) + H2(g)
Input Equation
Br+KI=KBr + I
Ba(NO3)2 + NaBr = BaBr2 + NaNO3
Ba(NO3)2 + NaOH = Ba(OH)2 + NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + Na2(NO3)2
Ba(NO3)2 + NaBr = BaBr2 + Na2(NO3)2
Bi(NO3)3 + NaOH = HBiO + Na (NO3)3
Bi(NO3)3 + NaOH = HBiO + Na (NO3)3
Br2 + NaI = NaBr2 + I
BCl3 + P4 + H2 = BP + HCl
Ba(OH)2 + H3PO4 = H2O + Ba3(PO4)2

Fe(NO3)2 + 2HNO3 = Fe(NO3)3 + NO2 + H2O


3Fe(NO3)2 + 4HNO3 = 3Fe(NO3)3 + NO +
2H2O
3Fe(s) + 4H2O(l) = Fe3O4(s) + 4H2(g)
Fe2O3 + 6HCl = 2FeCl3 + 3H2O
FeO3(s) + 3CO(g) = Fe(l) + 3CO2(g)
2Fe2O3 = 4Fe + 3O2
2Fe3O3 = 6Fe + 3O2
2Fe + 3O = Fe2O3
Fe + 3O = FeO3
2Fe + 3O = Fe2O3
2Fe + 6H2O = 2Fe(OH)3 + 3H2
2Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O
2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
2FeCl3 + 3(NH4)2S = Fe2S3 + 6NH4Cl
Fe2O3 + 3Mg = 3MgO + 2Fe
FeO3(s) + 3CO(g) = Fe + 3CO2(g)
2FeCl3 + Fe = 3FeCl2
Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4
Fe2O3 + 3CO = 2Fe + 3CO2
Fe(NO3)3 + K3PO4 = K3(NO3)3 + FePO4
3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
2FeCl3 + 3Na2CO3 = Fe2(CO3)3 + 6NaCl
4Fe + 3O2 = 2Fe2O3
3Fe + 4H2O = Fe3O4 + 4H2
3Fe(s) + 4H2O(g) = Fe3O4(s) + 4H2(g)
Balanced Equation
Br + KI = KBr + I
Ba(NO3)2 + 2NaBr = BaBr2 + 2NaNO3
Ba(NO3)2 + 2NaOH = Ba(OH)2 + 2NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + Na2(NO3)2
Ba(NO3)2 + 2NaBr = BaBr2 + Na2(NO3)2
Bi(NO3)3 + NaOH = HBiO + Na(NO3)3
Bi(NO3)3 + NaOH = HBiO + Na(NO3)3
Br2 + NaI = NaBr2 + I
4BCl3 + P4 + 6H2 = 4BP + 12HCl
3Ba(OH)2 + 2H3PO4 = 6H2O + Ba3(PO4)2

Ba(OH)2*8H2O+2NH4NO3=Ba(NO3)2+NH3+H2O
Ba(OH)2*8(H2O)+2NH4NO3=Ba(NO3)2+NH3+H2O
Ba(OH)2*8H2O+NH4NO3 = Ba(NO3)2+NH3+H2O
Ba(OH)2*8H2O + NH4NO3 = Ba(NO3)2 + NH3 + H2O
Ba(OH)28H2O + NH4NO3 = Ba(NO3)2 + NH3 + H2O
Ba(OH)2*8H2O+NH4NO3 = Ba(NO3)2+OH+H2O
Ba(OH)2*8H2O+2NH4NO3 = Ba(NO3)2+2OH+H2O
Be2C + H2O = Be(OH)2 + CH4
Ba(OH)2 + P4O10 = Ba3(PO4)2 + H2O
BCl3+H2O=H3BO3+HCl
B2O3+HF=BF3+H2O
Ba(OH)2 + P4O10 = Ba3(PO4)2 + H2O
BaCl+Na(SO4)= Ba(SO4) +NaCl
Be(NO3)2(aq) + NaOH(aq) = Be(OH)2(s) + NaNO3(aq)
BaCl2+H3PO4=Ba3(PO4)2+HCl
BCl3+H2O=H3BO3+HCl
BaCl2 + H2SO4 = BaSO4 + 2HCl
Be+Br2=2BeBr
Ba+I2=2BaI
Ba+Br2=2BaBr
Ba+Se=2BaSe
Be+Br2=BeBr
Be+Br2=BeBr
Be+Br2= BeBr2
B2O3(s)+HF(l)=BF3(g)+H2O(l)
Bi + F2 = BiF3
Ba(OH)2 + H2SO4 = BaSO4 + H2O
Ba(OH)2 + H2SO4 = BaSO4 = H2O
Ba(NO3)2+NaBr= BaBr + Na(NO3)2
Ba(OH)2 + P4O10 = Ba3(PO4)2 + H2O
Ba(NO3)2+NaBr= BaBr + Na(NO3)2
BCl3 + H2O = H3BO3 + HCl
B5H9 + O2 = B2 O3 + H2O
BaCl2 + Na2SO4 = BaSO4 + NaCl
Ba(OH)2 + HCl = BaCl2 +HOH
BaCl2+H3PO4 = Ba3(PO4)2+HCl
Br2 + NaOH = NaBr +NaBrO3 +H2O

Ba(OH)2*8H2O + 2NH4NO3 = Ba(NO3)2 + 2NH3


+ 10H2O
Ba(OH)2*8(H2O) + 2NH4NO3 = Ba(NO3)2 +
2NH3 + 10H2O
Ba(OH)2*8H2O + 2NH4NO3 = Ba(NO3)2 + 2NH3
+ 10H2O
Ba(OH)2*8H2O + 2NH4NO3 = Ba(NO3)2 + 2NH3
+ 10H2O
4Ba(OH)28H2O - 5NH4NO3 = 4Ba(NO3)2 18NH3 + 77H2O
Ba(OH)2*8H2O + NH4NO3 = Ba(NO3)2 - 8OH +
15H2O
Ba(OH)2*8H2O + NH4NO3 = Ba(NO3)2 - 8OH +
15H2O
Be2C + 4H2O = 2Be(OH)2 + CH4
6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
BCl3 + 3H2O = H3BO3 + 3HCl
B2O3 + 6HF = 2BF3 + 3H2O
6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
BaCl + Na(SO4) = Ba(SO4) + NaCl
Be(NO3)2(aq) + 2NaOH(aq) = Be(OH)2(s) +
2NaNO3(aq)
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BCl3 + 3H2O = H3BO3 + 3HCl
BaCl2 + H2SO4 = BaSO4 + 2HCl
2Be + Br2 = 2BeBr
2Ba + I2 = 2BaI
2Ba + Br2 = 2BaBr
Ba + Se = BaSe
2Be + Br2 = 2BeBr
2Be + Br2 = 2BeBr
Be + Br2 = BeBr2
B2O3(s) + 6HF(l) = 2BF3(g) + 3H2O(l)
2Bi + 3F2 = 2BiF3
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(NO3)2 + NaBr = BaBr + Na(NO3)2
6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
Ba(NO3)2 + NaBr = BaBr + Na(NO3)2
BCl3 + 3H2O = H3BO3 + 3HCl
2B5H9 + 12O2 = 5B2O3 + 9H2O
BaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba(OH)2 + 2HCl = BaCl2 + 2HOH
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
3Br2 + 6NaOH = 5NaBr + NaBrO3 + 3H2O

