You are on page 1of 42

V-Lines (1Mark)

Page 1 of 6
1. Find a vector in the direction of vector

2. Find

that has magnitude 7 units.

, if two vectors are such that

3. Find the value of


4. Find the projection of the vector
5. If

are any two vectors such that

then what is the angle between

6. Find the unit vector paralle to vactors 3+ - 3k and -2 - + 3 k


7. Find the value of if + 2 + k and 5 - 9 + 2k are perpendicular .
8. If

find the angle between and

9. Find the unit vector in the direction of

10. Write the vector equation and the direction ratio of the line
11. Cartesian equations of a line AB are:-

Write the equation of a line passing through (1, 2, 3) parallel to AB.


12. Write the position vector of a point dividing the line segment joining points A and B with position
Vectors

externally in the ratio 1 : 3 , where

13. If
14. If

and

find a unit vector in the direction of


= 2j+2 k b = 3i 5k find

15. Find so that vectors

are perpendicular .

16. Find the Cartesian and vector equations of a line which passes through the point (1,2,3) and is
parallel to the line
17. Find the unit vector perpendicular to the vectors a = i + 3j + 4k and b = 2i j 3k.
18. What is the value of i ( j x k ) + j ( k x i ) + k ( i x j ) ?

19. Write all unit vector in X Y plane.


20. Find a vector of magnitude 9 units, which is perpendicular to both the vectors

21. Find , when the projection of on is


22. If a, b, and c are unit vectors such that
23. Find the value of x for which

.
, then find the Value of
is a unit vector.

24. Find the direction cosines of a line that makes equal angle with the coordinate axes
25. Find the angle between two vectors

with magnitude

and 2 respectively and such that

26. Find
27. Find
28. Find the scalar components of a unit vector which is perpendicular to the vectors
.

29. The Cartesian equations of a line AB are


30. If

. Find the direction ratios of the line AB.

is a unit vector

31. Find the value of


32. Find the angle made by the vector i 4j + 8k with the z axis.
33. Find the position vector of a point R which divides the line joining the points P(i + 2j k) and Q(-i + j + k)
in the ratio 2 : 1 externally.
34. A line makes angles 60 and 45 with x and y-axis respectively. Find the angle which it makes with z-axis.

35. Find the angle between the line

and

36. The equation of a line 3x + 1 = 6y 2 = 1 z. Find the d.rs and d.cs of the line

37. Find the equation of line which passes through the point (1, -1, 2) and parallel to to
38. Find angle betweenlines r= 4i 3j + k+ (3i + 2j + 6k)andr = 8i 2k + (i + 2j + 2k)

39. If
40. If

41. Find , when the projection of on is


42. If a, b, and c are unit vectors such that
43. Find the value of x for which

.
, then find the Value of
is a unit vector.

44. Find the direction cosines of a line that makes equal angle with the coordinate axes
45. Find the angle between two vectors

with magnitude

and 2 respectively and such that

46. Find
47. Find
48. Find the scalar components of a unit vector which is perpendicular to the vectors
.

49. The Cartesian equations of a line AB are


50. If

. Find the direction ratios of the line AB.

is a unit vector

51. Find the value of


52. Find the angle made by the vector i 4j + 8k with the z axis.
53. Find the position vector of a point R which divides the line joining the points P(i + 2j k) and Q(-i + j + k)
in the ratio 2 : 1 externally.
54. A line makes angles 60 and 45 with x and y-axis respectively. Find the angle which it makes with z-axis.

55. Find the angle between the line

and

56. The equation of a line 3x + 1 = 6y 2 = 1 z. Find the d.rs and d.cs of the line

57. Find the equation of line which passes through the point (1, -1, 2) and parallel to to
58. Find angle betweenlines r= 4i 3j + k+ (3i + 2j + 6k)andr = 8i 2k + (i + 2j + 2k)
59. If

60. If
Vectors-3D-Lines (4-Marks )
Page 4 of 6
1. If

2. Show that the points A, B, C with position vectors


respectively are collinear
3. If the sum of two unit vectors is a unit vector, Prove that the magnitude of their difference is

4. Show that the points A, B and C with position vectors,


respectively, form the vertices of a right angled
triangle.

5. If a unit vector

makes angles

components of

and

then find and hence the

6. Let

, and be three vectors such that

and each one of them being perpendicular to the sum of other two, Find
7. Find the area of the parallelogram whose adjacent sides are determined by the vectors

8. The scalar product of the vector

with a unit vector along the sum of vectors

Find the value of .


9. If

is any vector in space show tha

10. If vectors
(a.b+b.c+c.a)

, and are such | a + b + c | =0, and | a | = 6, | b | = 8 and | c | = 10. Find

11. Find the vector of magnitude 5 units which is perpendicular to both the vectors

12. Find the values of

13. Show that area of parallelogram having diagonals (3i + j 2k) and (i 3j + 4k) is 5 3 sq unit.
14. Find the shortest distance between the lines, whose equations are

15. Find shortest distance between the lines r = i + j + (2i j + k), r = 2i + j k + (3i 5j + 2k)

16. If

are unit vectors such that

then find the value of

.
17. By computing the shortest distance, determine whether the following pair of lines intersect or not:

18. d1 and d2 are the diagonals of a parallelogram with sides a and b.Express a and b in terms of d1 and
d2 and find the area of the parallelogram ;d1 = i + 2 j + 3 k ;d2 = 3 i - 2 j + k

19. Find the shortest distance between the following pairs of line r = (1 t ) i + ( t 2 ) j + ( 3 + 2t ) k
and r = ( s + 1) i + ( 2s 1) j + ( 2s + 1 ) k.

20. Find the equations of the line through the intersection of the lines

and
and parallel to the line

Vectors-3D-Lines (4-Marks)
Page 5 of 6
21. If A,B,C,D are four points in space prove that AB x CD + BC x AD + CA x BD = 4 (Area
ABC)
22. If and , and find angle between

find the angle between

23. For vectors and prove that :


24. If with reference to a right handed system of mutually perpendicular unit vectors
and

Express

in the form

where

, we have

,is parallel to

is perpendicular to

25. Find the point on line

at a distance 32 from the point ( 1, 2, 3)

26. Dot product of vector with vectors


vector.

are respectively -1,6 & 5 find the

27. Find image of the point (1,0,2) in the line passing through (2,1,3) and perpendicular to the lines

28. Find the value of k so that the lines

and
are at right angle.

29. . If

are any two non zero vectors.then prove that

30. If
31. If

Find a vector

which is perpendicular to

32. Find the unit vector perpendicular to the plane ABC, where the position vectors of A, B & C are 2i
j + k, 3 i + j + 2 k & - 2 j + 3 k respectively.
33. Dot product of a vector with the vector i + j - 3 k , i + 3 k - 2 k and 2 i + j + 4 k are 0, 5 and 8
respectively.find vector.
34. find the shortest distance between the lines
( 2 s - 1 ) j -( 2 s + 1) k

=(1 - t ) i + (t - 2) j + ( 3 - 2 t ) k and r = ( s + 1 ) i +

35. find the equation of the line passing through the point(1,2,3) and parpendicular to lines
and
36. The scalar product of the vector i + j + k with a unit vector along the sum of vectors 2i + 2j 5k
and i + 2j + 3k is equal to one. Find the value of .
37. If a x b = c xd =, a x c = b xd, show that (a d) is parallel to (b c).

38. Find the foot of perpendicular from P(1, 2, 3) on the line


equation of the plane containing the line and the point (1, 2, 3).

Also find the

39. Determine whether or not the following pair of lines intersect. If these intersect, then find the point
of intersection, otherwise obtain the shortest distance between them: r = i + j k + (3 i j ) and r
=4ik+(2i+3k)

40. Find the foot of perpendicular from the point (0, 2, 7) on the line

41. Find the equations of line passing through (3, 4, 7) and perpendicular to the lines

42. Show that the lines intersect each other: r = -i 3j 5k + (3i + 5j + 7k) and r = 2i + 4j + 6k + (i + 3j +
5k)
43. Find the shortest distance between the lines given by and

44. Find the shortest distance between the lines

45. Find the shortest distance between the lines

46. Find the foot of perpendicular from (1, 2, 3) to the line


erpendicular.

