You are on page 1of 29

Analisa Kualitatif

(Analisa Kation)
Kation-kation :
Golongan 1,
Golongan 2,
Golongan 3

Pendahuluan

Analisa Kualitatif adalah suatu analisa yang


digunakan untuk memisahkan dan mendeteksi sejumlah
kation dan anion dalam suatu bahan sampel
Merupakan cabang ilmu kimia yang berhubungan
dengan identifikasi unsur atau golongan yang terdapat
dalam sampel.
Teknik-teknik yang digunakan dalam analisis kualitatif
berbeda-beda dalam kompleksitas, tergantung pada
sifat sampel.
Dalam beberapa kasus untuk membuktikan adanya
unsur-unsur atau golongan tertentu diperlukan tes
spesifik dari sampel
.

Pertama, ion akan dipisahkan dalam


kelompok-kelompok dari larutan awal.
Setelah masing-masing kelompok telah
terpisah, maka pengujian dilakukan untuk ion
individu dalam setiap kelompok.
Kation - kelompok ion atau ion memiliki
muatan positif.
- merupakan atom yang kehilangan elektron
menjadi bermuatan positif. Misalnya, Natrium
memiliki satu elektron valensi, satu elektron
pada tingkat energi terluarnya, sehingga
cenderung kehilangan satu elektron, dan
menjadi sebuah ion dengan muatan +

Menurut sifatnya, kation


diklasifikasikan menjadi 5
golongan.

Kation Golongan 1
(Golongan kation yg
tidak larut dalam
Ag+
klorida
)
2+
Pb
Hg22+
Mengendap in HCl 6
M

Kation golongan 2 Golongan yang tidak


larut dalam asam
Cd2+
sulfida
Bi3+
Cu2+
As3+
As5+
Sb3+
Mengendap larutan
Sb5+
dalam H2S 0,1 M pada
2+
Sn
pH 0.5
Sn4+
Hg2+
Pb2+

Kation golongan 3
Zn2+
Ni2+
Co2+
Mn2+
Fe2+
Fe3+
Al3+
Cr3+

Golongan ini tidak


larut dalam basa
sulfida

Mengendap dalam
H2S 0,1 M pada pH 9

Golongan ini tidak


Kation golongan 4
larut dalam larutan
Ba2+
Carbonat
Ca2+
Kation golongan ini
Sr2+
mengendap dalam
larutan (NH4)2CO3
1M pada pH 10
Kation golongan 5
Mg2+
Tidak larut dalam
Li+
klorida
Na+
K+
Tidak membentuk
NH4+
endapan

C. Persiapan Larutan uji

Sejumlah sampel-> larutkan dalam


pelarut yang sesuai. Gunakan ini
sebagai larutan uji
Ingat: selalu mengasumsikan bahwa
semua kation masih belum diketahui
Catatan: Diagram skematis termasuk
di lab Halaman manual-terakhir

Identification of Cation
Separation and Identification of Group 1 cation

Diskusi
Mengapa ditambahkan 6
M HCl?
Golongan 1 terdiri dari
kation bentuk ion klorida
yang tidak larut dan HCl
adalah sarana kita untuk
memiliki Cl dalam reaksi
membentuk presipitat.
Reaksinya adalah sbb:
Ag(l) + HCl(l) AgCl(s) + H+(g)
Pb+2(l)+ 2HCl(l)PbCl2(s) +
2H+(g)
Hg22+(l) + 2HCl(l) Hg2Cl2(s)
+ 2H+(g)

Mengapa harus dihindari penambahan HCl secara


berlebih? Krn kelebihan HCL akan membentuk
kompleks ion-ions yg larut

AgCl(s)+ Cl(aq)[AgCl2]- dikloroargentat


PbCl2 (s)+ 2Cl(aq)[PbCl4]2- tetrakloroplumbat
Hg2Cl2 (s)+ 2Cl(aq)[Hg2Cl4]2- tetrakloro hidrat
Mengapa harus ditambahkan air mendidih?

Ini dapat dijelaskan melalui Ksp dan pengaruh


suhu. produk kelarutan. Ksp perak klorida dan timbal
masing-masing 1,8 x 10-10 dan 1,7 x10-5,. Ini berarti
tidak ada satu garam pun yg larut dan AgCl kurang
larut dibandingkan dengan PbCl 2. Peningkatan suhu
akan menyebabkan kelarutan lebih besar untuk Pb
Simak
Baca secara fonetik
..