BaCl2+H3PO4=Ba3(PO4)2+HCl
Bi + HNO3 = Bi(NO3)3 + NO2 + H2O
BaCl2+H3PO4=Ba3(PO4)2+HCl
BaCl2 + (NH4)2SO4 = BaSO4 + NH4Cl
Ba(C2H3O2)2+Na3PO4 = Ba3(PO4)2+NaC2H3O2
BaClO3=BaCl+O2
BCl3(g)+H2O(l)=H3BO3(s)+HCl(g)
BCl3+H2O=H3BO3+HCl
BaCl2+CuSO4=BaSO4 + CuCl2
Ba(C2H3O2)2 + Na3PO4 = Ba3(PO4)2 +NaC2H3O2
Ba(C2H3O2)2 + Na3PO4 = Ba3(PO4)2 +NaC2H3O2
Bi2O3 + NaOH + NaOCl = NaBiO + NaCl + H2O
Ba(OH)2 + HCl = BaCl2 + H2O
BaCl2 + KIO3 = Ba(IO3)2 + 2 KCl
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)
Bi2O3 + C(s) = Bi(s) + CO(g)
BaCl2+NaOH=Ba(OH)2+NaCl
BaCl2+Na2CO3=BaCO3+NaCl
BCl3+H2O = H3BO3+HCl
BaCl2+H2SO4=BaSO4+HCl
BaCl2+NaCO3=Ba(CO3)2+NaCl
BaCl2+CuSO4=BaSO4+CuCl2
BaCl2 + KIO3 = Ba(IO3)2 + KCl
BCl3(g)+H2O(l)=H3BO3(s)+HCl(g)
B2H6+H2O=H3BO3+H2
Be(OH)2 +HCl = BeCl2 + H2O
Be(OH)2 +HCl = BeCl2 + H2O
Bi(s)+F2(g)=BiF3(s)
Be2C + H2O = Be(OH)2 + CH4
BaCl2(aq) + Na2SO4(aq) = NaCl + BaSO4
B2O3(s) + NaOH(aq) = Na3BO3(aq) + H2O(l)
BF3+H2O=HF+H3BO3
B2H6(g) + H2O(l) = H3BO3(s) + H2(g)
Ba(OH)2 + HCl = BaCl2 + H2O
B2O3 + 6HF = BF3 + H2O
B2O3+HF=BF3+H2O
Ba(OH)2 + HCl = Cl2Ba + H2O
Ba(OH)2 + HCl = Cl + Ba + H2O
B2S3 + H2O = H3BO3 + H2S

3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl


Bi + 6HNO3 = Bi(NO3)3 + 3NO2 + 3H2O
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BaCl2 + (NH4)2SO4 = BaSO4 + 2NH4Cl
3Ba(C2H3O2)2 + 2Na3PO4 = Ba3(PO4)2 +
6NaC2H3O2
2BaClO3 = 2BaCl + 3O2
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
BCl3 + 3H2O = H3BO3 + 3HCl
BaCl2 + CuSO4 = BaSO4 + CuCl2
3Ba(C2H3O2)2 + 2Na3PO4 = Ba3(PO4)2 +
6NaC2H3O2
3Ba(C2H3O2)2 + 2Na3PO4 = Ba3(PO4)2 +
6NaC2H3O2
Bi2O3 + 2NaOH - 2NaOCl = 2NaBiO - 2NaCl +
H2O
Ba(OH)2 + 2HCl = BaCl2 + 2H2O
BaCl2 + 2KIO3 = Ba(IO3)2 + 2KCl
3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) +
6HCl(aq)
Bi2O3 + 3C(s) = 2Bi(s) + 3CO(g)
BaCl2 + 2NaOH = Ba(OH)2 + 2NaCl
BaCl2 + Na2CO3 = BaCO3 + 2NaCl
BCl3 + 3H2O = H3BO3 + 3HCl
BaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2 + 2NaCO3 = Ba(CO3)2 + 2NaCl
BaCl2 + CuSO4 = BaSO4 + CuCl2
BaCl2 + 2KIO3 = Ba(IO3)2 + 2KCl
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
B2H6 + 6H2O = 2H3BO3 + 6H2
Be(OH)2 + 2HCl = BeCl2 + 2H2O
Be(OH)2 + 2HCl = BeCl2 + 2H2O
2Bi(s) + 3F2(g) = 2BiF3(s)
Be2C + 4H2O = 2Be(OH)2 + CH4
BaCl2(aq) + Na2SO4(aq) = 2NaCl + BaSO4
B2O3(s) + 6NaOH(aq) = 2Na3BO3(aq) + 3H2O(l)
BF3 + 3H2O = 3HF + H3BO3
B2H6(g) + 6H2O(l) = 2H3BO3(s) + 6H2(g)
Ba(OH)2 + 2HCl = BaCl2 + 2H2O
B2O3 + 6HF = 2BF3 + 3H2O
B2O3 + 6HF = 2BF3 + 3H2O
Ba(OH)2 + 2HCl = Cl2Ba + 2H2O
Ba(OH)2 + 2HCl = 2Cl + Ba + 2H2O
B2S3 + 6H2O = 2H3BO3 + 3H2S

BaSO4 + K3PO4 = Ba3(PO4)2 + K2SO4


3BaSO4 + 2K3PO4 = Ba3(PO4)2 + 3K2SO4
BaSO4 + K3PO4 = Ba3(PO4)2 + K2SO4
3BaSO4 + 2K3PO4 = Ba3(PO4)2 + 3K2SO4
BaCO3 + C + H2O = CO + Ba(OH)2
BaCO3 + C + H2O = 2CO + Ba(OH)2
BCl3 + H2O = H3BO3 + HCl
BCl3 + 3H2O = H3BO3 + 3HCl
BCl3 + H2O = H3BO3 + HCl
BCl3 + 3H2O = H3BO3 + 3HCl
Ba(NO3)2 + ZnSO4 = BaSO4 + Zn(NO3)2
Ba(NO3)2 + ZnSO4 = BaSO4 + Zn(NO3)2
Ba(OH)2 + P4O10 = Ba3(PO4)2 + H2O
6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
Ba(NO3)2 + Na2SO4 = BaSO4 + NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
B2O3(s) + NaOH(aq)= Na3BO3(aq) + H2O(l)
B2O3(s) + 6NaOH(aq) = 2Na3BO3(aq) + 3H2O(l)
Br2+KI=KBr+I2
Br2 + 2KI = 2KBr + I2
BaCl2 + Na2(C2O4)= BaC2O4 + NaCl
BaCl2 + Na2(C2O4) = BaC2O4 + 2NaCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba(OH)2 + (NH4)2SO4 = BaSO4 + NH3 + H2O
Ba(OH)2 + (NH4)2SO4 = BaSO4 + 2NH3 + 2H2O
Br2+Al=AlBr3
3Br2 + 2Al = 2AlBr3
Ba(OH)2 + K2SO4 = 2KOH + BaSO4
Ba(OH)2 + K2SO4 = 2KOH + BaSO4
Ba(OH)2 + K2SO4 = KOH + BaSO4
Ba(OH)2 + K2SO4 = 2KOH + BaSO4
Ba(OH)2 + HNO3 = Ba(NO3)2 + H2O
Ba(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Ba(NO3)2 + H2SO4 = BaSO4 + HNO3
Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
BaO + HNO3 = Ba(NO3)2 + H2O
BaO + 2HNO3 = Ba(NO3)2 + H2O
BaO + HNO3 = Ba(NO3)2 + H2O
BaO + 2HNO3 = Ba(NO3)2 + H2O
BaCl2+H3PO4=Ba3(PO4)2+HCl
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
2Bi(OH)3 + 3Na2SNO2 = 3Na2SNO3 + 2Bi +
Bi(OH)3 + Na2SNO2 = Na2SNO3 + Bi + H2O
3H2O
Bi2O3 +C = Bi + CO
Bi2O3 + 3C = 2Bi + 3CO
Br2 + NaOH = NaBrO3 + NaBr + H2O
3Br2 + 6NaOH = NaBrO3 + 5NaBr + 3H2O
BaCl2 + H3PO4 = Ba3(PO4)2 + HCl
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BaCl2*2H2O+ Na2SO4 = BaSO4*2H2O+ NaCl
BaCl2*2H2O + Na2SO4 = BaSO4*2H2O + 2NaCl
BaCl2*2H2O + Na2SO4 = BaSO4 + 2NaCl +
BaCl2*2H2O+ Na2SO4 = BaSO4+ NaCl +H2O
2H2O
B2O3(s) + NaOH(aq) =Na3BO3(aq) + H2O(l)
B2O3(s) + 6NaOH(aq) = 2Na3BO3(aq) + 3H2O(l)
Ba(NO3)2 + K2CO3 = KNO3 + BaCO3
Ba(NO3)2 + K2CO3 = 2KNO3 + BaCO3
BaCl2+H3PO4=Ba3(PO4)2+HCl
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
B2O3(s) + HF(l) = BF3(g) + H2O(l)
B2O3(s) + 6HF(l) = 2BF3(g) + 3H2O(l)
BaO2+H2SO4=BaSO4+H2O2
BaO2 + H2SO4 = BaSO4 + H2O2
BaSO4 + Ag(NO3)2 = AgSO4 + Ba(NO3)2
BaSO4 + Ag(NO3)2 = AgSO4 + Ba(NO3)2
Ba(OH)2+Fe2(SO4)3=BaSO4+Fe(OH)3
3Ba(OH)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(OH)3
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaCl2+(NH4)2CO3=BaCO3+NH4Cl
BaCl2 + (NH4)2CO3 = BaCO3 + 2NH4Cl
Br2 + NH3 = N2 + NH4Br
3Br2 + 8NH3 = N2 + 6NH4Br
Ba(NO3)2+K2SO3=Ba2(SO3)2+KNO3
2Ba(NO3)2 + 2K2SO3 = Ba2(SO3)2 + 4KNO3
B2S3+H2O=H3BO3+H2S
B2S3 + 6H2O = 2H3BO3 + 3H2S