Also find the length of

47. Find the foot of perpendicular from (1,2,3) to the line


plane containing the line and the point (1,2,3)

Also obtain the equation of

48. Show that the lines


the plane containing the lines. PROVE SD=0

49. Let the vectors

be such that

are coplanar Also find the equation of

, then find the angle between

such that

is a unit vector
50. If

, find the angle between

51. Find the coordinate of the foot of perpendicular drawn from the point(1,2,1) to the line joining the points
(1,4,6) and (5,4,4).
52. Find image of the point (0, 2, 3) in the line r= j+2k + ( i+2j+3k).
53. If

are two vectors such that

, then prove that

54. Find the equation of line which passes through the point (1, -1, 2) and parallel to
.Also find the distance between the two parallel lines
55. Find the shortest distance between the lines given by

Note That They Are Parallel Lnes


56. Find the angle between the diagonals of a cube.
57. Find the area of a triangle whose vertices are (-1,2,3),(3,4,-5) and (2,0,5)
58. Show that axb+bxc+cxa is perpendicular to the plane of ABC
This is the easiest topic for students .All you need is practice .It contributes to about 12 marks to the whole
syllabus .
Following formulae may be used:-

Properties of determinants :1. The value of a determinant remains unchanged if its rows and columns are interchanged.
2. The sign of value of a determinant is changed if its any two rows or columns are interchanged.
3. The value of a determinant is zero if its any two rows or columns are identical.
4. If a determinant is multiplied by a scalar (number) , its only one row or column gets multiplied by
that constant.
5. If any two row or column of a determinant are proportional, its value becomes zero.
6. If all elements of a row or column are expressed as sum of two or more elements ,the whole of the
determinant can be expressed in sum of two or more determinants.
7. If some multiple of one row or column is added or subtracted to another row or
column(elementwise) , 1 its value remains unchanged.
Tips to solve properties based problems:1. If a determinant is of nth order ,we can apply only n-1 propertis at a time to it.
2. The format of application of properties is :- Row affected Row affected n (Row used) Ex.

3. The format for interchanging Rows or columns :4. You can never multiply a number to Row affected, it is always multiplied to Row used.
5. First always try to make elements of any one row or column identical so that you could take out
common from that row or column. It makes all the elements of that Row or column unity(1) and
then you make at the most two elements of that row or columns zero (0).Now expand that the
determinant by that row or column.
Ex-

We shall apply

and

Taking out common b from C1 and C2

Expand by R1

6. Check the part which is required to prove ,try to take out common the factors which are given in the
part.
Ex.

Here the first factor is (a-b) ,we can obtain it by R1 - R2 .Another factor is b-c which we can obtain
by R2 - R3
Important questions are:-

1. Find x,y,z if

2. If

= Show that

and hence find A-1.

3. Using properties of determinants solve for x

4. Using properties prove that :

Page 2 of 3
5. Usining properties of determinants,prove that:

6. If

7. Using properties ,prove that:

8. If A =

, Using principle of mathematically induction prove that

9. Using properties of determinants,prove that

10. If
AB=0.

A= , B = , c = Find a matrix D such that CD-

11. Let

,Verify that

,find k so that A-1 = KA - 2I.

12. If

13. Find X and Y if

14. If

15. Find B if

16. Find

17. Express

, find a and b such that A2 + aI = bA such that where I is unit matrix of order 2.

as a sum of a symmetric and a skew symmetric matrix.

18. Prove using properties of determinants

19. Solve the equations by matrix method

20. If

find and use it solve the system of equations:

21. Using determinants ,solve the following system of equations:

22. Find the value of


the solution.

for which given homogeneous system of equations have non trival solution. Also find

23. If

24. If
following system of equations:

Using A-1 solve the system of linear equations:

find the product AB and use this result to solve the

25. Solve using matrices:


26. For what value of a and b, the following system of equations is consistent?

Bt - BayesTheorem;
Pdt -Probability Distribution
Bd - Binomial Distribution
1. In a factory which manufactures bolts, machine A, B and C manufacture respectively 25%, 35% and 40%
of the bolts. Of their outputs 5, 4 and 2 percent are respectively defective bolts. A bolt is drawn at random
from the product and is found to be defective. What is the probability that it is manufactured by machine
B?--BT
2. A man is known to speak truth 3 out of 4 times. He throws a die and reports that it is a six. Find the
probability that it us actually six.BT
3. An insurance company insured 2000 scooter drivers, 4000 car drivers and 6000 truck drivers. The
probability of an accident is 0.01, 0.03 and 0.15 respectively. One of the insured persons meets with an
accident. What is the probability that he is a scooter driver?BT
4. A card from the pack of 52 cards is lost. From the remaining cards of the pack, two cards are drawn and are
found to be both diamonds. Find the probability of lost card being
i) diamond
ii) spadeBT
5. A company has two plants to manufacture scooters. Plant I manufacture 70% of the scooters and plant II
manufacture 30%. At plant I, 80% of the scooters are rated as of standard quality and at plant II, 90% of
the scooters are rated as of standard quality. A scooter is chosen at random and is found to be of standard
quality. What is the probability that it has come from plant II. BT
6. There are 3 bags each containing 5 white balls and 3 black balls. Also there are 2 bags each containing 2
white balls and 4 black balls. A white ball is drawn at random. Find the probability that this white ball is
from the bag of first group. BT
7. In a competitive examination, an examinee either guesses or copies or knows the answer to a multiple
choice question with four choices. The probability that he makes a guess 1/3 is and probability that he
copies the answer is 1/6 . The probability that the answer is correct is, given that he copied it is 1/8 . Find
the probability that he knows the answer to the squestion, given that he correctly answered the question.
BT
8. Find the probability distribution of number of doublets in three throws of a pair of dice.
9. Let X denotes the number of hours you study during a randomly selected school day. The probability that
X can take a value x has the following form, where k is some unknown constant :
a. Find the value of k.
b. What is the probability that you study at least two hours? Exactly two hours? At most two hours? PDT

10. The random variable X has probability distribution P(X) of the following form, where k is some number:

1. Find the value of K.


2. PDT
11. Two cards are drawn simultaneously (or successively without replacement) from a well shuffled pack of 52
cards. Find the mean, variance and standard deviation of the number of kings. PDT
12. Two dice are thrown simultaneously. If X denotes the number of sixes, find the expectation of X PDT OR
BD
13. Let X denotes the sum of numbers obtained when two fair dice are rolled. Find the variance and standard
deviation of X. PDT OR BD
14. In a meeting, 70% of the members favour 30% members oppose a certain proposal. A member is selected
at random and we take X = 0 if he opposed, and X = 1 if he is in favour. Find E(X) and Var(X). PDT
15. 15. Find the probability distribution of number of heads when three coins are tossed. Also find the mean
number of heads in the above case. PDT OR BD
16. A pair of dice is thrown 4 times. If getting a doublet is considered a success. Find the probability of two
successes. PDT OR BD
17. There are 5% defective items in a large bulk of items. What is probability that a sample of 10 items will not
include more than one defective item. BD
18. A fair coin is tossed 10 times. Find the probability of
a. Exactly six heads.
b. At least six heads
c. At most six heads. BD

19. Find the mean of binomial distribution

(n=4 p=1/3 MEAN=np,VAR=npq)

20. Five dice are thrown simultaneously. If the occurrence of an even number in a single dice is considered a
success. Find the probability of getting at most 3 successes. BD

21. An unbiased dice is thrown three times. Getting 3 or 5 is considered as success. Find the probability of at
least two successes. BD
22. An urn contains seven white, 5 black and 3 red balls. Two balls are drawn at random.
Find the probability that :
i. Both the balls are red.
ii. One ball is red and other is black.
iii. One ball is white.
23. 3 cards are drawn at random from a pack of well shuffled 52 cards. Find the probability that :
i. All the three cards are of same suit.
ii. One is a king; the other is a queen and third is a jack.

24. There are two bags I and II. Bag I contains 3 white and 2 red balls, bag II contains2 white and 4 red balls.
A ball is transferred from bag I to bag II (without seeing its colour) and then ball is drawn from bag II.
Find the probability of getting a red ball.
25. Bag I contains 3 red and 4 black balls and bag II contains 4 red and 5 black balls. One ball is transferred
from bag I to bag II and then a ball is drawn from bag II. The ball so drawn is found to be red in colour.
Find the probability that the transferred ball is black. BT
26. A problem in mathematics is given to three students whose chances of solving it are 1/2, 1/3, 1/4 . What is
the probability in the following cases
i) the problem is solved
ii) Only one of them solves it correctly.
27. Five dice are thrown simultaneously . If the occurrence of an even number is considered as a success ,
find the probability of at most 3 successes BD
28. A laboratory blood test is 99% effective in detecting a certain disease when it is in fact present . However
the test also yields a false positive result for 0.5% of the healthy person tested (i.e. if a healthy person is
tested then with probability 0.005, the test will imply that he has the disease. If 0.1 percent of the
population actually has the disease , What is the probability that a person has the disease given that the test
result is positive ? BT
29. A pair of dice is thrown 4 times. If getting a doublet is considered a success, find the probability
distribution of number of succeses. PDT
30. If E and F are independent events prove that E and F are independent.
31. If a machine is correctly set up, it produces 90% acceptable items. If it is incorrectly set up, it produces
only 40% acceptable items. Past experience shows that 80% of the set ups are correctly done. If after a
certain set up, the machine produces 2 acceptable items, find the probability that the machine is correctly
set up. BT-NOTE THE 2.SEE TEXT BOOK EXAMPLE SUM
32. Let x denote a number of collages where you will apply after your results and P( X = x ) denote your
probability of getting admission in x number of collage it is given that
(i) Find the value of K
(ii) What is the probability that you will get admission in exactly two collages
(iii) Find the mean & variance of probability distributions.

k is positive constant
33. If A and B are independent events then prove that A and B are also independent events
34. From a lot of 30 bulbs which include 6 defectives, a sample of 4 bulbs is drawn at random with
replacement. Find the probability distribution of the number of defective bulbs.
35. In a test, and examinee either guesses or copies or knows the answer to a multiple choice question with 4
choices, the probability that he makes a guess is 1/3 and the probability that he copies the answer is 1/6. the
probability that his answer is correct, given that he copied it is 1/8. Find the probability that he knew the
answer to the question. BT
36. Two cards are drawn successively with replacement from a well-shuffled pack of 52 cards .find the
probability distribution of the number of aces .find its mean and standard deviation.

