learnfastreview.com.

ph
(0917) 327-9436, (02) 523-0475

NMAT CHEMISTRY SIMULATIONS (MOCK 3R)

DIRECTIONS: Select the best answer to each of the following questions and blacken the appropriate space on your answer
sheet.

1. Given:
𝑃 → 𝑃𝐻3 + 𝐻2 𝑃𝑂2 − (alkaline) For numbers 10 and 11, consider this situation. Paul found a
When balanced, what will be the sum of the coefficients of certain unknown compound to be 31.0% carbon, 5.2%
the products? hydrogen, 27.6% oxygen, and 36.2% nitrogen. The
a. 3 b. 4 c. 13 d. 14 molecular weight was experimentally determined to be
approximately 460.
2. Which of the following is not a conjugate acid-base pair? Atomic Weights:
a. 𝑁𝐻4 +, 𝑁𝐻3 c. 𝐻2 𝑂, 𝑂𝐻 − H=1 C = 12
b. 𝑁𝐻3 , 𝑁𝐻2 −
d. 𝐻2 𝑆𝑂4 , 𝑂𝐻 − N = 14 O = 16

3. What nuclear process occurred if 226

88𝑋 results from the 10. What is the empirical formula of the compound?
emission of particle by 226
89𝑌 ? a. C3H6O2N3 c. C6H10O5N5
a.  decay b. - decay c. + decay d. K-electron capture b. C5H2ON3 d. C10H20O7N10

4. In the combustion of ethyne in oxygen, 8 g of O2 was 11. Which is a possible molecular formula for the
present. Ideally, what amount of ethyne could have reacted compound?
with all that O2, and how much CO2 could have been a. C4H2O(NO)5(CO)2(NH2)5(CH)6(OH)2
produced? b. C4(NO)4(CO)2(NH2)8(CH)6(OH)2
a. 13 g ethyne; 11 g CO2 c. C18H2O2(CO)2(NH2)4(CH3)4(OH)2
b. 2.3 g ethyne; 7.3 g CO2 d. C18H2(CO)2(NH2)6(CH3)4(OH)2
c. 3.2 g ethyne; 6.4 g CO2
d. 2.6 g ethyne; 8.8 g CO2 For numbers 12 and 13 consider this situation. A sample of
0.025 M KOH stands at 250C, where 100.4  2.5
5. What kind of particle was emitted if 258
101𝐴 underwent
decay and the result was 254
99𝐵 ? 12. What is the pH of this sample?
a. alpha particle c. positron a. 1.6 c. 13
b. electron d. gamma ray b. 12.4 d. 13.6

6. Fusion is most likely to occur with the: 13. What is the pOH of this sample?
a. Combination of 2 1H nuclei a. 1.6 c. 13
b. Combination of 2 2H nuclei b. 12.4 d. 13.6
c. Splitting apart of a single 244
95𝐴𝑚 nucleus
d. Splitting apart of a single 245
95𝐴𝑚 nucleus
14. Given this graph:

7. Mike can prepare methanol from bromomethane by

adding _____ to the latter.
a. Hydrogen gas c. Sulfuric acid
b. Sodium hydroxide d. Heat energy and light

8. At 250C in the equilibrium

𝑁2 (𝑔) + 𝑂2 (𝑔) ↔ 2𝑁𝑂
Kp = 4.8 x 10-31
which species will dominate?
a. NO and O2 c. N2 and O2
b. N2 and NO d. None