B2H6+H2O=H3BO3+H2

B2H6 + 6H2O = 2H3BO3 + 6H2


3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) +
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)
6HCl(aq)
-1Ba(NO)32 + 34H2O = -32HNO3 - BaO2 +
Ba(NO)32+H2O=HNO3+BaO2+OH
100OH
BaNO32+H2O=HNO3+BaO2+OH
BaNO32 + 28H2O = HNO3 + BaO2 + 55OH
Bi(NO3)3 + 4KI = K(BiI4) + 3KNO3
Bi(NO3)3 + 4KI = K(BiI4) + 3KNO3
BCl3+H2O=H3BO3+HCl
BCl3 + 3H2O = H3BO3 + 3HCl
BaBr2 + Na2SO4 = BaSO4 + NaBr
BaBr2 + Na2SO4 = BaSO4 + 2NaBr
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
Br2 + C6H14 = HBr2 + C6
14Br2 + C6H14 = 14HBr2 + C6
Ba + H2O = Ba(OH)2 + H2
Ba + 2H2O = Ba(OH)2 + H2
Ba(OH)2 + 2NH4SCN = Ba(SCN)2 + 2H2O +
Ba(OH)2+ NH4SCN = Ba(SCN)2 + H2O+ NH3
2NH3
BaCl2 + Li2SO4 = BaSO4 + LiCl
BaCl2 + Li2SO4 = BaSO4 + 2LiCl
BrO3 + N2H5 = N2 + Br = H2O
5BrO3 + 6N2H5 = 6N2 + 5Br + 15H2O
Bi(NO3)3 + H2S = Bi2S3 + HNO3
2Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3
Br2+H2O+SO2=HBr+H2SO4
Br2 + 2H2O + SO2 = 2HBr + H2SO4
B2H6+H2O=H3BO3+H2
B2H6 + 6H2O = 2H3BO3 + 6H2
B2O3+C=B4C+CO2
2B2O3 + 4C = B4C + 3CO2
Ba(OH)2+CO2 = BaCO3+H2O
Ba(OH)2 + CO2 = BaCO3 + H2O
BaCl2+Ga2(SO4)3=Ba2(SO4)2+GaCl3
6BaCl2 + 2Ga2(SO4)3 = 3Ba2(SO4)2 + 4GaCl3
Ba(OH)2*8H2O + 2NH4NO3 = Ba(NO3)2 + 2NH3
Ba(OH)2 * 8H2O + NH4NO3 = Ba(NO3)2 + NH3 + H2O
+ 10H2O
BCl3 + H2O = H3BO3 + HCl
BCl3 + 3H2O = H3BO3 + 3HCl
BaCl2+H3PO4=Ba3(PO4)2+HCl
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaCl2 + Al2S3 = BaS + AlCl3
3BaCl2 + Al2S3 = 3BaS + 2AlCl3
BaCl2+H3PO4=Ba3(PO4)2+HCl
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BF3(g) + H2O(l) = HF(aq) + H3BO3(aq)
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
3Ba(OH)2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) +
Ba(OH)2(aq) + H3PO4(aq) = Ba3(PO4)2(s) + H2O(l)
6H2O(l)
3Ba(OH)2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) +
Ba(OH)2(aq) + H3PO4(aq) = Ba3(PO4)2(s) + H2O(l)
6H2O(l)
3Ba(OH)2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) +
Ba(OH)2(aq) + H3PO4(aq) = Ba3(PO4)2(s) + H2O(l)
6H2O(l)
BCl3+H2O=H3BO3+HCl
BCl3 + 3H2O = H3BO3 + 3HCl
B2H6+H2O=H3BO3+H2
B2H6 + 6H2O = 2H3BO3 + 6H2
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
BaO2 +H2O = Ba(OH)2 + O2
2BaO2 + 2H2O = 2Ba(OH)2 + O2
Bi(OH)3+K2SnO2=Bi+K2SnO3+H2O
2Bi(OH)3 + 3K2SnO2 = 2Bi + 3K2SnO3 + 3H2O
Ba (OH)2 + HCl = BaCl2 + H2O
Ba(OH)2 + 2HCl = BaCl2 + 2H2O
Ba(OH)2 + HNO3 = Ba(NO3)2 + H2O
Ba(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
Bi(NO3)3 + H2S = HNO3 + Bi2S3
2Bi(NO3)3 + 3H2S = 6HNO3 + Bi2S3