37. In shuffling a pack of 52 playing cards, four are accidentally dropped .find chance that missing cards
should be one from each suit.
38. If P(A) = 0.2, P(B) = 0.3 and P (A U B ) = 0.4, where a & b are two events associated with a random
experiment. Find P (A B) and P(A / B)
39. A bag contains 3 white, 4 red and 5 black balls. Two balls are drawn one after the other without
replacement. Find the probability that of the two drawn balls, one is white and the other is black.
40. Two dice are throw together. What is the probability that the sum of the number on the two faces is
divisible by 3 or 4?

41. A and B appear for an interview for two posts. The Probability of As selection is 1/3 and that of Bs
selection is 2/5 . Find the probability that only one of themwillselected.
42. Three bags contains 5W, 8R; 7W,6R;6W,5R balls respectively. One ball is drawn from each bag at random.
Find the probability that the three balls drawn are same colour.
43. A & B through a die alternately till one of them gets a 6 and wins the games. Find their respective
probabilities of winning if A starts first.
44. A bag contains 5white, 7red & 8 black balls. If 4 balls are drawn one by one with replacement. Find the
probability distribution of the number of red ball drawn.
45. A bag contains 4 white and 2 black balls, and another bag contains 3white and 5 black balls. If one ball is
drawn from each bag, find the probability that one is white and one is black.
46. A problem is given to three students whose chances of solving it are 1/2, 1/3, what is the probability that
the problem will be solved.
47. There are two bags A and B. Bag A contains 3 white and 2 red balls. Bag B contains 2 white and 4 red
balls. A ball is transferred from Bag A to Bag B without seeing its colour and then a ball is drawn from Bag
B. Find the probability of getting a redball.
48. Three bad articles are mixed with 7 good ones. Find the probability distribution of the number of bad
articles, if three articles are drawn at random.
49. A bag contains 3 red, 4 black and 2 green balls. Two balls are drawn at random from the bag. Find the
probability that both balls are at different colours.
50. A pair of dice is rolled. Find the probability of getting a doublet or sum of numbers to be at least 20..
51. Two cards are drawn successively (without replacement) from a well shuffled pack of playing cards. Find
the probability distribution of number of spades.
52. A bag contains 3 red, 4 black and 2 green balls. Two balls are drawn at random fromthe bag. Find the
probability that both balls are of different colours.
53. A bag contains 3 red, 4 black and 2 green balls. Two balls are drawn at random from the bag. Find the
probability that both balls are of different colours.
54. A pair of dice is rolled. Find the probability of getting a doublet or sum of number to be at least 10.
55. Two cards are drawn from a well shuffled pack of 52 cards without replacement. Find the probability that
one of the two cards is an ace & the other a queen.

56. A problem of mathematics is given to 3 students whose chances of solving it are 1/2,1/3, 1/4. What is the
probability that problem is solved?
57. A bag contains 5 white and 3 black balls. Another bag contains 4 white and 5 black balls. A bag is selected
at random and two balls are drawn from it. Find The probability that both balls are of different colours.
58. Two cards are drawn from a well shuffled pack of 52 cards without replacement. Find the probability that
one of the two cards in an ace and the other a queen of opposite shade
59. There are two bags I and II. Bag I contains 3 white and 2 red balls, bag II contains 2 white and 4 red balls.
A ball is transferred from bag I to bag II (without seeing its colour) and then a ball is drawn from bag II.
Find the probability of getting a red ball.
60. Two cards are drawn successively (with replacement) from a well shuffled pack of playing cards. Find the
Probability distribution of number of speeds.

61. Two dice are thrown together, what is the probability that sum of the number on the two faces is neither 9
nor 11?
62. A bag contains 4 yellow and 5 red balls and another bag contains 6 yellow and 4 red balls. A ball is taken
out from the first bag and, without seeing its colour, is put in the second bag. Find the probability that if
now a ball is drawn from the second bag, it is yellow in colour
63. A bag contains 5 white, 7red and 4black balls. If four balls are drawn one by one with replacement, what is
the probability that none is white? BD PUT R=0
64. A pair of dice is thrown 6 times. If getting a total of 7 is considered a success. Find the probability of
getting at most 5 success. BD---R< =5
65. The mean and variance of a bionomial distribution 4/3 and 8/9 respectively. Find the probability
distribution.
66. If the sum of the mean and variance of a binomial distribution for 6 trial be 10/3 , Find the distribution.
67. Three urns A, B, and C contain 6 red & 4 white 2red and 6 white balls. respectively An urn is drawn at
random and a ball is drawn. If the ball drawn is found to be red. Find the probability that the ball was
drawn from urn A. BT
68. A bag contains five white and three black balls. Four balls are successively drawn without replacement.
What is the probability that they are alternatively of different colors
69. Two cards are drawn successively without replacement from a well shuffled pack of playing cards. Find
the probability distribution of number of spades.
70. A bag contains 3 red, 4 black and 2 green balls. Two balls are drawn at random from thebag. Find the
Probability that both the balls are of different colours.
71. Find the Probability that in a random arrangement of the letters of word MATHEMATICS the vowels
occur together
72. A die is thrown ten times. If getting a prime number is considered a success. Find The probability of
getting not more then 8 successive. BD
73. A man is known to speak truth 4 out of a 5times. He throws a pair of dice and reports that it is a doublet.
Find the probability that it is actually a doublet. BT

74. A and B are two events such that P(A)=0.42, P(B)=0.48 and P(A and B) = 0.16. Determine P(AorB).
75. A bag contain 7 green , 4 white and 5 red balls. If four balls are drawn one by one with replacement . What
is the probability that none is red. BT-----R=0
76. A purse contains 2 silver and 4 copper coins. A second purse contains 4 silver and 3 copper coins.A coin is
pulled out at random from one of the two purses. What is the probability that it is a silvercoin.
77. Find the probability distributation of the random variable which equals the number of heads obtained when
3 coins are tossed
78. A football match may be either won , drawn or lost by the host countrys team ,show there are three ways
of for casting the result at any one match one correct and two incorrect. Find the probabilities of for at least
there correct result for four matches
79. A man is known to speak truth 3 out of 4 times he thrown a die and report that it is a six find probability
that it is actually a six . BT
80. In a game a man wins a rupee for a six and loses for any other number when a fair die is thrown. The man
decided to throw a die thrice but to quit as and when he gets six. Find the expected value of the amount he
wins/ loses. PDT

81. A pair of dice is thrown twice. If the random variable X is defined as the number of doublets, find the
probability distribution of X. Also find the mean and variance for above distribution.
82. Suppose that the reliability of HIV test is specified as follows: Of the people having HIV, 90% of the test
detect the disease but 10% go undetected. Of people free of HIV, 90% of the test are judged HIV ive but
1% are diagnosed as showing HIV +ive. From a large population of which only 0.1% have HIV, one
person is selected at random, given the HIV test, and the pathologist reports him/her as HIV +ive. What is
the probability that the person actually has HIV? BT
83. A letter is known to have come either from LONDON or CLIFTON. On the envelope just two consecutive
letters ON are visible. What is the probability that the letter has come from (i) LONDON (ii) CLIFTON.
BT
84. A and B throw a pair of die turn by turn. The first to throw 10 is awarded a prize. If B starts the game.
What is the probability that A is getting prize.
85. A manufacturer has three machine operators A,B and C. The first operator A produces 1% defective items,
where as the other two operators B and C produce 5% and 7% defective items respect$ively. A is on the job
for 50% of the item, B is on the job for 30% of the time and C is on the job for the remaining time .If a
defective item is produced, what is the probability that it was produced by A? BT
86. In an examination, 20 questions of true-false type are asked. Suppose a student tosses a fair coin to
determine his answer to each question. If the coin falls heads, he answers true, if it falls tails, he answers
false. Find the probability that he answers at least 12 questions correctly.
87. A die is thrown again and again until three sixes are obtained. Find the probability of obtaining the third six
in the sixth throw of the die.
88. The probability that a certain person will buy a shirt is 0.2, the probability that he will buy a the probability
that he will buy both a shirt and a trouser. Find also the probability that he will trouser is 0.3 and the
probability that he will buy a shirt given that he buys a trouser is 0.4. Find the probability that he buys a
trouser given that he buys a shirt.