Mengapa
ditambahkan K2CrO4
1M?
K2CrO4 akan
memberikan gugus
CrO4 yg akan
bereaksi dg PbCl2
membentuk endapan
kuning dg reaksi sbb:
PbCl2+CrO4 PbCrO4(s)
+ 2Cl

Mengapa ditambahkan NH3 6M?


Utk membentuk endapan yg
dikehendaki NH3 digunakan sbg
senyawa pengkompleks. Ini dpt
dijelaskan melalui reaksi sbb:
AgCl + 2NH3[Ag(NH3)2]++ClHg2Cl2 + NH3 Hg(s) + HgNH2Cl + Cl Mengapa ditambahkan HNO3 6M
sampai asam (gunakan lakmus) ?
Penambahan HNO3 ke dlm larutn akan
mengubah konpleks [Ag(NH3)2]
menjadi Ag and NH3 dan penambahan
sampai mjd asam utk meyakinkan
bahwa jumlah HNO3 dalm larutan
telah cukup. Sesuai dengan reaksi
sbb:
[Ag(NH3)2]++ HNO3 Ag+ NH3
ClAgCl(white)

Separation and Identification of


Group 2 Cations

Diskusi

Mengapa pH harus disesuaikan sampai 0.5?


Kation Gol.2 adalah gol yg tidak larut dalam
kelompok sulfida. Jd penurunan pH akan
membuat kation gol 2 tetap dlm bentuk
larutan . Jika penyusuaian tidak tercapai,
ada kemungkinan kation gol 3 akan
mengendap juga dlm larutan. Selain itu juga,
pd pengendapan gol.2 dg H2S, penambahan
H+ akan mengubah arah reaksi ke kiri
sehingga S2+ menjadi rendah. So, only fairly
insoluble sulfide groups will precipitate in
the soln. Consider the reaction
H2S(aq) 2H+(aq) + S2-(aq)

Mengapa ditambahkan
thioacetamide?
Thioacetamide (CH3CSNH2), mrpkn
sumber H2S krn ia akam terurai
membentuk hidrogen sulfida
dengan adanya asam menrt
reaksi berikut
CH3CSNH2 + 2H2OCH3CO2- +
NH4+ + H2S
Hasil reaksi yg terjadi:
Pb+2+H2S PbS(s) + 2H+
Bi+3+3H2S Bi2S3(s) + 6H+
Cu+2+H2S CuS(s) + 2H+
Cd+2+H2S CdS(s) + 2H+
Hg+2+H2S HgS(s) + 2H+
2Sb+3+3H2S Sb2S3(s)+6H+
Sn+2+2H2S SnS(s) + 4H+

Mengapa ditambahkan HNO3 6 M?


Untuk menghasilkan kation yg dikehendaki . Ini
dpt dijelaskan melalui reaksi berikut :
Ex. PbS+4H++NO-3Pb+2+S(s) + NO(g)+2H2O
Mengapa endapan kuning harus dibuang?
Krn hanya merupakan produk dr belerang
Mengapa ditambahkan HCl 6 M?
Utk menghasilkan endapan Pb,
Pb+2Cl-PbCl2(white)
Mengapa ditambahkan NaOAc dan K 2CrO4 ke
dalam endapan putih?
Uji utk keberadaan Pb
PbCl2+2NaC2H3O2 Pb(C2H3O2)2+2NaCl
Pb(C2H3O2)2+K2CrO4PbCrO4(yellow)

Utk Hg, Mengapa ditambahkan HCl 6M, HNO 3


6M, dan 0.1M SnCl2?
Uji identifikasi Hg. Menurut reaksi
Hg(NO3)2 + HCl HgCl+HNO3
HgCl+HNO3 Hg(NO3) 2 + HCl
HgNO3+SnCl2 Hg2Cl2+Sn(NO3)2

Mengapa ditambahkan 6M NH3 utk


mendekantasi?
Utk memperoleh endapan yg dikehendaki spt pd
reaksi berikut:
Bi+3+3NH3+3H2O Bi(OH)3(white)+NH4
Cu+2+2NH3+2H2O Cu(OH)2(light blue)+2NH4
Cd+2+2NH3+2H2O Cd(OH)2(white)+2NH4