BaCl2+K3PO4=KCl+Ba3(PO4)2
Br2+H2O+SO2=HBr+H2SO4

3BaCl2 + 2K3PO4 = 6KCl + Ba3(PO4)2


Br2 + 2H2O + SO2 = 2HBr + H2SO4
Ba(OH)2*8H2O + 2NH4NO3 = Ba(NO3)2 + 2NH3
Ba(OH)2 * 8H2O + NH4NO3 = Ba(NO3)2 + NH3 + H2O
+ 10H2O
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
B2O3(s) + NaOH(aq) = Na3BO3(aq) + H2O(l)
B2O3(s) + 6NaOH(aq) = 2Na3BO3(aq) + 3H2O(l)
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
BCl3 + H2O = H3BO3 + HCl
BCl3 + 3H2O = H3BO3 + 3HCl
Ba2 + H2SO4 = HOBa + BaHSO3
Ba2 + H2SO4 = HOBa + BaHSO3
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
Ba + H2SO4 + OH = H2O + Ba(HSO4)2
Ba + 2H2SO4 + 2OH = 2H2O + Ba(HSO4)2
Ba(OH)2 + H2O = BaO H2O
Ba(OH)2 + 0H2O = BaOH2O
Br2 + SO2 + H2O = HBr + H2SO4
Br2 + SO2 + 2H2O = 2HBr + H2SO4
Ba(OH)2 + NH4Cl = BaCl2 + NH4OH
Ba(OH)2 + 2NH4Cl = BaCl2 + 2NH4OH
Br2+SO2+H2O=HBr+H2SO4
Br2 + SO2 + 2H2O = 2HBr + H2SO4
BaCl2+Na2SO4=BaSO4+NaCl
BaCl2 + Na2SO4 = BaSO4 + 2NaCl
B2O3+C=B4C+CO2
2B2O3 + 4C = B4C + 3CO2
8Ba(OH) + 17NH4NO3 = 8Ba(NO3)2 + 18NH3 +
Ba(OH) + NH4NO3 = Ba(NO3)2 + NH3 + H2O
11H2O
Ba(OH)2H16O8 + 2NH4NO3 = Ba(NO3)2 + 2NH3
Ba(OH)2H16O8 + NH4NO3 = Ba(NO3)2 + NH3 + H2O
+ 10H2O
Be2C + H2O =Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
Bi+HNO3=Bi(NO3)3+NO+H2O
Bi + 4HNO3 = Bi(NO3)3 + NO + 2H2O
Ba(OH)2+H2SO4=BaSO4+H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(OH)2+H2SO4=BaSO4+2H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
BiCl3+NaOH=Bi(OH)3+NaCl
BiCl3 + 3NaOH = Bi(OH)3 + 3NaCl
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
BaCl2+MgSO4=BaSO4+MgCl2
BaCl2 + MgSO4 = BaSO4 + MgCl2
Ba(OH)2+Fe2(SO4)3=BaSO4+Fe(OH)3
3Ba(OH)2 + Fe2(SO4)3 = 3BaSO4 + 2Fe(OH)3
BF3 + Li2SO3 = B2(SO3)3 + LiF
2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Ba(NO3)2 + NH4OH +(NH4)2SO4 = Ba(SO4)2 +NH4NO3 0Ba(NO3)2 + NH4OH + 0(NH4)2SO4 =
+NH4OH
0Ba(SO4)2 + 0NH4NO3 + NH4OH
BaCl2+NaOH=Ba(OH)2 +NaCl
BaCl2 + 2NaOH = Ba(OH)2 + 2NaCl
BaCl2 + Na3PO4 = Ba3(PO4)2 + NaCl
3BaCl2 + 2Na3PO4 = Ba3(PO4)2 + 6NaCl
Ba + O2 = BaO
2Ba + O2 = 2BaO
BaCO3=BaO+CO2
BaCO3 = BaO + CO2
Bi(NO3)3 + 9Al + 9NaOH = Bi + 3NH3 +
Bi(NO3)3 + Al + NaOH = Bi + NH3 + NaAlO2
9NaAlO2
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
Ba(OH)2+H2SO4=BaSO4+H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
Bi2O3 + NaClO2 + 2NaOH = 2NaBiO3 + NaCl +
Bi2O3 + NaClO2 + NaOH = NaBiO3 + NaCl + H2O
H2O
Ba(OH)2 + H2SO4 = BaSO4 + H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
BaCl2 + Na2CrO4 = BaCrO4 + NaCl
BaCl2 + Na2CrO4 = BaCrO4 + 2NaCl

Be2C + H2O = Be(OH)2 + CH4


B2S3 + H2O = H3BO3 + H2S
BCl3 + P4 + H2 = BP + HCl
B2S3 + H2O = H3BO3 + H2S
BCl3 + P4 + H2 = BP + HCl
Ba(OH)2 * 8H2O +NH4SCN = Ba(SCN)2 + H2O + NH3
Ba(OH)2*8H2O + NH4SCN = Ba(SCN)2 + H2O + NH3
BaCl3+Cu(NO3)2=Ba(NO3)2+CuCl3
Ba(NO3)2+H2SO4 = BaSO4+HNO3
BaCl2(aq) + H3PO4(aq) = Ba3(PO4)2(s) + HCl(aq)
BaSO4 (s) + HNO3 (aq) = Ba(NO3) 2 (aq) + H2SO4(aq)
Ba+O=2BaO
Ba+O=2BaO
Ba+O=BaO2
Ba+O=BaO
Ba+O=BaO
BaCl2(aq)+H3PO4(aq)=Ba3(PO4)2(s)+HCl(aq)
BaO + HNO3 = Ba(NO3)2 + H2O
BaCl2 + CO3 = BaCO3 + Cl
Ba(NO3)2 + MgSO4 = BaSO4 +Mg(NO3)2
BaCl2+Na3PO4=Ba3(PO4)2+NaCl
Ba(NO3)2+(NH4)2CO3=BaCO3+2NH4NO3
BF3(g) + H2O(l)=HF(aq) + H3BO3(aq)
Ba3N2 + H2O = Ba(OH)2 + NH3
BaCl2+AgNO3=AgCl+Ba(NO3)2
Ba(OH)2 + AgNO3 = BaNO3 + Ag(OH)2
Ba+H3PO4=Ba3(PO4)2+H2
BaCl2+H3PO4=Ba3(PO4)2+HCl
BCl3(g) + 6H2O(l)=H3BO3(s) + 8HCl(g)
BCl3(g) + H2O(l) = H3BO3(s) + HCl(g)
Ba(OH)2*8H2O+NH4SCN=Ba(SCN)2+H2O+NH3
Br2 + KOH = KBr + KBrO3 + H2O
BaO+HNO3=Ba(NO3)2+H2O
Ba(OH)2 + P4O10 = Ba3(PO4)2 + H2O
Ba(NO3)2 + K3PO4 = Ba3(PO4)2 + KNO3
BaCl2 + NaHCO3 = Ba(HCO3)2 + NaCl
BaO+HNO3=Ba(NO3)2+H2O
B2O3 + C = B4C + CO
Be2C+ H2O = Be(OH)2 + CH4

Be2C + 4H2O = 2Be(OH)2 + CH4


B2S3 + 6H2O = 2H3BO3 + 3H2S
4BCl3 + P4 + 6H2 = 4BP + 12HCl
B2S3 + 6H2O = 2H3BO3 + 3H2S
4BCl3 + P4 + 6H2 = 4BP + 12HCl
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
10H2O + 2NH3
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
10H2O + 2NH3
BaCl3 + Cu(NO3)2 = Ba(NO3)2 + CuCl3
Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) +
6HCl(aq)
BaSO4(s) + 2HNO3(aq) = Ba(NO3)2(aq) +
H2SO4(aq)
Ba + O = BaO
Ba + O = BaO
Ba + 2O = BaO2
Ba + O = BaO
Ba + O = BaO
3BaCl2(aq) + 2H3PO4(aq) = Ba3(PO4)2(s) +
6HCl(aq)
BaO + 2HNO3 = Ba(NO3)2 + H2O
BaCl2 + CO3 = BaCO3 + 2Cl
Ba(NO3)2 + MgSO4 = BaSO4 + Mg(NO3)2
3BaCl2 + 2Na3PO4 = Ba3(PO4)2 + 6NaCl
Ba(NO3)2 + (NH4)2CO3 = BaCO3 + 2NH4NO3
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
BaCl2 + 2AgNO3 = 2AgCl + Ba(NO3)2
Ba(OH)2 + AgNO3 = BaNO3 + Ag(OH)2
3Ba + 2H3PO4 = Ba3(PO4)2 + 3H2
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
10H2O + 2NH3
3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
BaO + 2HNO3 = Ba(NO3)2 + H2O
6Ba(OH)2 + P4O10 = 2Ba3(PO4)2 + 6H2O
3Ba(NO3)2 + 2K3PO4 = Ba3(PO4)2 + 6KNO3
BaCl2 + 2NaHCO3 = Ba(HCO3)2 + 2NaCl
BaO + 2HNO3 = Ba(NO3)2 + H2O
2B2O3 + 7C = B4C + 6CO
Be2C + 4H2O = 2Be(OH)2 + CH4