89. Three persons A, B, throw a die in succession till one gets a six and wins the game. Find their respective
probabilities of winning, if A begins.
90. In a test, an examinee either guesses or copies or knows the answer to a multiple choice question with four
choices. The probability that he makes a guess is 1/3 and the probability that he copies the answer is 1/6.
The probability that his answer is correct given that he copied it is 1/8. Find the probability that he knows
the answer to the question, given that he correctly answered it. BT
91. Two balls are drawn at random with replacement from a box containing 10 black and 8 red balls. Find the
probability that
(i) both balls are red
(ii) one of them is black and the other is red.
92. In a hurdle race, a race player has to cross hurdles. The probability that he will be each hurdle is 4/5. What
is the probability that he will knock down fewer than 2 hurdles? BD
93. A bag X contains 2 white and 3 red balls and a bag Y contains 4 white and 5 red balls.Oneball is drawn at
random from one of the bag and is found to be red. Find the probability that it was drawn from bag Y. BT
94. A man is known to speak truth 3 out of 4 times. He throws a die and reports that it is a six.Find the
probability that it is actually a six. BT
95. In a binomial distribution, the sum of mean and variance of 5 trials is 3.75.Find the distribution.
96. Suppose that 80% of people are right handed. What is the probability that at most 6 of a random sample of
10 people are right handed? BD
97. Two cards are drawn successively with replacement from a well-shuffled of 52 cards. Find the P.D, mean
and variance for the number of kings. BD
98. Two cards are drawn without replacement from a well-shuffled of 52 cards. Find the P.D, mean and
variance for the number of aces. BD
99. An urn contains 5 red and 3 black balls. Find the P.D of the number of blue balls in a draw of 2 balls with
replacement.
100.
An insurance company insured 2000 scooters, 3000 car and 4000 track drivers. The probabilities of
their meeting with an accident are 0.04, 0.06 and 0.15 respectively. If one of person meets with an accident
then find the probability that he is a car driver.
101.
A bag contains 6 red and 7 blue balls and another bag contains 5 red and 4 blue balls. A ball is
drawn from the first bag and without noticing its color is put in the second bag. A ball is then drawn from
the second bag. Find the probability that the ball is drawn is blue in color.
102.
A speaks truth in 60% of the cases and B in 70% of the cases. In what percentages of cases they are
likely to (i) contradict each other (ii)agree with each other, in stating same fact?
103.
A problem in mathematics is given to three students whos chancing of solving it are 1/2, 1/3 and
1/4 respectively. What is the probability that the problem will be solved?
104.
A husband and wife appear in an interview for two vacancies in the same post. The probability of
husbands selection is 1/5 and that of wifes selection is 1/3. What is the probability that
(i) both are selected
(ii) only one is selected
(iii) none is selected
(iv) at least one selected?

105.
In a group, there are 3 women and 4 men. Three persons are selected at random from this group.
Find the probability that 2 women and 1 man or 1 woman and 2 men are selected.
106.
Two cards are drawn at random, without replacement from a pack of 52 cards, find the probability
that both the cards will be red.
107.
The probability that a student selected at random will pass in mathematics 2/3 and the probability
that he/she passes in mathematics and c.s is 1/5. What is the probability that he/she will pass in c.s if it is
known that he/she has passed in mathematics?
108.

Given P(A) = 1/2, P(B) = 1/3 and P(A U B) = 2/3. Are the events A and B independent?

109.
A pair of dice is thrown twice. If the random variable X is defined as the number of doublets, find
the probability distribution of X. Also find the mean and variance for above distribution.
110.
Suppose that the reliability of HIV test is specified as follows: Of the people having HIV, 90% of
the test detect the disease but 10% go undetected. Of people free of HIV, 90% of the test are judged HIV
ive but 1% are diagnosed as showing HIV +ive. From a large population of which only 0.1% have HIV,
one person is selected at random, given the HIV test, and the pathologist reports him/her as HIV +ive.
What is the probability that the person actually has HIV? BT
111.
A letter is known to have come either from LONDON or CLIFTON. On the envelope just two
consecutive letters ON are visible. What is the probability that the letter has come from (i) LONDON (ii)
CLIFTON. BT
112.
A and B throw a pair of die turn by turn. The first to throw 10 is awarded a prize. If B starts the
game. What is the probability that A is getting prize.
113.
A manufacturer has three machine operators A,B and C. The first operator A produces 1% defective
items, where as the other two operators B and C produce 5% and 7% defective items respect$ively. A is on
the job for 50% of the item, B is on the job for 30% of the time and C is on the job for the remaining
time .If a defective item is produced, what is the probability that it was produced by A? BT
114.
In an examination, 20 questions of true-false type are asked. Suppose a student tosses a fair coin to
determine his answer to each question. If the coin falls heads, he answers true, if it falls tails, he answers
false. Find the probability that he answers at least 12 questions correctly.
115.
A die is thrown again and again until three sixes are obtained. Find the probability of obtaining the
third six in the sixth throw of the die.
116.
The probability that a certain person will buy a shirt is 0.2, the probability that he will buy a the
probability that he will buy both a shirt and a trouser. Find also the probability that he will trouser is 0.3
and the probability that he will buy a shirt given that he buys a trouser is 0.4. Find the probability that he
buys a trouser given that he buys a shirt.
117.
Three persons A, B, throw a die in succession till one gets a six and wins the game. Find their
respective probabilities of winning, if A begins.
118.
In a test, an examinee either guesses or copies or knows the answer to a multiple choice question
with four choices. The probability that he makes a guess is 1/3 and the probability that he copies the
answer is 1/6. The probability that his answer is correct given that he copied it is 1/8. Find the probability
that he knows the answer to the question, given that he correctly answered it. BT
119.
Two balls are drawn at random with replacement from a box containing 10 black and 8 red balls.
Find the probability that
(i) both balls are red
(ii) one of them is black and the other is red.

120.
In a hurdle race, a race player has to cross hurdles. The probability that he will be each hurdle is
4/5. What is the probability that he will knock down fewer than 2 hurdles? BD
121.
A bag X contains 2 white and 3 red balls and a bag Y contains 4 white and 5 red balls.Oneball is
drawn at random from one of the bag and is found to be red. Find the probability that it was drawn from
bag Y. BT
122.
A man is known to speak truth 3 out of 4 times. He throws a die and reports that it is a six.Find the
probability that it is actually a six. BT
123.

In a binomial distribution, the sum of mean and variance of 5 trials is 3.75.Find the distribution.

124.
Suppose that 80% of people are right handed. What is the probability that at most 6 of a random
sample of 10 people are right handed? BD
125.
Two cards are drawn successively with replacement from a well-shuffled of 52 cards. Find the P.D,
mean and variance for the number of kings. BD
126.
Two cards are drawn without replacement from a well-shuffled of 52 cards. Find the P.D, mean and
variance for the number of aces. BD
127.
An urn contains 5 red and 3 black balls. Find the P.D of the number of blue balls in a draw of 2
balls with replacement.
128.
An insurance company insured 2000 scooters, 3000 car and 4000 track drivers. The probabilities of
their meeting with an accident are 0.04, 0.06 and 0.15 respectively. If one of person meets with an accident
then find the probability that he is a car driver.
129.
A bag contains 6 red and 7 blue balls and another bag contains 5 red and 4 blue balls. A ball is
drawn from the first bag and without noticing its color is put in the second bag. A ball is then drawn from
the second bag. Find the probability that the ball is drawn is blue in color.
130.
A speaks truth in 60% of the cases and B in 70% of the cases. In what percentages of cases they are
likely to (i) contradict each other (ii)agree with each other, in stating same fact?
131.
A problem in mathematics is given to three students whos chancing of solving it are 1/2, 1/3 and
1/4 respectively. What is the probability that the problem will be solved?
132.
A husband and wife appear in an interview for two vacancies in the same post. The probability of
husbands selection is 1/5 and that of wifes selection is 1/3. What is the probability that
(i) both are selected
(ii) only one is selected
(iii) none is selected
(iv) at least one selected?
133.
In a group, there are 3 women and 4 men. Three persons are selected at random from this group.
Find the probability that 2 women and 1 man or 1 woman and 2 men are selected.
134.
Two cards are drawn at random, without replacement from a pack of 52 cards, find the probability
that both the cards will be red.
135.
The probability that a student selected at random will pass in mathematics 2/3 and the probability
that he/she passes in mathematics and c.s is 1/5. What is the probability that he/she will pass in c.s if it is
known that he/she has passed in mathematics?
136.