9. If the equilibrium constant KC for

What type of reaction does the forward reaction represent?
𝐹2 (𝑔) ↔ 2𝐹 (𝑔)
a. Endothermic c. Both A and B
At a certain temperature is 7.3 x 10-13, what is KC for
1 b. Exothermic d. Neither A nor B
𝐹2 (𝑔) ↔ 𝐹 (𝑔)?
2
a. √7.3 × 10−13 c. 1.37 x 10-12
b. 3.65 x 10-13 d. 7.3 x 10-13
1
15. NO2 is a gas whose density is 73.5 g/L. What pressure 21. What happens to aluminium in the reaction:
will it exert at a temperature of 270C? 2𝐴𝑙 + 3𝑁𝑖(𝑁𝑂3 )2 → 2𝐴𝑙(𝑁𝑂3 )3 + 3𝑁𝑖
a. 43.05 atm c. 86.10 atm
b. 81.81 atm d. 1808.10 atm a. Reduced and its oxidation number increases
b. Reduced and its oxidation number decreases
16. If 25
13𝐾𝑦 emits a gamma ray, then the daughter nucleus c. Oxidized and its oxidation number increases
is: d. Oxidized and its oxidation number decreases
a. 24
13𝐾𝑦 c. 21
11𝑁𝑐
b. 13𝐾𝑦
25
d. 24
14𝑆ℎ𝑓 22. The Law of Multiple Proportions applies to what pair of
For numbers 17 and 18, refer to the following periodic table. compounds?
a. KCl and KClO3 c. H2O and H2O2
b. MgSO4 and MnSO4 d. NaBr and NaCl

23. Which procedure is most likely to increase the solubility

of a gas in a liquid?
a. Constant stirring c. Adding more solvent
b. Heating the solution d. Increasing the pressure

24. Along a row in the periodic table, elements have the

same:
17. Which pair of elements below has the highest and a. Energy level c. Atomic radius
lowest electron affinities, respectively? b. Electronegativity d. Ionization energy
a. He and Rn c. Ac and F
b. F and Fr d. Li and Nb 25. What is the correct identity of X in the reaction:
91𝑃𝑎 → 𝑋 + −1𝛽 ?
234 0

18. Which of the following are all metalloids? a. 92𝑈

234
c. 90𝑇ℎ
234

a. Sc, Lr, Zn, Uub c. Ge, As, Te b. 235

92𝑈 d. 232
90𝑇ℎ
b. B, O, F, Ne d. Ne, Ar, Kr
26. The half-life, t1/2, of radioactive phosphorous, 32P, is 14
19. What will be the product of the following reaction? days. Given 1.0 mg 32P, how much will remain after 42
days?
a. 0.5 mg c. 0.125 mg
b. 1.25 mg d. None

27. Which statement is NOT true?

a. An element melts at a definite temperature.
b. An element is changed into another substance by heat in
the absence of air or another substance.
c. An element may combine with another to form a
compound.
d. An element is made of the same kind of atom.

28. Which of the following is a property of all metals?

a. All are hard.
b. All are combined easily with oxygen.
c. All are solids at room temperature.
d. All are conductors of heat and electricity.

29. No two electrons in the same atom can have the same
set of quantum numbers is the statement of:
a. Hund’s Rule of Multiplicity
b. Dalton’s Atomic Theory
c. Heisenberg’s Uncertainty Principle
d. Pauli’s Exclusion Principle

30. As you enter a building, you observe a beam of light

20. In which substance is the oxidation state of nitrogen from the glass roof. What is the phenomenon?
zero? a. Brownian movement c. Tyndall effect
a. N2 c. NO2 b. Peptization d. Adsorption
b. NH3 d. N2O

2
31. Which of the following substances will exhibit the 39. The molecular weight of a substance is 128 and its
highest boiling point? equivalent weight in a particular reaction is 24. A 1.0 M
a. CCl4 c. CH4 solution of this substance will have a normality of:
b. CO2 d. Cl2HCCHCl2 a. 5.33 N b. 0.50 N c. 2 N d. 0.25 N