Ba(OH)2 + 2NH4NO3 = Ba(NO3)2 + 2H2O +


2NH3
Ba(OH)2 H2O(s) + NH4SCN(s) = Ba(SCN)2(s) + H2O(l) + Ba(OH)2H2O(s) + 2NH4SCN(s) = Ba(SCN)2(s) +
NH3(g)
3H2O(l) + 2NH3(g)
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
Ba(OH)2*8H2O + NH4SCN = Ba(SCN)2 + H2O + NH3
10H2O + 2NH3
Ba(ClO4)2 + Na2S = Na(ClO4) + BaS
Ba(ClO4)2 + Na2S = 2Na(ClO4) + BaS
Br2 + NaI = I2 + NaBr
Br2 + 2NaI = I2 + 2NaBr
B2O3(s) + HF(l) = BF3(g) + H2O(l)
B2O3(s) + 6HF(l) = 2BF3(g) + 3H2O(l)
B2O3(s) + HF(l) = BF3(g) + H2O(l)
B2O3(s) + 6HF(l) = 2BF3(g) + 3H2O(l)
BiCl3 + H2O = HCl + BiOCl
BiCl3 + H2O = 2HCl + BiOCl
BiCl3 + H2O = HCl + BiOCl
BiCl3 + H2O = 2HCl + BiOCl
BaCl2 + Na(NO3) = Ba(NO3)2 + NaCl
BaCl2 + 2Na(NO3) = Ba(NO3)2 + 2NaCl
B2O3+NaOH=Na3BO3+H2O
B2O3 + 6NaOH = 2Na3BO3 + 3H2O
Br2 + KI = KBr + I2
Br2 + 2KI = 2KBr + I2
Br2 + KOH = KBrO3 + KBr + H2O
3Br2 + 6KOH = KBrO3 + 5KBr + 3H2O
Br+KI = KBr+I
Br + KI = KBr + I
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Br2+N2=NBr3
3Br2 + N2 = 2NBr3
BaCl2+H3PO4=Ba3(PO4)2+HCl
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BiO3- + H+ + NH3 = BiO+ + H2O + N2
3BiO3- + 6H+ + 2NH3 = 3BiO+ + 6H2O + N2
BF3(g) + H2O(l) =HF(aq) + H3BO3(aq)
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
BF3(g) + H2O(l)= HF(aq) + H3BO3(aq)
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
Bi+HNO3=Bi(NO3)3+NO+H2O
Bi + 4HNO3 = Bi(NO3)3 + NO + 2H2O
Bi2O3+Cl2+KOH=KCl+KBiO3+H2O
Bi2O3 + 2Cl2 + 6KOH = 4KCl + 2KBiO3 + 3H2O
B2Br6 + HNO3 = B(NO3)3 + HBr
B2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BF3(g) + H2O(l) = HF(aq) + H3BO3(aq)
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
BF3+H2O=HF+H3BO3
BF3 + 3H2O = 3HF + H3BO3
BF3(g) + H2O(l) = HF(aq) + H3BO3(aq)
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
BaCl2 + NaOH = NaCl + Ba(OH)2
BaCl2 + 2NaOH = 2NaCl + Ba(OH)2
BF3(g) + H2O(l) = HF(aq) + H3BO3(aq)
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
BF3(g) + H2O(l) = HF(aq) + H3BO3(aq)
BF3(g) + 3H2O(l) = 3HF(aq) + H3BO3(aq)
Ba + H2O = Ba(OH)2 + H2
Ba + 2H2O = Ba(OH)2 + H2
Ba(OH)2 * 8 H2O(s) + NH4SCN(s) =Ba(SCN)2(s) + H2O(l) Ba(OH)2*8H2O(s) + 2NH4SCN(s) = Ba(SCN)2(s)
+ NH3(g)
+ 10H2O(l) + 2NH3(g)
BaCl2+H3PO4=Ba3(PO4)2+HCl
3BaCl2 + 2H3PO4 = Ba3(PO4)2 + 6HCl
Ba(OH)2 * 8H2O(s) + 2NH4SCN(s) = Ba(SCN)2(s) +
Ba(OH)2*8H2O(s) + 2NH4SCN(s) = Ba(SCN)2(s)
H2O(l) + NH3(g)
+ 10H2O(l) + 2NH3(g)
Ba(NO3)2+Na2CO3=Ba(CO3)+Na(NO3)
Ba(NO3)2 + Na2CO3 = Ba(CO3) + 2Na(NO3)
BF3 + Li2SO3 = B2(SO3)3 + LiF
2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B (NO3)3 + HBr
B2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BCl3(g) + H2O(l) = H3BO3(s) + HCl(g)
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
Ba(OH)2 + NH4 NO3 = Ba(NO3)2 +H2O + NH3

Ba(NO3)2+K2CO3=Ba(CO3)2+2K2NO3
Ba(NO3)2+K2CO3=Ba(CO3)2+2K2NO3

Ba(NO3)2 + 2K2CO3 = Ba(CO3)2 + 2K2NO3


Ba(NO3)2 + 2K2CO3 = Ba(CO3)2 + 2K2NO3
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2
Ba(NO3)2+NH2SO3H+H2O = Ba(NH2SO3)2+HNO3
+ 2HNO3
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2
Ba(NO3)2+NH2SO3H+H2O = Ba(NH2SO3)2+HNO3
+ 2HNO3
Ba(NO3)2 + 2NH2SO3H + 2H2O = Ba(NH2)2 +
Ba(NO3)2+NH2SO3H+H2O = Ba(NH2)2+H2SO4+HNO3
2H2SO4 + 2HNO3
Ba(NO3)2 + NH2SO3H + H2O = BaSO4 +
Ba(NO3)2+NH2SO3H+H2O = BaSO4+NH4NO3+HNO3
NH4NO3 + HNO3
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2
Ba(NO3)2+NH2SO3H+H2O = Ba(NH2SO3)2+HNO3
+ 2HNO3
Ba(NO3)2 + 2NH2SO3H + 0H2O = Ba(NH2SO3)2
Ba(NO3)2+NH2SO3H+H2O=Ba(NH2SO3)2+HNO3
+ 2HNO3
Br2(l) +KI(aq) = I2 + KBr
Br2(l) + 2KI(aq) = I2 + 2KBr
B2S3+H2O=H3BO3+H2S
B2S3 + 6H2O = 2H3BO3 + 3H2S
Ba+H3PO4=Ba(PO4)2+H2
Ba + 2H3PO4 = Ba(PO4)2 + 3H2
BaOH + K2SO4 = KOH + Ba2SO4
2BaOH + K2SO4 = 2KOH + Ba2SO4
BF3 + Li2SO3 = B2(SO3)3 + LiF
2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3= B(NO3)3 + HBr
B2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
BF3+Li2SO3=B2(SO3)3+LiF
2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6+HNO3=B(NO3)3+HBr
B2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Bi2S3+HCl= BiCl3+H2S
Bi2S3 + 6HCl = 2BiCl3 + 3H2S
Br2 + KOH = KBr + KBrO3 + H2O
3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
Be2C + H2O = Be(OH)2 + CH4
Be2C + 4H2O = 2Be(OH)2 + CH4
Bi(O)3 + SnO2 = SnO3 + Bi
Bi(O)3 + 3SnO2 = 3SnO3 + Bi
BaCl2 + H2SO4 = BaSO4 + 2HCl =
BaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2 + H2SO4 = BaSO4 + HCl =
BaCl2 + H2SO4 = BaSO4 + 2HCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba (NO3)2 + Na2SO4 = BaSO4 + NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
BF3 + Li2SO3 = B2(SO3)3 + LiF
2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
B2Br6 + HNO3 = B(NO3)3 + HBr
B2Br6 + 6HNO3 = 2B(NO3)3 + 6HBr
Ba+Cl=BaCl2
Ba + 2Cl = BaCl2
BaCl2+2NaSO4=NaCl2+BaSO4
BaCl2 + NaSO4 = NaCl2 + BaSO4
BaCl2 + Na2SO4 = BaSO4 + NaCl
BaCl2 + Na2SO4 = BaSO4 + 2NaCl
B2O3 + Mg =MgO+B
B2O3 + 3Mg = 3MgO + 2B
BaCl2 + H2SO4 = BaSO4 + HCl
BaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2 + Na2SO4 =BaSO4+NaCl
BaCl2 + Na2SO4 = BaSO4 + 2NaCl
Ba3N2 + H2O = Ba(OH)2 + NH3
Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
B2S3(s) + 6 H2O = 3 H2S(g) + 2H3BO3(aq)
B2S3(s) + 6H2O = 3H2S(g) + 2H3BO3(aq)
BaCl2 + Al2(SO4)3 = BaSO4 + AlCl3
3BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
BaCl2+H2So4=BaSo4+HCl
BaCl2 + H2So4 = BaSo4 + 2HCl
Ba(OH)2+H2O=Ba+OH
Ba(OH)2 + 0H2O = Ba + 2OH
B2S3 + H2O = H3BO3 + H2S
B2S3 + 6H2O = 2H3BO3 + 3H2S