Given P(A) = 1/2, P(B) = 1/3 and P(A U B) = 2/3. Are the events A and B independent?

137.
A pair of dice is thrown twice. If the random variable X is defined as the number of doublets, find
the probability distribution of X. Also find the mean and variance for above distribution.
138.
Suppose that the reliability of HIV test is specified as follows: Of the people having HIV, 90% of
the test detect the disease but 10% go undetected. Of people free of HIV, 90% of the test are judged HIV
ive but 1% are diagnosed as showing HIV +ive. From a large population of which only 0.1% have HIV,
one person is selected at random, given the HIV test, and the pathologist reports him/her as HIV +ive.
What is the probability that the person actually has HIV? BT
139.
A letter is known to have come either from LONDON or CLIFTON. On the envelope just two
consecutive letters ON are visible. What is the probability that the letter has come from (i) LONDON (ii)
CLIFTON. BT
140.
A and B throw a pair of die turn by turn. The first to throw 10 is awarded a prize. If B starts the
game. What is the probability that A is getting prize.
141.
A manufacturer has three machine operators A,B and C. The first operator A produces 1% defective
items, where as the other two operators B and C produce 5% and 7% defective items respect$ively. A is on
the job for 50% of the item, B is on the job for 30% of the time and C is on the job for the remaining
time .If a defective item is produced, what is the probability that it was produced by A? BT
142.
In an examination, 20 questions of true-false type are asked. Suppose a student tosses a fair coin to
determine his answer to each question. If the coin falls heads, he answers true, if it falls tails, he answers
false. Find the probability that he answers at least 12 questions correctly.
143.
A die is thrown again and again until three sixes are obtained. Find the probability of obtaining the
third six in the sixth throw of the die.
144.
The probability that a certain person will buy a shirt is 0.2, the probability that he will buy a the
probability that he will buy both a shirt and a trouser. Find also the probability that he will trouser is 0.3
and the probability that he will buy a shirt given that he buys a trouser is 0.4. Find the probability that he
buys a trouser given that he buys a shirt.
145.
Three persons A, B, throw a die in succession till one gets a six and wins the game. Find their
respective probabilities of winning, if A begins.
146.
In a test, an examinee either guesses or copies or knows the answer to a multiple choice question
with four choices. The probability that he makes a guess is 1/3 and the probability that he copies the
answer is 1/6. The probability that his answer is correct given that he copied it is 1/8. Find the probability
that he knows the answer to the question, given that he correctly answered it. BT
147.
Two balls are drawn at random with replacement from a box containing 10 black and 8 red balls.
Find the probability that
(i) both balls are red
(ii) one of them is black and the other is red.
148.
In a hurdle race, a race player has to cross hurdles. The probability that he will be each hurdle is
4/5. What is the probability that he will knock down fewer than 2 hurdles? BD
149.
A bag X contains 2 white and 3 red balls and a bag Y contains 4 white and 5 red balls.Oneball is
drawn at random from one of the bag and is found to be red. Find the probability that it was drawn from
bag Y. BT
150.
A man is known to speak truth 3 out of 4 times. He throws a die and reports that it is a six.Find the
probability that it is actually a six. BT
151.

In a binomial distribution, the sum of mean and variance of 5 trials is 3.75.Find the distribution.

152.
Suppose that 80% of people are right handed. What is the probability that at most 6 of a random
sample of 10 people are right handed? BD
153.
Two cards are drawn successively with replacement from a well-shuffled of 52 cards. Find the P.D,
mean and variance for the number of kings. BD
154.
Two cards are drawn without replacement from a well-shuffled of 52 cards. Find the P.D, mean and
variance for the number of aces. BD
155.
An urn contains 5 red and 3 black balls. Find the P.D of the number of blue balls in a draw of 2
balls with replacement.
156.
An insurance company insured 2000 scooters, 3000 car and 4000 track drivers. The probabilities of
their meeting with an accident are 0.04, 0.06 and 0.15 respectively. If one of person meets with an accident
then find the probability that he is a car driver.
157.
A bag contains 6 red and 7 blue balls and another bag contains 5 red and 4 blue balls. A ball is
drawn from the first bag and without noticing its color is put in the second bag. A ball is then drawn from
the second bag. Find the probability that the ball is drawn is blue in color.
158.
A speaks truth in 60% of the cases and B in 70% of the cases. In what percentages of cases they are
likely to (i) contradict each other (ii)agree with each other, in stating same fact?
159.
A problem in mathematics is given to three students whos chancing of solving it are 1/2, 1/3 and
1/4 respectively. What is the probability that the problem will be solved?
160.
A husband and wife appear in an interview for two vacancies in the same post. The probability of
husbands selection is 1/5 and that of wifes selection is 1/3. What is the probability that
(i) both are selected
(ii) only one is selected
(iii) none is selected
(iv) at least one selected?
161.
In a group, there are 3 women and 4 men. Three persons are selected at random from this group.
Find the probability that 2 women and 1 man or 1 woman and 2 men are selected.
162.
Two cards are drawn at random, without replacement from a pack of 52 cards, find the probability
that both the cards will be red.
163.
The probability that a student selected at random will pass in mathematics 2/3 and the probability
that he/she passes in mathematics and c.s is 1/5. What is the probability that he/she will pass in c.s if it is
known that he/she has passed in mathematics?
164.

Given P(A) = 1/2, P(B) = 1/3 and P(A U B) = 2/3. Are the events A and B independent?

165.

Find x if

166.

How many matrices of order 3 x 3 are possible with each entry 0 or 1?

167.

For any 2 x 2 matrix, if

168.

If A is a square matrix of order 3 such that

, then find |A|

169.

If A = [1 2 3 4] and

Write the order of AB and BA

170.

For what value of x, the following matrix is singular?

171.

A matrix A of order 3 X 3 has determinant 7, what is the value of |3A|?

172.

If A is a square matrix such that A = A, then find (I + A) - 3A.

173.

If

find x, 0 < x < when A + A = I .

174.
If A and B are matrices of the equal order and B is skew symmetric, then show that ABA is skew
symmetric.

175.

Using elementary operations, find the inverse of

176.

Show that the matrix

177.

Express the matrix

178.

A matrix of order 3 X 3 has a determinant 15. What is the value of |5A|?

179.

If A is square matrix of order 3 such that |Adj A| = 289, find |A|.

180.

Give an example of two non-zero matrices A and B of the same order 2x2 such that AB=0.

181.

Find the value of k, if the matrix

is Skew-symmetric.

as the sum of symmetric and a skew- symmetric matrix.

is singular.

182.
Show that the matrix BAB is symmetric or skew symmetric according as A is symmetric or skew
symmetric.
183.

Construct a 2 x3 matrix whose elements are given by

184.

21. If A is 3x4 matrix and B is a matrix such that AB and BA are both defined, then find the order of matrix B
.

22. If a square matrix A be singular find the matrix A ( adj A ).


23. If A is an invertible matrix of order 2 and det (A) = 5, then find det ( A-1) .

24. Evaluate

25. If A and B are symmetric matrices of same order. Prove that AB-BA is skew symmetric matrix.

26. For what value of k, the matrix

is singular.

27. If A and B are symmetric matrices then show that AB-BA will be skew-symmetric.
28. If be singular matrix, then find then find the value of x ?

29. If

30. If

A and B are two matrices such that AB =A and BA = B then what is value of B2.

is additive inverse of

. Find x, y, z and t .

31. Construct 3x2 matrix If A = [aij] where aij = { i+j, if i > j ; i-j, if i< j }.

32. Construct a 2 x 2 matrix A= [ aij ] whose elements are given by

33. If

find the values of a and b.

34. Find value of x, If matrix

35.

is not invertible.

is a skew symmetric, find value of x.

36. Construct a 2x2 matrix A = [aij] whose element are given by

37. For any 2 x 2 matrix, if

, then find |A|.

38. If A is a square matrix such that A2 = A. Find the value of (I+A)3 7A.

39. Find the cofactor of (1, 2) th entry in the given matrix

40. If a matrix is both is symmetric and skew symmetric, then show that it is a null matrix.
41. If B is a skew symmetric, write whether the matrix (ABA ) is symmetric or skew symmetric.