Mengapa ditambahkan 6M CH 3COOH


dan K4Fe(CN)6?
Uji identifikasi utk Cu, penambahan
CH3COOH akan membuat larutan mjd
asam. Pembentukan Fe(CN)6 dari
K4Fe(CN)6 digunakan utk mereaksikan
Cu. Tembaga(II) bereaksi dg kalium
ferrocyanida dan asam (HCl encer) mjd
endapan tembaga ferosianida merah
bata :
Cu2+ + K4Fe(CN)6 Cu2[Fe(CN)6]
Mengapa ditambahkan Na2S2O4 dan
thioacetamide?
Utk uji identifikasi Cd, Na2S2O4 bereaksi
dg Cd(OH)2 melalui reaksi
Cd(OH)2 + Na2S2O4 Cd(S2O4)2+ NaOH
H2S from thioacetamide will react to Cd
forming
Cd+H2S CdS(yellow)+2H

Separation and Identification of Group 3 Cations

Continued

Diskusi
Mengapa ditambahkan 5% thioacetamide dan NH3?
Kation gol. III ions form sulfides that are more
soluble than those of Group II, but they may be
precipitated as sulfides if the sulfide concentration is
sufficiently large. Addition of conc. NH3 (aq) to the
thioacetamide insures that the necessary sulfide
concentration will be reached. Consider this
reactions:
Fe3+ +H2S Fe3+ +S+2H+
2NH3 +H2S 2NH4+S
Ni2+ +H2S NiS+2H
Fe2+ +H2S FeS+2H+
Mn2+ +H2S MnS+2H+
Al3+ +3NH3+3H2O Al(OH)3+3NH4
Co2+ +H2S CoS+2H+
Zn2+ +H2S ZnS+2H+
Cr3+ +3NH3+3H2O Cr(OH)3 +3NH4

Why add 1M HCl?


To separate NiS and CoS to the rest
because they are insoluble in HCl
Why add 1M HCl and 16M HNO ?
3
To achieve the desired cation and they
are soluble in it. Consider this reaction:
3CoS+8H++2NO3 3Cu+2+3S+2No+4H2O
3NiS+8H++2NO3 3Ni+2+3S+2No+4H2O
Why add DMG or dimethylgloxime?
To confirm the presence of Ni. The free
Ni2+ that results is first complexed
with ammonia and then detected as an
insoluble, scarlet coordination
compound of dimethylglyoxime
(DMGH2). The structures of DMGH2
and the coordination compound are
shown below. Note that DMGH2 is
weakly acidic and loses one of its two
acidic protons in order to form an
electrically neutral complex. This
DMGH2 conjugate base anion can be
abbreviated DMGH- in your net
reactions.
Ni(NH3)6+2H2DMG
Ni(HDMG)2+4NH3+2NH4

Mengapa ditambahkan HCl1M ,


NH4CNS dan aseton?
Untuk membentuk larutan yg berwarna
biru sesuai dengan reaksi berikut
Co2++4SCN- Co(SCN)42-(lar.biru)
Mengapa ditambahkan 6M CH 3COOH
dan KNO3
Utk membentuk endapan kuning yg
menunjuukan adanya Co. Sesuai dg
reaksi berikut
Co3++6KNO2 K3Co(NO2)6(yellow ppt)

Why add 4M NaOH and 3% H2O2


To separate cations based on their properties.
Consider reactions

Fe3+ +3OH- Fe(OH)3


Mn2+ +2OH- Mn(OH)2
Al3+ +3OH- Al(OH)3
Cr3+ +3OH- Cr(OH)3
Zn2+ +2OH- Zn(OH)2
Adding H2O2 will separate Mn and Fe
from the rest
Consider example reaction:
Mn(OH)2+H2O2 MnO2+H2O2

Why add NaBIO3 and HNO3?


To confirm the presence of Mn. Consider
reaction NaBiO3+6H+2e

Bi+Na+3H2O
2Mn2++5NaBiO4+14H+
2MnO4+5Bi+5Na+7H2O

Why add KSCN?


To confirm presence Fe2+.Consider reaction
Fe2++2SCN- Fe(SCN)2(red)
Why add K4Fe(CN)6?

To confirm presence of Fe3+

4Fe3++Fe(CN)6 Fe4[Fe(CN)6]

Why add 6M CH3COOH, Al reagent, (NH4)2CO3?


To form red lake which shows the presence of Al
Al(OH)3+3H Al+3H2O
(NH4)2CO3 NH3 + H2O + CO2
Why add 1M CH3COOH, 0.1M Pb(OAc)2
To form yellow precipitate that will show the
presence of Cr. Consider the reaction
Pb(C2H3O2)2+CrO4PbCrO4+2C2H3O2
Why add 5% thioacetamide, 6M NH 3,HCl and
K4Fe(CN)6
To show the presence of Zn. Consider the
reaction
4Zn+2K+[Fe(CN)6]4-K2Zn4[Fe(CN)6]