Ba(OH)2 + H3PO4 = Ba3(PO4)2 + H2O


3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
BaCl2 + (NH4)2CO3 = NH4Cl + BaCO3
BaCl2 + (NH4)2CO3 = 2NH4Cl + BaCO3
BaCl2 + K2SO4 = BaSO4 + K2Cl2
BaCl2 + K2SO4 = BaSO4 + K2Cl2
Ba(OH) + HNO3 = Ba(NO3) + H2O
Ba(OH) + HNO3 = Ba(NO3) + H2O
Ba(OH2) + NO3 = Ba(NO3) + H2O
Ba(OH2) + NO3 = Ba(NO3) + H2O
Ba(OH)2 + HNO3 = H2O + Ba(NO3)2
Ba(OH)2 + 2HNO3 = 2H2O + Ba(NO3)2
Ba(OH)2 + H2SO4 = BaSO4 +H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
Br2 +KI = KBr + I2
Br2 + 2KI = 2KBr + I2
Ba + NH3 = Ba3N2 + H2
3Ba + 2NH3 = Ba3N2 + 3H2
Br2 + KI = KBr + I2
Br2 + 2KI = 2KBr + I2
BaCO3 + HCl = BaCl2 + H2O + CO2
BaCO3 + 2HCl = BaCl2 + H2O + CO2
BaCl2 + Co(NO3)2 = Ba(NO3)2 + CoCl2
BaCl2 + Co(NO3)2 = Ba(NO3)2 + CoCl2
BF3 + H2O = HF + H3BO3
BF3 + 3H2O = 3HF + H3BO3
BaCO3 + HCl = BaCl2 + H2O + CO2
BaCO3 + 2HCl = BaCl2 + H2O + CO2
BrO3- + Br- + H+ = Br2 + H2O
BrO3- + 5Br- + 6H+ = 3Br2 + 3H2O
Ba(OH)2 + O2 = BaO + H2O
Ba(OH)2 + 0O2 = BaO + H2O
BaCl2+Na2SO4=BaSO4+NaCl
BaCl2 + Na2SO4 = BaSO4 + 2NaCl
BCl3(g) + H2O(l) = H3BO3(s) + HCl(g)
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
Br2+SO2+H2O=H2SO4+HBr
Br2 + SO2 + 2H2O = H2SO4 + 2HBr
Br2 + (OH)- = (BrO3)- + Br- + H2O
3Br2 + 6(OH)- = (BrO3)- + 5Br- + 3H2O
Bi + O2 = Bi2O3
4Bi + 3O2 = 2Bi2O3
BaO + MnCl2 + H2O = BaCl2 + Mn(OH)2
BaO + MnCl2 + H2O = BaCl2 + Mn(OH)2
BaO + MnCl2 = BaCl2 + MnO
BaO + MnCl2 = BaCl2 + MnO
Bi + O2 = Bi2O3
4Bi + 3O2 = 2Bi2O3
Bi + HNO3 = Bi(NO3)3 + NH4NO3 +H2O
8Bi + 30HNO3 = 8Bi(NO3)3 + 3NH4NO3 + 9H2O
Ba(IO3)2 + Ba5(IO6)2 = BaI + O
3Ba(IO3)2 + Ba5(IO6)2 = 8BaI + 30O
Ba(IO3)2 + Ba5(IO6)2 = BaI +O
3Ba(IO3)2 + Ba5(IO6)2 = 8BaI + 30O
Ba(IO3)2 + Ba5(IO6)2 = BaO + I
7Ba(IO3)2 - 5Ba5(IO6)2 = -18BaO + 4I
BaCl2 = Ba + Cl
BaCl2 = Ba + 2Cl
Br2 + Na = NaBr
Br2 + 2Na = 2NaBr
Bi(OH)3 + HNO3 = BiNO3 + H + OH
Bi(OH)3 + HNO3 = BiNO3 + H + 3OH
Bi(OH)3 + HNO3 = BiNO3 + H + O
Bi(OH)3 + HNO3 = BiNO3 + 4H + 3O
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba(OH)2(H2O)8 + 2NH4SCN = Ba(SCN)2 +
Ba(OH)2(H2O)8 + NH4SCN = Ba(SCN)2 + H2O + NH3
10H2O + 2NH3
BaCl2+Al2(SO4)3=BaSO4+AlCl3
3BaCl2 + Al2(SO4)3 = 3BaSO4 + 2AlCl3
Ba(NO3)2 + Na2SO4= BaSO4 + Na2(NO3)2
Ba(NO3)2 + Na2SO4 = BaSO4 + Na2(NO3)2
Ba(OH)2+H2SO4=BaSO4+2H2O
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
BCl3(g) + H2O(l) = H3BO3(s) + HCl(g)
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
BF3+ NaH = NaBF4 + B2H6
8BF3 + 6NaH = 6NaBF4 + B2H6
Ba(OH)2+Fe(NO3)3=Fe(OH)3+Ba(NO3)2
3Ba(OH)2 + 2Fe(NO3)3 = 2Fe(OH)3 + 3Ba(NO3)2
Br2+NaOH=NaBrO3+NaBr+H2O
3Br2 + 6NaOH = NaBrO3 + 5NaBr + 3H2O
Bi(OH)3 + Na2SnO2 = Bi + Na2SnO3 + H2O
2Bi(OH)3 + 3Na2SnO2 = 2Bi + 3Na2SnO3 + 3H2O

BaCl2 + Na2SO3=BaSO3 + Na2Cl2


B10H18 + O2 = B2O3 + H2O

BaCl2 + Na2SO3 = BaSO3 + Na2Cl2


B10H18 + 12O2 = 5B2O3 + 9H2O
Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4 +
Ba(NO3)2(aq) + Na2SO4(aq) = BaSO4 + NaNO3(aq)
2NaNO3(aq)
Bi(NO3)3 + H2S = Bi2S3 + HNO3
2Bi(NO3)3 + 3H2S = Bi2S3 + 6HNO3
B5H9 + O2 = B2O3 + H2O
2B5H9 + 12O2 = 5B2O3 + 9H2O
Bi2S3 + HCl = BiCl3 + H2S
Bi2S3 + 6HCl = 2BiCl3 + 3H2S
BaCl2+Na2SO4=BaSO4+NaCl
BaCl2 + Na2SO4 = BaSO4 + 2NaCl
BF3 + Li2SO3 = B2(SO3)3 + LiF
2BF3 + 3Li2SO3 = B2(SO3)3 + 6LiF
Ba(OH)2 + H3PO4 = Ba3(PO4)2 + H2O
3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
Ba + H2O = Ba(OH)2 + H2
Ba + 2H2O = Ba(OH)2 + H2
Ba+H2SO4=BaSO4+SO2+H2O
Ba + 2H2SO4 = BaSO4 + SO2 + 2H2O
BF3+NaH=NaBF4+B2H6
8BF3 + 6NaH = 6NaBF4 + B2H6
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
BaO + As2O5 = Ba3 (AsO4)2
3BaO + As2O5 = Ba3(AsO4)2
Ba(HCO3)2 + Ba(HSO4)2 = 2BaSO4 + 2CO2 +
Ba(HCO3)2 + Ba(HSO4)2 = BaSO4 + CO2 + H2O
2H2O
Ba(HSO4)2 + Na2SO4 = BaSO4 + NaHSO4
Ba(HSO4)2 + Na2SO4 = BaSO4 + 2NaHSO4
Ba2+O2=BaO
Ba2 + O2 = 2BaO
BaO+H2O=Ba(OH)2
BaO + H2O = Ba(OH)2
B2O3 + HF = BF3 + H2O
B2O3 + 6HF = 2BF3 + 3H2O
BCl3(g) + H2O(l) = H3BO3(s) + HCl(g)
BCl3(g) + 3H2O(l) = H3BO3(s) + 3HCl(g)
Br2+H2S=HBr+S
Br2 + H2S = 2HBr + S
BaO+As2O5=Ba3(AsO4)2
3BaO + As2O5 = Ba3(AsO4)2
BaCl2+H2So4=HCl+BaSo4
BaCl2 + H2So4 = 2HCl + BaSo4
Bi(NO3)3 + 9AL + 9NaOH = Bi + 3NH3 +
Bi(NO3)3+AL+NaOH=Bi+NH3+NaALO2
9NaALO2
Br2(l)+I2(s) = IBr3(g)
3Br2(l) + I2(s) = 2IBr3(g)
Br2 + HClO + H2O = HBrO3 + HCl
Br2 + 5HClO + H2O = 2HBrO3 + 5HCl
Br2 + HCLO + H2O = HBrO3 + HCL
Br2 + 5HCLO + H2O = 2HBrO3 + 5HCL
BaCl2 + Bi2(SO4)3 = BiCl3 + 3BaSO4
3BaCl2 + Bi2(SO4)3 = 2BiCl3 + 3BaSO4
Ba(NO3)2+H3PO4=Ba3(PO4)2+HNO3
3Ba(NO3)2 + 2H3PO4 = Ba3(PO4)2 + 6HNO3
B2O3 + HF = BF3 + H2O
B2O3 + 6HF = 2BF3 + 3H2O
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
Ba(OH)2*8H2O+NH4SCN= Ba(SCN)2+H2O+NH3
10H2O + 2NH3
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
Ba(OH) + H2O = BaO + H3O
Ba(OH) + H2O = BaO + H3O
B2S3(s) + H2O(l) = H3BO3(l) + H2S(g)
B2S3(s) + 6H2O(l) = 2H3BO3(l) + 3H2S(g)
Ba(OH)2 + 2NH4SCN(s) = Ba(SCN)2(s) + 2H2O(l)
Ba(OH)2 + NH4SCN(s) = Ba(SCN)2(s) + H2O(l) + NH3(g)
+ 2NH3(g)
BaO2 + HCl = BaCl2 + H2O2
BaO2 + 2HCl = BaCl2 + H2O2
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O