42. Which type of matrix

43. If

is this?

find k so that A2 = 8A + kI.Hence find A-1.

44. If a, b, c are in AP, show that

45. Without using the concept of inverse of a matrix

, find the matrix such that

46. By using properties of determinants show that

47. Using elementary row transformation find the inverse of the matrix

48. Prove by using properties of determinant

49. If

, then prove that

, where n is any positive integer.

50. Using properties of determinants, Prove that

51. Using the properties of determinants, show that

52. Express the matrix

as the sum of symmetric and skew symmetric matrices.

53. Using the properties of determinants; show that

Show that (a+b+c) and (a2+b2+c2) are the factors.

54. For the determinant

55. Show that

satisfies the equation x + 4x 42 = 0.Hence find A-1.

56. Using the properties of determinants, show that

57. If

then prove that

58. Prove that

59. Prove by using properties of determinant

60. If a,b,c are in A.P then find the value of the determinant

61. If

and I is the identity matrix of order 2, show that


.

62. Show that

21. Using properties of determinants, prove the following

22. If a, b, c are positive and unequal, show that value of determinant

is negative.

23. Find the matrix X and Y when it is being given that

..

24. Using properties of determinants, Prove that

25. Using properties of determinants, Prove that

26. Using properties of determinants Prove that

Find x and y Such that A2= xA + yI. Hence find A-1. .

27. If A=

and I=

28. If
constant.

Then by mathematical induction show that

29. If

30. Prove that

Where a & b are

, then show that

31. Prove that :

32. Using properties of determinants prove that

33. Let

show that (aX + bY)3 = a3X + 3a2b Y.

34. Prove that value of the determent

is independent of .

35. Solve for

36.

37. By using the properties of the determinants prove that

38.

39.

40.

41.

42.

43.

44.

45.

46.

47. If a, b, c are reals, and

Show that either a + b+ c =0 or a = b = c.

1. Using matrices solve the following equations: x + y + z = 3 ; x 2y + 3z = 2 and 2x y + z = 2

2. If
y = 3, 2x +3y +4z = 17, y+2z =7

and B= ,Find AB hence solve the system of equation x-

3. Solve the following system of equations by matrix method : 5x-7y+z =11 , 6x-8y-z =15 and 3x+2y6z =7.

4. Given that
find BA. Use product solve the system of
equations x y + z = 4, x 2y 2z = 9, 2x + y + 3z = 1
5. Solve the following system of equations by matrices: 2/x + 3/y + 10/z = 4 ; 6/x + 9/y 20/z = 2 ;
4/x 5/y + 5/z = 1

6. Given that
2z = 9, 2x + y + 3z = 1

Hence solve the system of equations: x y + z = 4, x 2y

7. If
find A-1 and solve the following system of equations 2x 3y + 5z = 11, 3x +
2y 4z = -5, x + y - 2z = - 3.

8. If

, find A-1 and use it to solve the system of the equations

9. Using elementary row transformations, find the inverse of

10. Find A-1 , where


2x+3y+2z=2, 3x-3y-4z=11

. Hence, Solve the system of linear equations: x +2y-3z= - 4,

11. Solve the following system of equation by matrix method

12. If
Find A-1 and hence solve the system of linear equation: 3x+4y+7z=14, 2xy+3z=4, x+2y-3z=0.

13. If

14. If

prove that A2-4A-5I=0, Hence find A-1.

, find A-1 using elementary row operation.

15. Classify the following system of equations as consistent or inconsistent. If consistent solve it. x y
+ 3z = 6, x + 3y 3z = 4 and 5x + 3y + 3z = 10

Differentiability Applications (1 Mark)


Page 1 of 6
1. If a line y = x + 1 is a tangent to the curve y2= 4x ,find the point the of contact ?
2. Find the point on the curve y = 2x2 6x 4 at which the tangent is parallel to the x axis
3. Find the slope of tangent for y = tan x + sec x at x = /4
4. Show that the function f(x) == x3 6x2 +12x -99 is increasing for all x.
5. Find the maximum and minimum values, if any of
6. For the curve y = 3x + 4x, find the slope of the tangent to the curve at the point x = -2.

7. Find a point on the curve y = x2 4x -32 at which tangent is parallel to x-axis.


8. Find a, for which f(x) = a(x+sinx)+a is increasing .
9. The side of a square is increasing at 4 cm/minute. At what rate is the area increasing when the side
is 8 cm long?
10. Find the point on the curve y =x2-7x+12, where the tangent is parallel to x-axis.
Differentiability Applications (4 Mark)
Page 2 of 6
1. Find the intevals in which the function f(x) = 2log(x-2) - x2 + 4x + 1is increasing or decreasing.
2. Find the intervals in which the function f ( x ) = x3 - 6x2 + 9x + 15 is
(i) increasing
(ii) decreasing.
3. Find the equation of the tangent line to the curve x = + sin, y = 1+cos a=/4

4. Prove that

is increasing in [o, /2]

5. Prove that curves y = 4ax and xy = c cut at right angles If c4 = 32 a4


6. A water tank has the shape of an inverted right circular cone with its axis vertical and vertex lower
most. Its semi vertical angle is
. Water is poured into it at a constant rate of 5 cubic meter
per minute. Find the rate at which the level of the water is rising at the instant when the depth of
water in the tank is 10m. Find the point on the curve y =x-7x+12, where the tangent is parallel to
x-axis.
7. Discuss applicability Rolles Theorem for the function f(x) = cosx + sinx in [0,2 ] and hence find a
point at which tangent is parallel to X axis.
8. Verify Lagranges mean value theorem for the function f(x) = x + 1/x in [1,3].
9. Find the intervals in which f(x) = sinx + cosx , o x 2 , is increasing or decreasing.
10. Use differentials to find the approximate value of 25.2
11. Find the interval in which the function given by f(x)= (4sinx 2x x cosx) / (2+cos x) is
increasing.
12. Find the local maximum & local minimum value of function x3 12x2 + 36x 4
13. For the curve y = 4x3 - 2x5, find all the points at which the tangent passes throughthe origin.
14. Show that the curves 2x = y2 and 2xy = k cut at right angles if k2 = 8.
15. Find the interval in which the function f(x)= 2x3 -9x2 -24x-5 is Increasing or decreasing.
16. Find the interval in which the function is increasing or decreasing.
17. Prove that the curves x = y and xy = k cut at right angle if 8k2 = 1.

18. If f(x) = 3x + 15x + 5, then find the approximate value of f(3.02), using diffrentials.
19. Find the local maximum and minimum values of function: f(x) = sin 2x x,-/2 < x < /2
20. Find the interval in which f(x) =sin 3x is increasing or decreasing in [0, /2].

Differentiability Applications (4 Mark)


Page 3 of 6
21. A ladder 5m. long is leaning against a wall . The bottom of the ladder is pulled along the ground,
away from the wall at the rate of 2 m./sec. How fast is its height decreasing on the wall,when the
foot of the ladder is 4 m away from the wall.
22. Show that the function f given by f(x) = tan-1(sinx+cosx), is strictly decreasing function on (/4,/2)
23. Find the equation of the tangents to the curve y = 3x-2 which is parallel to the line 4x-2y+5=0.
24. Find the intervals in which the function f(x) = x3+1/ x3 increasing or decreasing.
25. Verify Rolles theorem for the function f(x)=x3+2x-8 ,
26. Find the equation of the tangent and normal to the parabola y2 = 4 a x at ( at2, 2at).
27. Using LMVT, find a point on the parabola y = ( x 3 )2 , where the tangent is parallel to the chord
(3,0) and (4,1).
28. Verify Rolles theorem for f (x) = x3- 2x2- x + 3 in [0,1] .
29. Find the intervals in which f(x) = x3+ 2x21 decreasing or increasing
30. It is given for the function of defines by f(x)=x3+ bx2ax,

Rolle theorem helds with

31. Find the intervals in which f(x) = - 2 x3+15x2- 36x + 1 is increasing or decreasing.
32. Show that the parabola y2 = 4 x + 4 & y2 = 4 - 4 x intersect at right angle.
33. Find the interval in which the function f is given by f(x)=sinx-cosx,o x 2
(i) Increasing
(ii) Decreasing.
34. It is given that for the function f given by f(x)=x3+ bx2ax

Rolles theorem hold

.Find the values of a and b


35. Find the equation of the tangent and normal to the curve: x = acost +at sint , y = asint - atcot at any
point t. Also show that the normal to the Curve is at a constants distance from the origin.
36. Using differentiate find approximate value of 51.