32. Which of the following is/are true? 40. What volume of 0.1 M NaOH is needed to neutralize 25
a. At 1 atm the boiling point of water is 1000C. mL of 0.1 M H2SO4?
b. The vapour pressure of 40 mL of water heated at 400C is a. 12.5 mL b. 25 mL c. 50 mL d. 100 mL
twice the vapour pressure of 20 mL of water heated at the
same temperature. 41. What is the normality of an acid solution if 50 mL of the
c. Generally, non-polar substances have higher boiling solution requires 48.16 mL of 0.1879 N alkali for
points than polar substances. neutralization?
d. Choices a and b are true. a. 0.4000 N c. 0.1827 N
b. 0.2678 N d. 0.1274 N
33. Which substance evaporates more rapidly at a given
temperature? 42. Which is the conjugate base of H2SO4?
a. Substance that has high vapour pressure at room a. SO3-2 b. S-2 c. HSO3- d. HSO4-
temperature
b. Substance with molecules having strong forces of 43. Which statement best describes a solution with a pH of
attraction 3?
c. Substance with high boiling temperature a. It has an H+ concentration of 1 x 103 and is acidic.
d. Substance with high heat of vaporization b. It has an H+ concentration of 1 x 10-3 and is acidic.
c. It has an H+ concentration of 1 x 103 and is basic.
34. What is the maximum number of grams of water at d. It has an H+ concentration of 1 x 10-3 and is basic.
100C that can be heated to 300C by the addition of 40
calories of heat? 44. Which of the following will produce a solution with a pH
a. 1.0 c. 20 less than 7?
b. 2.0 d. 30 a. KCN b. K2SO4 c. NH4Cl d. NaNO3

35. Exothermic is a term used to describe a reaction: 45. In any of the p, d, or f orbitals, electrons tend to occupy
a. That occurs at a low temperature separate orbitals before any orbital can have two electrons.
b. For which heat is a reactant This principle is referred to as:
c. For which heat is a product a. de Broglie’s Principle c. Aufbau’s Principle
d. That occurs at a high temperature b. Pauli’s Exclusion Principle d. Hund’s Principle

36. Which type of reaction does the Haber process below 46. If 75% of the isotopes of an element have a mass of 35
represent? amu and 25% of the isotopes have a mass of 37 amu, what
𝑁2 (𝑔) + 3𝐻2 (𝑔) → 2𝑁𝐻3 (𝑔) + 𝐻𝑒𝑎𝑡 is the atomic mass of the element?
a. Exothermic, with an increase in entropy a. 35 amu c. 36 amu
b. Exothermic, with a decrease in entropy b. 35.5 amu d. 37 amu
c. Endothermic, with an increase in entropy
d. Endothermic, with a decrease in entropy 47. Which of the following molecules is the most acidic?
a. CH3COOH c. CHCl2CH2COOH
37. Which change would most likely increase the rate of a b. CH2ClCOOH d. CH3CCl2COOH
chemical reaction?
a. Decreasing the reactants’ concentration 48. If propylene is shaken with cold neutral KMnO4 solution,
b. Decreasing the reactants’ surface the primary organic compound will be:
c. Cooling the reaction mixture a. CH3CH(OH)CH2OH c. CH3CH2CH2OH
d. Adding a catalyst to the reaction mixture b. CH3CH2CH2MnO4 d. CH2(OH)CH(OH)CH2OH

38. Given the reaction below at equilibrium. 49. When propyne reacts with 2 moles of HBr, the major
𝑋2 (𝑔) + 2𝑌2 (𝑔) ↔ 2𝑋𝑌2 (𝑔) + 80 𝑘𝑐𝑎𝑙 product formed is :
The equilibrium point will shift to the left if the pressure is: a. 1,1-dibromopropane c. 2,2-dibromopropane
a. Increased and the temperature is increased b. 1,2-dibromopropane d. 1-bromopropane
b. Increased and the temperature is decreased
c. Decreased and the temperature is increased 50. Which compound contains double bonds, does not
d. Decreased and the temperature is decreased decolorize bromine water, and reacts with chlorine in the
presence of ferric chloride?
a. Ethyl alcohol c. Benzene
b. Butane d. Cyclohexene