Ba(OH)2+HNO3=Ba(NO3)2+H2O
Ba(OH)2 + H2O = Ba + OH
Ba(OH)2 + H2O = Ba + 2OH
BaCl2 + K2SO4 = BaSO4 + 2 KCl

Ba(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O


Ba(OH)2 + 0H2O = Ba + 2OH
Ba(OH)2 + 0H2O = Ba + 2OH
BaCl2 + K2SO4 = BaSO4 + 2KCl
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
Ba(OH)2*8H2O+NH4SCN=Ba(SCN)2+H2O+NH3
10H2O + 2NH3
BaCl2 + K2SO4 = BaSO4+ KCl
BaCl2 + K2SO4 = BaSO4 + 2KCl
Ba(OH)2*8H2O+HNO3=Ba(NO3)2+H2O
Ba(OH)2*8H2O + 2HNO3 = Ba(NO3)2 + 10H2O
Ba(OH)2+HNO3=Ba(NO3)2+H2O
Ba(OH)2 + 2HNO3 = Ba(NO3)2 + 2H2O
B+F3=BF3
B + F3 = BF3
Ba(OH)2 + H3PO4 = Ba3(PO4)2 + H2O
3Ba(OH)2 + 2H3PO4 = Ba3(PO4)2 + 6H2O
BaCl + MgSO4 = BaSO4 + MgCl
BaCl + MgSO4 = BaSO4 + MgCl
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O
B2S3 + H2O = H3BO3 + H2S
B2S3 + 6H2O = 2H3BO3 + 3H2S
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
Ba(OH)2*8H2O + NH4SCN = Ba(SCN)2 +H2O + NH3
10H2O + 2NH3
Bi(NO3)3 + Al + NaOH = Bi + NH3 + NaAlO2Bi(NO3)3 + 9Al + 9NaOH = Bi + 3NH3 + 9NaAlO2
BaCl2 + Na3PO4 = Ba3 (PO4)2 + NaCl
3BaCl2 + 2Na3PO4 = Ba3(PO4)2 + 6NaCl
Ba(ClO3)2 + Na2S = NaClO3 + BaS
Ba(ClO3)2 + Na2S = 2NaClO3 + BaS
BaCl2 + Na3PO4 = Ba3 (PO4)2 + NaCl
3BaCl2 + 2Na3PO4 = Ba3(PO4)2 + 6NaCl
Ba + N2 = Ba3N2
3Ba + N2 = Ba3N2
Ba + Na2 = 2Ba3Na2
3Ba + Na2 = Ba3Na2
Ba(OH)2 + H2C2O4 = BaO4 + H2C2(OH)2
Ba(OH)2 + H2C2O4 = BaO4 + H2C2(OH)2
Ba + H3PO4 = Ba3(PO4)2 + H2
3Ba + 2H3PO4 = Ba3(PO4)2 + 3H2
BaCl2+Na2SO4=Ba2SO4+NaCl2
2BaCl2 + Na2SO4 = Ba2SO4 + 2NaCl2
BaCO3 + C2 +H2O = CO +Ba(OH)2
2BaCO3 + C2 + 2H2O = 4CO + 2Ba(OH)2
Ba(OH)2 + CO2 = BaCO3 +H2O
Ba(OH)2 + CO2 = BaCO3 + H2O
Ba(NO3)2 + H2S = BaS + HNO3
Ba(NO3)2 + H2S = BaS + 2HNO3
Br2 + KOH = KBr + KBrO3 + H2O
3Br2 + 6KOH = 5KBr + KBrO3 + 3H2O
BaCO3+H2SO4=BaSO4+H2O+CO2
BaCO3 + H2SO4 = BaSO4 + H2O + CO2
B2S3+H2O=H3BO3+H2S
B2S3 + 6H2O = 2H3BO3 + 3H2S
Ba3N2+H2O=Ba(OH)2+NH3
Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Ba+HNO3=Ba(NO3)2+H2O+O2
-2Ba - 4HNO3 = -2Ba(NO3)2 - 2H2O + O2
Ba+HNO3=Ba(NO3)2+H2O+O2
-2Ba - 4HNO3 = -2Ba(NO3)2 - 2H2O + O2
Ba(NO3)2 + H2SO4 = BaSO4 + HNO3
Ba(NO3)2 + H2SO4 = BaSO4 + 2HNO3
Br+HCl=BrCl +H
Br + HCl = BrCl + H
B2S3 + H2O = H3BO3 + H2S
B2S3 + 6H2O = 2H3BO3 + 3H2S
Ba(NO3)2+Na2SO4 = BaSO4 + NaNO3
Ba(NO3)2 + Na2SO4 = BaSO4 + 2NaNO3
Br2 + AlI3 = I + AlBr3
3Br2 + 2AlI3 = 6I + 2AlBr3
Ba(NO3)2+NaOH = Ba(OH)2 +NaNO3
Ba(NO3)2 + 2NaOH = Ba(OH)2 + 2NaNO3
Ba(NO3)2+NaCl =BaCl2 +NaNO3
Ba(NO3)2 + 2NaCl = BaCl2 + 2NaNO3
Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3 2Bi(NO3)3*5H2O + H2O2 + 2RuCl3 + 12NaOH =
+NaCl+H2O
Bi2Ru2O7 + 6NaNO3 + 6NaCl + 17H2O