37. The surface area of a spherical bubble is increasing at the rate of 2m/sec. Find the rate of at which
the volume of the bubble is increasing at the instant its radius is 6cm.
38. Prove that x/a + y/b = 1 is a tangent to the curve y = be-x/a at the point where the curve cuts y-axis.
39. Find the equation of the tangent to the curve x + 3y 3 = 0, which is perpendicular to the line y =
4x 5.
40. Find the approximate change in the volume V of cube of side x mts caused by increasing the side 2
%.
41. Find the intervals in which the function f(x) = 2x - 15x + 36x + 1 is strictly increasing and decreasing.
Also find the points on which the tangents are || to the x-axis.
42. Find the equations of the tangent and normal to the curve 16x + 9y = 144 at (2, y1 > 0). Also find the
point of intersection where both tangent and normal meet the x-axis.
43. A particle moves along 3y = 2x + 3. Find the points on the curve at which the y-coordinate changes twice
as fast as x-coordinate.
44. Find the point on the parabola y = (x 3) where the tangent is parallel to chord joining the points (3, 0)
and (4, 1).
45. The volume of a sphere is increasing at 3cm3/ s. what will be the rate at which the radius increases when
radius is 2 cm
46. Verify Rolles theorem for the function f(x) = x2-5x+6 in the interval [2, 3].
47. Water is leaking from a conical funnel at the rate of 5cm3/Sec. If the radius of the base of funnel is 5 cm
and height 10cm find the rate at which is water level dropping when it is 2.5 cm from the top.
48. The length x of a rectangle is decreasing at the rate of 2cm/s and the width y is increasing at the rate of
2cm/s. when x=12 cm and y=5cm, find the rate of change of
(a) the perimeter and
(b) the area of the rectangle.
49. Using differential, find the appropriate value of 329
50. Sand is being poured at the rate of 0.3 m3/sec into a conical pile. If the height of the conical pile is thrice
the radius of the base, Find the rate of change of height when the pile is 5cm high.
51. Verify the condition of Mean Value Theorem and find a point c in the interval as statedby the MVT for the
function given by f(x) = logex on [1, 2].
52. The two equal sides of isosceles triangle with a fixed base b are increasing at the rate of 3 cm/sec. How
fast is the area decreasing when the two equal sides are equal to the base?
53. Verify Rolles Theorem for the function f(x) = Sin x Cos x in the interval [ /4,5/4]
54. The radius of a balloon is increasing at the rate of 10 cm/sec. At what rate is the volume of the balloon
increasing when the radius is 10cm?
55. Find the interval in which the function f(x) = x3 6x2 36x + 2
56. Find the intervals in which the following function is increasing : f(x)=x4 2x2.

57. Using Rolles theorem, find the points on the curve y = 16 x2, x [ -1,1] where the tangent is parallel to xaxis.
58. Show that the function f given by f(x)= tan-1(sinx+cosx), is strictly decreasing function on (/4,/2).
59. Find the equation of the tangent to the curve x2 + 3y = 3 which is parallel to the line y 4x + 5 = 0.
60. A man 160 cm tall; walks away from a source of light situated at the top of a pole 6 m high, at the rate of
1.1 m/s. How fast is the length of his shadow increasing when he is 1 m away from the pole?
61. A point source of light along a straight road is at a height of a metres. A boy b metres in height is
walking along the road. How fast is his shadow increasing if he is walking away from the light at the rate
of c m/min?
62. At what points of the ellipse 16x2 + 9y2 = 400 does the ordinate decrease at the same rate at which the
abscissa increases?
63. The bottom of a rectangular swimming pool is 25 m by 40 m. Water is pumped out into the tank at the rate
of 500 m3/min. Find the rate at which the level of the water in the tank rising.
64. An inverted cone has a depth of 40 cm and base of radius 5 cm. Water is poured into it at a rate of 1.5 cm3/
min. Find the rate at which the level of water in the cone is rising when the depth is 4 cm.
65. Water is dripping through a tiny whole at the vertex in the bottom of a conical funnel at a uniform rate of 4
cm3 / s. When the slant height of the water is 3 cm, find the rate of decrease of the slant height of the water,
given that the vertical angle of the funnel is 1200.
66. Oil is leaking at the rate of 16 mL / s from a vertically kept cylindrical drum containing oil. It the radius of
the drum is 7 cm and its height is 60 cm, find the rate at which the level of the oil is changing when the oil
level is 18 cm.

Differentiability Applications (6 Mark)


Page 5 of 6
1. Show that the height of the cone of maximum volume that can be inscribed in a sphere of radius
12cm is 16cm.
2. Find the equation of line through the point (3, 4) which cuts the 1st quadrant a triangle of minimum
area.
3. Show that the right circular cone of least curved surface and given volume has an altitude equal to
2 time the radius of the base.
4. Show that the semivertical angle of a cone of maximum volume and given slant height is tan-12.
5. A wire of length 28m is to be cut into two pieces. One of the pieces is to be made into a square and
the other into a circle. What should be the length of the two pieces so that the combined area of the
square and the circle is minimum.
6. A window is in the form of a rectangle surmounted by a semi-circular opening. The total perimeter
of the window is 10m. Find the dimensions of the window to admit maximum light through the
whole opening.

7. An open box with a square base is to be made out of a given iron sheet of area 27 sq.m. Show that
the maximum volume of the box is 13.5 m
8. A point on hypotenuse of right angled triangle is at a distance a and b from the sides Show that
the length of hypotenuse is at least (a2/3 + b2/3)3/2
9. A square piece of tin of side 48 cm is to be made into a box without top, by cutting a square from
each corner and folding up the flaps to form the box. What should be the side of the square to be
cut off, so that the volume of the box is the maximum possible? Also find the maximum volume.
10. Prove that the volume of the largest cone that can be inscribed in a sphere of radius R is 8/27 of the
volume of the sphere.
11. Show that semi-vertical angle of right circular cone of given surface area and maximum volume is
Sin-1(1/3)
12. Awindow is in the form of rectangle surmounted by semi circular opening.The total perimeter of
the window is 'p'.c.m.Show that the window will allow the maximum possible light only when the
redius of semi circle is
13. A rectangle is inscribed in a semi circle or radius a with one of its sides on the diameter of the semicircle. Find the dimensions of the rectangle so that its area is maximum. Find also the area .
14. Show that the surface Area of closed cuboid with square base & given volume is maximum when it
is a cube.
15. Show that the maximum volume of the cylinder which can be inscribed in a sphere of radius 53cm
if 500cm3.
16. A large window has the shape of a rectangle surmounted by an equilateral triangle. If the perimeter
of the window is 12m find the dimensions of the rectangle that will produce the largest area of the
window.
17. Prove that the radius of the right circular cylinder of greatest curved surface area which can be
inscribed in a given cone is half that of the cone.
18. A wire of length 36cm is cut into two pieces. One of them is turned into square and other is into
equilateral triangle. Find the length of each piece so that the sum of the areas of two is minimum
19. Show that the height of the cylinder of maximum volume that can be inscribed in a sphere of radius
R is 2R/3
20. The sum of the perimeter of a circle and square is k, where k is some constant. Prove that the sum
of their areas is least when the side of square is double the radius of the circle.

21. If the lengths of three sides of trapezium other than base are equal to 10 cm, then find the area of
the trapezium when it is maximum.
22. Given the sum of the perimeter of a square and a circle, show that the sum of their areas is least
when the side of the square is equal to diameter of circle.
23. Find a point on the parabola y2 = 4x which is nearest to the point (2,-8)

24. Show that the right circular cone of least curved surface and given volume has an altitude equal
to2 times the radius of the base.
25. A given quantity of metal is to be cast into a solid half circular cylinder( i.e. with rectangular base
and semicircular ends).Show that the surface area may be minimum, if the ratio of the length of the
cylinder to the diameter of its circular ends is : + 2.
26. A window is in the form of a rectangle surmounted by a semi circular opening . The total perimeter
of the window is 10m. Find dimensions of the window to admit maximum light through the whole
opening.
27. An open box with a square base is to be made out of a given quantity of sheet of area a2 . Show that
the maximum volume of the box is a3 / 63.
28. An open tank with square base and vertical sides is to be constructed from a metal sheet so as to
hold given quantity of water. Show that the cost of the material will be least when the depth of the
tank is half of its width.
29. Show that the height of a closed circular cylinder of given total surface are and maximum volume
is equal to the diameter its base.
30. A Cylindrical container with a capacity of 20 cubic feet is to be produced. The top and bottom of
the container are to be made of a material that costs Rs.6 per squares foot while the side of the
container is made of material costing Rs.3 per squares foot. Find the dimension that will minimize
the total cost.
31. Show that the volume of the greatest cylinder which can be inscribed in a cone of height h and
semi-vertical angle 300 is 4/81 h3.
32. Find the largest possible area of a right angled triangle whose hypotenuse is 5cm long.
33. Find two positive numbers whose sum is 16 and sum of whose cube is minimum.
34. Show that the rectangle of maximum perimeter which can be inscribed in a circle of radius a is
square of side 2 a.
35. A tank with rectangular base and rectangular sides, open at the top is to be constructed so that its
depth is 2m and volume is 8m. If building of tank cost Rs. 70 per square meters for the base and
Rs. 45 per square meters for sides. What is the cost of least expensive tank?
36. Show that the triangle of maximum area that can be inscribed in a given circle is an equilateral
triangle.
37. Prove that :
38. Prove that : tan x > x for x (0,/2).
39. Find the intervals on which the following functions are
(a) strictly increasing and
(b) strictly decreasing: f(x) = (x+2)e-x.
40. f(x) = x4 4x3 + 4x2 + 15.

Functions and Relations (1 Mark)

Page 1 of 5
1. Is the function f: N N, defined by f(x) = 3x, onto? Give reasons.
2. If f(x) = [ x ] and g (x) = x , then evaluate (f o g) (1/2) (g o f) (-1/2).
3. If tan-11 + tan-1(1/2) = tan-1, find .
4. 1If A and B are two sets such that n (A) = m and n (B) = n then write number of function from A
B.
5. Let f : R { - 4/3} R be a function defined as f(x) = 4x / 3x+4. Find the inverse of f.
6. Find the value of tan-1(1) + cos-1(-1/2) + sin -1 (-1/2).
7. Evaluate Sin [ sin-1 (-1)].
8. Let set A contains 3 elements. Write the total number of binary operation possible.
9. Let * be a binary operation defined on the set of integers as a*b=a+b+1 for a, b I. Find the
identity element.
10. Prove that cos2(tan-12)+sin2(cot-13) = 3/10.
11. What is the principal value of cos-1(cos 2 /3)+sin-13(sin 2 /3).
12. If f(x) = 8x3 and g(x) = x1/3 , find g o f.
13. Find the value of sin-1(sin 3/5).
14. Show that the signum function f : R R given by f(x) = 1, if x is greater than 0, if x = 0, - 1, if x is
less than 0 is neither one-to-one nor onto.
15. If

, find f o g.

16. N N, defined by f(x) = 3x onto?Give Reasons.


17. If a binary operation * is defined on the set Z of integers as a*b = 3a b, then find the value of
(2*3)*4.
18. Prove that sec2 (tan -1 2) + cosec2 (cot -1 3) = 15.
19. How many relations can be defined from a non-empty set A to non-empty set B , if n(A) = 2 and
n(B)=3.
20. Find the principal value of tan-1[sin(sin-1x+cos-1x)] , x [ -1,1] .
21. Evaluate sin{ 1/2 cos -1(4/5) }.
22. Find gof(-5/2) and fog(3/2) if f is identity function and g is signum function .
23. Evaluate the value of cos -1(-1/2) + Sin -1(-3/2).
24. If : R R ,a,b,c,d R such that (a,b) *(c,d) = (ac, b + ad) Find the identity element of the function.
25. Let * be a binary operation defined by a * b =2ab-7. Is * associative?

26. Write the range of one branch of sin -1 x, other than the Principal Branch.
27. If f(x) = x-1 / x+1;

, then find f -1(x ).

28. Find the value of cosec (sec -1 +cosec -1 ).


29. Evaluate : Cos (/3- sin-1(-3/2)).
30. Show that the function f: R R such that f(x) = x2 is neither one one nor onto.
31. If f(x) = x + 7 and g(x) = x 7, x R, find (fog) (7).
32. Let * be a binary operation on N given by a * b = H.C.F. ( a , b ) , a, b N. Find 12 * 4.
33. if f(x)=x2-1 and g(x)=2x+3 find fog(2).
34. if sin(sin-1 1/5 + cos-1 x) = 1, then find the value of x.
35. Evaluate: sin [ /3 - sin-1(-1/2) ].
36. Which of the following graph represent a function .

37. Write the range of one branch of cos x, other than the principal branch.
38. Which one of the following graphs represents an identity function? Why?

39. Let A = {1, 2, 3) and B = {4, 5, 6}, f: A B is a function defined on f(1) = 4, f(2)=5and f(3) = 6. Write the
inverse as set of ordered pairs.
40. Let * be the binary operation on N defined by a*b = a+b+10 for all a, b N and if 3*p=15 then find p.
41. Find the value of the parameter for which the function is the inverse of itself.
42. If f(x) = ex and g(x) = logex , find fog and gof. Is fog = gof ?
unctions and Relations (4/6 Mark)
Page 3 of 5

1. Consider f : R [ -5, ) given by f(x) = 9x2+ 6x-5. Show that f is invertible with
.

2. Prove that:
3. Consider
defined by f(1) = a, f(2) =
b, f(3) = c, g(a) = apple, g(b) = ball ,g(c) = cat. Show that f, g and gof are invertible. Find out f-1 , g1
and (gof)-1 and show that (gof)-1 = f-1o g-1.
4. Let A = N x N and * be the binary operation on A defined by (a,b)*(c,d) = (a + c, b+d). Show that *
is commutative and associative. Find the identity element for * on A, if any.

5. Find the value of x if


6. Let f: NR be a function defined as f(x) = 4x2 + 12 x + 15, where S is the range of f. Show that f:
N S is invertible. Find f-1.

7. Prove that
8. Prove: 2 tan-1(1/2) + tan-1(1/7) = tan-1(31/17)
9. Solve for x: tan-12x + tan-13x = /4
10. Prove that the function f: R R defined as f(x) = 2x-3 is invertible and find f-1(x)
11. Show that sin-1 12 /13 + cos-1 4/5 + tan-1 63/16 = .
12. Show that the relation are in the set a = {x : x w, x 10}given by
is an equivalence relation , find the elements related to 3.
13. Examine if the following are binary operations
(i) a*b =a+b/2,a,b N
(ii) a*b=a+b/2, a,b Q .

14. Let

be a function defined as

15. Prove that

16. Prove: 2 tan-11/2) + tan-1(1/7) = tan-1(31/17).


17. Solve for x: tan-12x + tan-13x = /4.
18. Solve for x : 2 tan-1( cos x ) = tan-1 ( 2 cosec x ).

19. Find the value of

, find f-1 : Range of

20. Find the value of


21. Prove that tan -1 (1/5) + tan -1 (1/7) + tan -1 (1/3) + tan -1 (1/8) = 1.

22. Prove that

23. Prove that

24. Prove that

25. Write in simplest form:

26. Prove that tan -1 3/4 + tan -1 3/5 tan -1 8/15 = /4.
27. Show that the binary operation * defined by a*b = a b, on Z is not commutative and associative..
28. Let f : x y and g : y z be two invertible functions. Then gof is also with (gof)-1 = f-1 o g-1.
29. Show that the function f: Z Z given by f(x) = x is not injective.

30. Evaluate :

31. Solve for

32. If
33. Check whether the operator

.
define by a

b=a+b -ab is commutative or aasociative.

34. if

35. Proved that

36. Let A =NxN and Let * be a binary operation on A defined by (a,b)*(c,d) = (ad+bc,bd) for all (a,b),(c,d)
NxN.Determine if * is commutative, associative,
37. Solve for

38. Prove that:

39. If the function f : RR defined by ,Prove that f is one-one and onto function. Also find the inverse of the
function f and f-1(23) .

40. Solve for

41. If

find f(f(x))

42. Solve for x:

43. If

show that f(f(x)) is an identity function.

44. Show that the relation R in the set A= {x Z ; 0 x 12} given by R = { ( a,b) : |a-b| is multiple of
4}is an equivalence relation . Also find the set of all elements related to 4.
45. Check whether the relation R defined in the set {1,2,3,4,5,6} as R = { (a,b): b = a +1} is reflexive,
symmetric or transitive.
46. Let A = {-1,0,1,2}, B = [ -4,-2,0,2} and f , g : A B be the function defined by f(x) = x2 x , x A
and g(x) = 2| x - 1/2 | , x A ; are f and g equal. Justify your answer.
47. Show that f [ 1, -1 ] R given by f(x) = x/x+2 is one-one. Find the inverse of function. f: [ -1 ,1] &
Range (f).

48. Express

in the simplest form.

49. Let
bijection

given by f(x)= x| x |is a

50. If f, g : R Rare defined respectively by Find


i) fog
ii) gof
iii) fof
iv) gog
51. Let f, g : R R be two functions such that

Find f(x) and g(x).

52. Consider f, g : N N and h : N Rdefined as f(x) = 2x, g(y)= 3y+4, and h(z)= Sin z for all x,y,z
NShow that ho(gof) = (hog)of
53. Let

54. Let

and

. Find

is a bijection