BaCl2 + Na2SO4 = BaSO4 + NaCl


Br2 + NH3 = NH4Br + N2
Bi(OH)3 + Na2SnO2=Bi+Na2SnO3+H2O
Ba(NO3)2=BaO+NO2+O2
Ba(NO3)2=BaO+NO2+O2
Ba(OH)2 + H2C2O4 = H2O + BaC2O4
Ba(NO3)2 + Na3PO4=BaPO4 + Na3(NO3)2
BaBr2 + K2Cr2O7 + H3PO4 = CrPO4 + Ba3(PO4)2 +
K3PO4 + Br2 + H2O
BaCl2+NaOH = Ba(OH)2+NaCl
BaCl2 + K2SO4 = BaSO4 +KCl
BaCl2 + K2SO4 = BaSO4 +2KCl
Ba(OH)2 + H2SO4 = BaSO4 + H2O
BCl3 + H2O = H3BO3 + HCl
B2O3 + NaOH = Na3BO3 + H2O
B2O3 + NaOH = Na3BO3 + H2O
BaCl2+H2SO4=BaSO4+HCl
BaCl2 + K2(CO3) = Ba(CO3) + KCl
Ba(NO3)2+(NH4)2SO4=BaSO4+NH4NO3
B2O3 + Mg = B + Mg2O
Ba3N2 + H2O=Ba(OH)2 + NH3
Ba + OH = BaOH
Br2 + KClO3 + H2SO4 + H20 = HBrO3 + K2SO4 + HCl
Ba(OH)2*8H2O + NH4SCN = Ba(SCN)2 + H2O + NH3
Br2+SO2+H2O=H++Br-+SO4
Br2+SO2+H2O=H++Br-+SO42BaCl2 + H2SO4 =BaSO4 + HCl
BaS + PtF2 = BaF2 + PtS
BaCl2 + K2CO3 = BaCO3 + KCl
B2S3 + H2O = H3BO3 + SH2
Br2 + H2O = HBrO + HBr
BaTiO3 + H20 = Ba(OH)2 + TiO
Ba(HSO4)2 + K2CO3 = BaSO4 + K2SO4 + CO2 + H2O
BaCl2 + NaHSO4 = BaSO4 + Na2SO4 + HCl
Ba(OH)2 + Al2(SO4)3 = Al(OH)2 + Ba2(SO4)3
Bi2(CO3)3 = Bi2O3 + 3CO2
BaCl2 + Na2SO3 = NaCl + BaSO3
Ba(OH)2 + H2SO4 = BaSO4 + H2O
BaCl2 + NaOH = Ba(OH)2 + NaCl
Bi2O3 + Na(OH) + NaClO2 = NaCl + NaBiO3 + H2O

BaCl2 + Na2SO4 = BaSO4 + 2NaCl


3Br2 + 8NH3 = 6NH4Br + N2
2Bi(OH)3 + 3Na2SnO2 = 2Bi + 3Na2SnO3 + 3H2O
2Ba(NO3)2 = 2BaO + 4NO2 + O2
2Ba(NO3)2 = 2BaO + 4NO2 + O2
Ba(OH)2 + H2C2O4 = 2H2O + BaC2O4
Ba(NO3)2 + Na3PO4 = BaPO4 + Na3(NO3)2
9BaBr2 + 3K2Cr2O7 + 14H3PO4 = 6CrPO4 +
3Ba3(PO4)2 + 2K3PO4 + 9Br2 + 21H2O
BaCl2 + 2NaOH = Ba(OH)2 + 2NaCl
BaCl2 + K2SO4 = BaSO4 + 2KCl
BaCl2 + K2SO4 = BaSO4 + 2KCl
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
BCl3 + 3H2O = H3BO3 + 3HCl
B2O3 + 6NaOH = 2Na3BO3 + 3H2O
B2O3 + 6NaOH = 2Na3BO3 + 3H2O
BaCl2 + H2SO4 = BaSO4 + 2HCl
BaCl2 + K2(CO3) = Ba(CO3) + 2KCl
Ba(NO3)2 + (NH4)2SO4 = BaSO4 + 2NH4NO3
B2O3 + 6Mg = 2B + 3Mg2O
Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Ba + OH = BaOH
10Br2 + 20KClO3 + 10H2SO4 + H20 = 20HBrO3
+ 10K2SO4 + 20HCl
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
10H2O + 2NH3
2Br2 + SO2 + 2H2O = 4H+ + 4Br- + SO4
79Br2 + 2SO2 + 80H2O = 160H+ + 158Br- +
2SO42BaCl2 + H2SO4 = BaSO4 + 2HCl
BaS + PtF2 = BaF2 + PtS
BaCl2 + K2CO3 = BaCO3 + 2KCl
B2S3 + 6H2O = 2H3BO3 + 3SH2
Br2 + H2O = HBrO + HBr
10BaTiO3 + H20 = 10Ba(OH)2 + 10TiO
Ba(HSO4)2 + K2CO3 = BaSO4 + K2SO4 + CO2 +
H2O
BaCl2 + 2NaHSO4 = BaSO4 + Na2SO4 + 2HCl
2Ba(OH)2 + Al2(SO4)3 = 2Al(OH)2 + Ba2(SO4)3
Bi2(CO3)3 = Bi2O3 + 3CO2
BaCl2 + Na2SO3 = 2NaCl + BaSO3
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O
BaCl2 + 2NaOH = Ba(OH)2 + 2NaCl
Bi2O3 + 2Na(OH) + NaClO2 = NaCl + 2NaBiO3 +
H2O

BaCl2 + K2CrO4= BaCrO4 + KCl


Be2C+H2O=Be(OH)2+CH4
Ba(OH)2 + HI= BaI2 + H2O
Ba O2 = O2 + 2Ba O
Ba3N2+H2O=Ba(OH)2+NH3
Ba(NO3)2+CaCl2=BaCl2+Ca(NO3)2
Bi(OH)3+K2SnO2=Bi+K2SnO3+H2O
Br2+H2O=HBrO3+HBr
Br2+H2O=HBrO3+HBr
Be2C + H2O = Be(OH)2 + CH4
BaBr2 +(NH4)2SO4 = BaSO4 + NH4Br
BaCl2 + Na2SO4 = BaSO4 + NaCl
BaO + H2O = Ba(OH)2
Ba(OH)2 + Na3PO4 = Ba3(PO4)2 + NaOH
BaO + H2O = Ba(OH)2
Br2+ CH2Cl2 = BrCl + CH2
Br2+ CH2Cl2 = CH2Br2 + Cl2
BaO + H2O=Ba(OH)2
BaF2 + SrCO3 = BaCO3 + SrF2
Ba(OH)2*8H2O+NH4SCN = Ba(SCN)2+H2O+NH3
Bi + O2 = Bi2O3
BrO3- + I- + H+ = Br- + I2 + H2O
Bi + NO3- + H+ = Bi++ + NO + H2O
BaO+P2O5=Ba+P2O6
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O

BaCl2 + K2CrO4 = BaCrO4 + 2KCl


Be2C + 4H2O = 2Be(OH)2 + CH4
Ba(OH)2 + 2HI = BaI2 + 2H2O
2BaO2 = O2 + 2BaO
Ba3N2 + 6H2O = 3Ba(OH)2 + 2NH3
Ba(NO3)2 + CaCl2 = BaCl2 + Ca(NO3)2
2Bi(OH)3 + 3K2SnO2 = 2Bi + 3K2SnO3 + 3H2O
3Br2 + 3H2O = HBrO3 + 5HBr
3Br2 + 3H2O = HBrO3 + 5HBr
Be2C + 4H2O = 2Be(OH)2 + CH4
BaBr2 + (NH4)2SO4 = BaSO4 + 2NH4Br
BaCl2 + Na2SO4 = BaSO4 + 2NaCl
BaO + H2O = Ba(OH)2
3Ba(OH)2 + 2Na3PO4 = Ba3(PO4)2 + 6NaOH
BaO + H2O = Ba(OH)2
Br2 + CH2Cl2 = 2BrCl + CH2
Br2 + CH2Cl2 = CH2Br2 + Cl2
BaO + H2O = Ba(OH)2
BaF2 + SrCO3 = BaCO3 + SrF2
Ba(OH)2*8H2O + 2NH4SCN = Ba(SCN)2 +
10H2O + 2NH3
4Bi + 3O2 = 2Bi2O3
BrO3- + 6I- + 6H+ = Br- + 3I2 + 3H2O
3Bi + 2NO3- + 8H+ = 3Bi++ + 2NO + 4H2O
BaO + P2O5 = Ba + P2O6
Ba(OH)2 + H2SO4 = BaSO4 + 2H2O